Initial Commit

.gitignore

@@ -0,0 +1 @@
+*.jar

Readme.md

@@ -0,0 +1,9 @@
+# Community Chest
+A 1.10 minecraft modpack for Clockwork Gaming. Downloadable through the [Clockwork Launcher](http://cwgaming.co.uk/modpack/ClockworkLauncher.jar).
+
+This modpack has been designed with the [SkCraft launcher](https://github.com/SKCraft/Launcher).
+
+## Changelog
+
+### V1:
+* Initial release.

loaders/forge-1.10.2-12.18.1.2094-installer.jar.url.txt

@@ -0,0 +1 @@
+http://files.minecraftforge.net/maven/net/minecraftforge/forge/1.10.2-12.18.1.2094/forge-1.10.2-12.18.1.2094-installer.jar

modpack.json

@@ -0,0 +1,65 @@
+{
+  "name" : "Community Chest",
+  "title" : "Community Chest - CwG Autumn '16",
+  "gameVersion" : "1.10.2",
+  "features" : [
+    {
+      "properties" : {
+        "name" : "Inventory Tweaks",
+        "description" : "Inventory sorting and management.",
+        "recommendation" : "starred",
+        "selected" : true
+      },
+      "files" : {
+        "include" : [
+          "config/InvTweaks.cfg",
+          "mods/InventoryTweaks*.jar"
+        ],
+        "exclude" : [ ]
+      }
+    },
+    {
+      "properties" : {
+        "name" : "JourneyMap",
+        "description" : "A minimap to show the terrain around you",
+        "recommendation" : null,
+        "selected" : false
+      },
+      "files" : {
+        "include" : [
+          "mods/journeymap*.jar",
+          "config/journeymap*"
+        ],
+        "exclude" : [ ]
+      }
+    },
+    {
+      "properties" : {
+        "name" : "OptiFine",
+        "description" : "Shaders and redering optimizations.",
+        "recommendation" : "avoid",
+        "selected" : false
+      },
+      "files" : {
+        "include" : [
+          "mods/OptiFine_1.10.2*.jar"
+        ],
+        "exclude" : [ ]
+      }
+    }
+  ],
+  "userFiles" : {
+    "include" : [
+      "options.txt",
+      "optionsshaders.txt",
+      "journeymap/*",
+      "options/chiselandbits_clipboard.cfg"
+    ],
+    "exclude" : [ ]
+  },
+  "launch" : {
+    "flags" : [
+      "-Dfml.ignoreInvalidMinecraftCertificates=true -Xmx 12G"
+    ]
+  }
+}

src/config/AdvGenerators/client.config

@@ -0,0 +1,17 @@
+# Configuration file
+
+display {
+    # Units to use when displaying power. Valid values: MJ, EU, RF, T
+    S:PowerShowUnits=RF
+}
+
+
+tooltips {
+    # If false will only show tooltip in Syngas Producer GUI
+    B:AlwaysShowCarbonTooltip=true
+
+    # If false will only show tooltip in Turbine GUI
+    B:AlwaysShowFuelTooltip=true
+}
+
+

src/config/AdvGenerators/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

src/config/Baubles.cfg

@@ -0,0 +1,2 @@
+# Configuration file
+

src/config/BloodMagic/BloodMagic.cfg

@@ -0,0 +1,409 @@
+# Configuration file
+
+##########################################################################################################
+# blood altar sacrificial values
+#--------------------------------------------------------------------------------------------------------#
+# Entity Sacrificial Value Settings
+##########################################################################################################
+
+"blood altar sacrificial values" {
+    # Used to edit the amount of LP gained per sacrifice of the given entity.
+    # Setting an entity to 0 effectively blacklists it.
+    # If a mod modifies an entity via the API, it will take precedence over this config.
+    # Syntax: EntityClassName;LPPerSacrifice [default: [EntityVillager;2000], [EntitySlime;150], [EntityEnderman;200], [EntityCow;250], [EntityChicken;250], [EntityHorse;250], [EntitySheep;250], [EntityWolf;250], [EntityOcelot;250], [EntityPig;250], [EntityRabbit;250]]
+    S:entitySacrificeValues <
+        EntityVillager;2000
+        EntitySlime;150
+        EntityEnderman;200
+        EntityCow;250
+        EntityChicken;250
+        EntityHorse;250
+        EntitySheep;250
+        EntityWolf;250
+        EntityOcelot;250
+        EntityPig;250
+        EntityRabbit;250
+     >
+}
+
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# Client only settings
+##########################################################################################################
+
+client {
+    # Always renders the beams between routing nodes. If false, only renders while a Node Router is being held. [default: false]
+    B:alwaysRenderRoutingLines=false
+
+    # Spectral Blocks (Used by the Suppression Sigil to store fluids) will not render at all. If false, a see through texture will render. [default: true]
+    B:invisibleSpectralBlocks=true
+
+    # The Sigil of Holding will skip empty sigil slots if set to true. [default: false]
+    B:sigilHoldingSkipsEmptySlots=false
+}
+
+
+##########################################################################################################
+# compatibility
+#--------------------------------------------------------------------------------------------------------#
+# Compatibility settings
+##########################################################################################################
+
+compatibility {
+
+    waila {
+        # The mode for the Waila display on Blood Altars.
+        # 0 - Always display information
+        # 1 - Only display when Divination/Seer sigil is in hand.
+        # 2 - Only display when Divination/Seer sigil is in inventory [range: 0 ~ 2, default: 1]
+        I:wailaAltarDisplayMode=1
+    }
+
+    thaumcraft {
+        # Allows the Living Helmet to be upgraded with Goggles of Revealing in an Anvil. [default: true]
+        B:thaumcraftGogglesUpgrade=true
+    }
+
+    compression {
+        # Compression decided to add a storage recipe for every item and block in the game. This will make the Sigil of Compression ignore those recipes so your game will actually load in a decent amount of time. [default: true]
+        B:ignoreCompressionSpamAddedByCompression=true
+    }
+
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# General settings
+##########################################################################################################
+
+general {
+    # Allows logging information to the console. Fatal errors will bypass this [default: true]
+    B:enableLogging=true
+
+    # Amount of LP received per damage point (not heart!) [range: 0 ~ 10000, default: 100]
+    I:sacrificialDaggerConversion=200
+
+    # Damage done from using the Sacrificial Dagger [range: 0 ~ 10000, default: 2]
+    I:sacrificialDaggerDamage=2
+
+    # Base multiplier for the Coat of Arms. DamageDealt * sacrificialPackConversion [range: 0 ~ 100, default: 20]
+    I:sacrificialPackConversion=20
+}
+
+
+##########################################################################################################
+# item/block blacklisting
+#--------------------------------------------------------------------------------------------------------#
+# Allows disabling of specific Blocks/Items.
+# Note that using this may result in crashes. Use is not supported.
+##########################################################################################################
+
+"item/block blacklisting" {
+    # Blocks to not be registered. This requires their mapping name. Usually the same as the class name. Can be found in F3+H mode. [default: ]
+    S:blockBlacklist <
+     >
+
+    # Items to not be registered. This requires their mapping name. Usually the same as the class name. Can be found in F3+H mode. [default: ]
+    S:itemBlacklist <
+     >
+}
+
+
+##########################################################################################################
+# meteors
+#--------------------------------------------------------------------------------------------------------#
+# Meteor settings
+##########################################################################################################
+
+meteors {
+    # Should the default meteors be regenerated if the mod has updated them [default: true]
+    B:resyncOnVersionChange=true
+}
+
+
+##########################################################################################################
+# potions
+#--------------------------------------------------------------------------------------------------------#
+# Potion settings
+##########################################################################################################
+
+potions {
+
+    ##########################################################################################################
+    # id
+    #--------------------------------------------------------------------------------------------------------#
+    # Potion ID settings
+    ##########################################################################################################
+
+    id {
+        # ID of the Amphibian potion [range: 20 ~ 256, default: 116]
+        I:customPotionAmphibianID=116
+
+        # ID of the Boost potion [range: 20 ~ 256, default: 101]
+        I:customPotionBoostID=101
+
+        # ID of the Deaf potion [range: 20 ~ 256, default: 113]
+        I:customPotionDeafID=113
+
+        # ID of the Demon Cloak potion [range: 20 ~ 256, default: 115]
+        I:customPotionDemonCloakID=115
+
+        # ID of the Drowning potion [range: 20 ~ 256, default: 100]
+        I:customPotionDrowningID=100
+
+        # ID of the Feather Fall potion [range: 20 ~ 256, default: 114]
+        I:customPotionFeatherFallID=114
+
+        # ID of the Fire Fuse potion [range: 20 ~ 256, default: 109]
+        I:customPotionFireFuseID=109
+
+        # ID of the Flame Cloak potion [range: 20 ~ 256, default: 106]
+        I:customPotionFlameCloakID=106
+
+        # ID of the Flight potion [range: 20 ~ 256, default: 104]
+        I:customPotionFlightID=104
+
+        # ID of the Heavy Heart potion [range: 20 ~ 256, default: 108]
+        I:customPotionHeavyHeartID=108
+
+        # ID of the Ice Cloak potion [range: 20 ~ 256, default: 107]
+        I:customPotionIceCloakID=107
+
+        # ID of the Inhibit potion [range: 20 ~ 256, default: 103]
+        I:customPotionInhibitID=103
+
+        # ID of the Planar Binding potion [range: 20 ~ 256, default: 110]
+        I:customPotionPlanarBindingID=110
+
+        # ID of the Projectile Protection potion [range: 20 ~ 256, default: 102]
+        I:customPotionProjProtID=102
+
+        # ID of the Reciprocation potion [range: 20 ~ 256, default: 105]
+        I:customPotionReciprocationID=105
+
+        # ID of the Soul Fray potion [range: 20 ~ 256, default: 111]
+        I:customPotionSoulFrayID=111
+
+        # ID of the Soul Harden potion [range: 20 ~ 256, default: 112]
+        I:customPotionSoulHardenID=112
+    }
+
+    ##########################################################################################################
+    # toggle
+    #--------------------------------------------------------------------------------------------------------#
+    # Toggle potions available in Alchemy
+    ##########################################################################################################
+
+    toggle {
+        # Enables the Amphibian potion in Alchemy [default: true]
+        B:customPotionAmphibianEnabled=true
+
+        # Enables the Boost potion in Alchemy [default: true]
+        B:customPotionBoostEnabled=true
+
+        # Enables the Deaf potion in Alchemy [default: true]
+        B:customPotionDeafEnabled=true
+
+        # Enables the Demon Cloak potion in Alchemy [default: true]
+        B:customPotionDemonCloakEnabled=true
+
+        # Enables the Drowning potion in Alchemy [default: true]
+        B:customPotionDrowningEnabled=true
+
+        # Enables the Feather Fall potion in Alchemy [default: true]
+        B:customPotionFeatherFallEnabled=true
+
+        # Enables the Fire Fuse potion in Alchemy [default: true]
+        B:customPotionFireFuseEnabled=true
+
+        # Enables the Flame Cloak potion in Alchemy [default: true]
+        B:customPotionFlameCloakEnabled=true
+
+        # Enables the Flight potion in Alchemy [default: true]
+        B:customPotionFlightEnabled=true
+
+        # Enables the Heavy Heart potion in Alchemy [default: true]
+        B:customPotionHeavyHeartEnabled=true
+
+        # Enables the Ice Cloak potion in Alchemy [default: true]
+        B:customPotionIceCloakEnabled=true
+
+        # Enables the Inhibit potion in Alchemy [default: true]
+        B:customPotionInhibitEnabled=true
+
+        # Enables the Planar Binding potion in Alchemy [default: true]
+        B:customPotionPlanarBindingEnabled=true
+
+        # Enables the Projectile Protection potion in Alchemy [default: true]
+        B:customPotionProjProtEnabled=true
+
+        # Enables the Reciprocation potion in Alchemy [default: true]
+        B:customPotionReciprocationEnabled=true
+
+        # Enables the Soul Fray potion in Alchemy [default: true]
+        B:customPotionSoulFrayEnabled=true
+
+        # Enables the Soul Harden potion in Alchemy [default: true]
+        B:customPotionSoulHardenEnabled=true
+
+        # Enables the Absorption potion in Alchemy [default: true]
+        B:vanillaPotionAbsorptionEnabled=true
+
+        # Enables the Blindness potion in Alchemy [default: true]
+        B:vanillaPotionBlindnessEnabled=true
+
+        # Enables the Fire Resistance potion in Alchemy [default: true]
+        B:vanillaPotionFireResistEnabled=true
+
+        # Enables the Health Boost potion in Alchemy [default: true]
+        B:vanillaPotionHealthBoostEnabled=true
+
+        # Enables the Instant Health potion in Alchemy [default: true]
+        B:vanillaPotionHealthEnabled=true
+
+        # Enables the Invisibility potion in Alchemy [default: true]
+        B:vanillaPotionInvisibilityEnabled=true
+
+        # Enables the Jump Boost potion in Alchemy [default: true]
+        B:vanillaPotionJumpBoostEnabled=true
+
+        # Enables the Mining potion in Alchemy [default: true]
+        B:vanillaPotionMiningEnabled=true
+
+        # Enables the Night Vision potion in Alchemy [default: true]
+        B:vanillaPotionNightVisionEnabled=true
+
+        # Enables the Poison potion in Alchemy [default: true]
+        B:vanillaPotionPoisonEnabled=true
+
+        # Enables the Regeneration potion in Alchemy [default: true]
+        B:vanillaPotionRegenerationEnabled=true
+
+        # Enables the Resistance potion in Alchemy [default: true]
+        B:vanillaPotionResistanceEnabled=true
+
+        # Enables the Saturation potion in Alchemy [default: true]
+        B:vanillaPotionSaturationEnabled=true
+
+        # Enables the Slowness potion in Alchemy [default: true]
+        B:vanillaPotionSlownessEnabled=true
+
+        # Enables the Speed potion in Alchemy [default: true]
+        B:vanillaPotionSpeedEnabled=true
+
+        # Enables the Strength potion in Alchemy [default: true]
+        B:vanillaPotionStrengthEnabled=true
+
+        # Enables the Water Breathing potion in Alchemy [default: true]
+        B:vanillaPotionWaterBreathingEnabled=true
+
+        # Enables the Weakness potion in Alchemy [default: true]
+        B:vanillaPotionWeaknessEnabled=true
+    }
+
+}
+
+
+##########################################################################################################
+# rituals
+#--------------------------------------------------------------------------------------------------------#
+# Ritual toggling
+##########################################################################################################
+
+rituals {
+    B:ritualAltarBuilder=true
+    B:ritualAnimalGrowth=true
+    B:ritualArmourEvolve=true
+    B:ritualCobblestone=true
+    B:ritualContainment=true
+    B:ritualCrushing=true
+    B:ritualCrystalHarvest=true
+    B:ritualExpulsion=true
+    B:ritualFeatheredKnife=true
+    B:ritualFelling=true
+    B:ritualForsakenSoul=true
+    B:ritualFullStomach=true
+    B:ritualGreenGrove=true
+    B:ritualHarvest=true
+    B:ritualInterdiction=true
+    B:ritualJumping=true
+    B:ritualLava=true
+    B:ritualMagnetic=true
+    B:ritualPlacer=true
+    B:ritualPortal=true
+    B:ritualPump=true
+    B:ritualRegeneration=true
+    B:ritualRemove=true
+    B:ritualSpeed=true
+    B:ritualSuppression=true
+    B:ritualWater=true
+    B:ritualWellOfSuffering=true
+    B:ritualZephyr=true
+
+    imperfect {
+        B:imperfectRitualNight=true
+        B:imperfectRitualRain=true
+        B:imperfectRitualResistance=true
+        B:imperfectRitualZombie=true
+    }
+
+}
+
+
+##########################################################################################################
+# teleposer blacklist
+#--------------------------------------------------------------------------------------------------------#
+# Block blacklisting
+##########################################################################################################
+
+"teleposer blacklist" {
+    # Stops specified blocks from being teleposed. Put entries on new lines. Valid syntax is:
+    # modid:blockname:meta [default: [minecraft:bedrock], [minecraft:mob_spawner]]
+    S:teleposerBlacklist <
+        minecraft:bedrock
+        minecraft:mob_spawner
+     >
+
+    # Entity class names listed here will not be able to be teleposed. [default: ]
+    S:teleposerBlacklistEntity <
+     >
+}
+
+
+##########################################################################################################
+# transposition sigil blacklist
+#--------------------------------------------------------------------------------------------------------#
+# Block blacklisting
+##########################################################################################################
+
+"transposition sigil blacklist" {
+    # Stops specified blocks from being teleposed. Put entries on new lines. Valid syntax is:
+    # modid:blockname:meta [default: [minecraft:bedrock], [minecraft:mob_spawner]]
+    S:transpositionBlacklist <
+        minecraft:bedrock
+        minecraft:mob_spawner
+     >
+}
+
+
+version {
+    S:"Config Version"=1.9.4-2.1.0-63
+}
+
+
+##########################################################################################################
+# well of suffering blacklist
+#--------------------------------------------------------------------------------------------------------#
+# Entity blacklisting from WoS
+##########################################################################################################
+
+"well of suffering blacklist" {
+    # Use the class name of the Entity to blacklist it from usage.
+    # IE: EntityWolf, EntityWitch, etc [default: ]
+    S:wellOfSufferingBlacklist <
+     >
+}

src/config/BloodMagic/meteors/IronMeteor.json

@@ -0,0 +1,47 @@
+{
+  "catalystStack": {
+    "registryName": {
+      "domain": "minecraft",
+      "path": "iron_block"
+    },
+    "meta": 0
+  },
+  "components": [
+    {
+      "weight": 400,
+      "oreName": "oreIron"
+    },
+    {
+      "weight": 200,
+      "oreName": "oreCopper"
+    },
+    {
+      "weight": 140,
+      "oreName": "oreTin"
+    },
+    {
+      "weight": 70,
+      "oreName": "oreSilver"
+    },
+    {
+      "weight": 80,
+      "oreName": "oreLead"
+    },
+    {
+      "weight": 30,
+      "oreName": "oreGold"
+    },
+    {
+      "weight": 60,
+      "oreName": "oreLapis"
+    },
+    {
+      "weight": 100,
+      "oreName": "oreRedstone"
+    }
+  ],
+  "explosionStrength": 15.0,
+  "radius": 5,
+  "maxWeight": 1000,
+  "version": 2
+}

src/config/Botania.cfg

@@ -0,0 +1,753 @@
+# Configuration file
+
+general {
+    # Set this to false to disable the Adaptative Config. Adaptative Config changes any default config values from old versions to the new defaults to make sure you aren't missing out on changes because of old configs. It will not touch any values that were changed manually.
+    B:adaptativeConfig.enabled=true
+
+    # Set this to false to disable custom armor models.
+    B:armorModels.enable=true
+
+    # Set this to false to disable rendering of baubles in the player.
+    B:baubleRender.enabled=true
+
+    # Set this to false to remove the block breaking particles from the flowers and other items in the mod.
+    B:blockBreakingParticles.enabled=true
+
+    # Set this to false to remove the block breaking particles from the Mana Shatterer, as there can be a good amount in higher levels.
+    B:blockBreakingParticlesTool.enabled=true
+
+    # Set this to false to disable the wireframe when looking a block bound to something (spreaders, flowers, etc).
+    B:boundBlock.wireframe.enabled=true
+
+    # Set this to false to disable the animation when an item is charging on top of a mana pool.
+    B:chargeAnimation.enabled=true
+
+    # Set this to false to disable the Smokey Quartz blocks. This config option is here for those using Thaumic Tinkerer
+    B:darkQuartz.enabled=true
+
+    # Set this to false to disable the particles in the elven portal.
+    B:elfPortal.particles.enabled=true
+
+    # Set to false to disable the ability for the Hand of Ender to pickpocket other players' ender chests.
+    B:enderPickpocket.enabled=true
+
+    # Set this to false to disable the Fallen Kanade flower (gives Regeneration). This config option is here for those using Blood Magic. Note: Turning this off will not remove ones already in the world, it'll simply prevent the crafting.
+    B:fallenKanade.enabled=true
+
+    # Set this to false to disable the fancy skybox in Garden of Glass.
+    B:fancySkybox.enable=true
+
+    # Set this to true to enable the fancy skybox in non Garden of Glass worlds. (Does not require Garden of Glass loaded to use, needs 'fancySkybox.enable' to be true as well)
+    B:fancySkybox.normalWorlds=false
+
+    # The height of the Flugel Tiara flight bar. You can change this if you have a mod that adds a bar in that spot.
+    I:flightBar.height=49
+
+    # The height of the Flugel Tiara flight bar if your breath bar is shown. You can change this if you have a mod that adds a bar in that spot.
+    I:flightBarBreath.height=59
+
+    # Turn this off ONLY IF you're on an extremely large world with an exaggerated count of Mana Spreaders/Mana Pools and are experiencing TPS lag. This toggles whether flowers are strict with their checking for connecting to pools/spreaders or just check whenever possible.
+    B:flower.forceCheck=true
+
+    # The frequency in which particles spawn from normal (worldgen) mystical flowers
+    D:flowerParticles.frequency=0.75
+
+    # The harvest level of the Mana Lens: Bore. 3 is diamond level. Defaults to 3
+    I:harvestLevel.boreLens=3
+
+    # The harvest level of the Mana Lens: Weight. 3 is diamond level. Defaults to 2 (iron level)
+    I:harvestLevel.weightLens=2
+
+    # Set this to true to enable justified text in the Lexica Botania's text pages.
+    B:lexicon.enable.justifiedText=false
+
+    # Set this to false to disable the rotating items in the petal and rune entries in the Lexica Botania.
+    B:lexicon.enable.rotatingItems=true
+
+    # Set this to false to disable the animated 3D render for the Lexica Botania.
+    B:lexicon.render.3D=true
+
+    # Set this to true to invert the Ring of Magnetization's controls (from shift to stop to shift to work)
+    B:magnetRing.invert=true
+
+    # The height of the mana display bar in above the XP bar. You can change this if you have a mod that changes where the XP bar is.
+    I:manaBar.height=29
+
+    # Set this to false to disable the Mana Enchanter. Since some people find it OP or something. This only disables the entry and creation. Old ones that are already in the world will stay.
+    B:manaEnchanter.enabled=true
+
+    # Set this to false to disable the Mana Fluxfield (generates RF from mana). This only disables the entry and creation. Old ones that are already in the world will stay.
+    B:manaFluxfield.enabled=true
+
+    # Set this to true to disable the mana spreader shooting sound.
+    B:manaSpreaders.silent=false
+
+    # Set this to true if you are the chosen one. For lovers of glitch art and just general mad people.
+    B:matrixMode.enabled=false
+
+    # Set this to true to set the power system's particles to be a lot more subtle. Good for low-end systems, if the particles are causing lag.
+    B:powerSystem.subtle=false
+
+    # Set this to true to use the old (non-.obj, pre beta18) pylon model
+    B:pylonModel.old=false
+
+    # Set this to true to use Shift instead of Ctrl for the inventory lexica botania quick lookup feature.
+    B:quickLookup.useShift=false
+
+    # Set this to false to disable the references in the flower tooltips. (You monster D:)
+    B:references.enabled=true
+
+    # Set this to false to disable the Relic System. This only disables the entries, drops and achievements. Old ones that are already in the world will stay.
+    B:relics.enabled=true
+
+    # Set this to false to make the Ring of Odin not apply fire resistance. Mostly for people who use Witchery transformations.
+    B:ringOfOdin.fireResist=true
+
+    # Set this to false to disable seasonal features, such as halloween and christmas.
+    B:seasonalFeatures.enabled=true
+
+    # Set this to false to disable the use of shaders for some of the mod's renders.
+    B:shaders.enabled=true
+
+    # The GL Texture Unit to use for the secondary sampler passed in to the Lexica Botania's category button shader. DO NOT TOUCH THIS IF YOU DON'T KNOW WHAT YOU'RE DOING
+    I:shaders.secondaryUnit=7
+
+    # Do not ever touch this value if not asked to. Possible symptoms of doing so include your head turning backwards, the appearance of Titans near the walls or you being trapped in a game of Sword Art Online.
+    I:spreader.posShift=1
+
+    # Set this to true if you use lots of floating flowers and are experiencing rendering lag. Will disable the floating flowers' animations and render them statically for a major performance boost. Hit F3+A in-world after toggling this.
+    B:staticFloaters.enabled=false
+
+    # Set this to false to disable Thaumcraft Infusion Stabilizing in botania blocks
+    B:thaumraftStabilizers.enabled=true
+
+    # Set this to false to always display all particles regardless of the "Particles" setting in the Vanilla options menu.
+    B:vanillaParticleConfig.enabled=true
+
+    # Set this to false to disable checking and alerting when new Botania versions come out. (keywords for noobs: update notification message)
+    B:versionChecking.enabled=true
+
+    # Set this to true to use a static wand beam that shows every single position of the burst, similar to the way it used to work on old Botania versions. Warning: Disabled by default because it may be laggy.
+    B:wandBeam.static=false
+
+    # The density of each Botania flower patch generated, defaults to 2, the lower the number, the less each patch will have.
+    I:worldgen.flower.density=2
+
+    # The inverse chance for a Botania flower patch to be generated, defaults to 16. The higher this value is the less patches will exist and the more flower each will have.
+    I:worldgen.flower.patchChance=20
+
+    # The size of each Botania flower patch, defaults to 6. The larger this is the farther the each patch can spread
+    I:worldgen.flower.patchSize=6
+
+    # The quantity of Botania flower patches to generate in the world, defaults to 2, the lower the number the less patches generate.
+    I:worldgen.flower.quantity=2
+
+    # The chance for a Botania flower generated in a patch to be a tall flower. 0.1 is 10%, 1 is 100%. Defaults to 0.05
+    D:worldgen.flower.tallChance=0.05
+
+    # The quantity of Botania mushrooms to generate underground, in the world, defaults to 40, the lower the number the less patches generate.
+    I:worldgen.mushroom.quantity=40
+}
+
+
+shedding {
+    # Configuration of Shedding for Bat
+    S:Bat.item=
+    I:Bat.lexiconDisplaySize=40
+    I:Bat.metadata=0
+    I:Bat.rate=-1
+
+    # Configuration of Shedding for BiomesOPlenty.butterfly
+    S:BiomesOPlenty.butterfly.item=
+    I:BiomesOPlenty.butterfly.lexiconDisplaySize=40
+    I:BiomesOPlenty.butterfly.metadata=0
+    I:BiomesOPlenty.butterfly.rate=-1
+
+    # Configuration of Shedding for BiomesOPlenty.pixie
+    S:BiomesOPlenty.pixie.item=
+    I:BiomesOPlenty.pixie.lexiconDisplaySize=40
+    I:BiomesOPlenty.pixie.metadata=0
+    I:BiomesOPlenty.pixie.rate=-1
+
+    # Configuration of Shedding for BiomesOPlenty.snail
+    S:BiomesOPlenty.snail.item=
+    I:BiomesOPlenty.snail.lexiconDisplaySize=40
+    I:BiomesOPlenty.snail.metadata=0
+    I:BiomesOPlenty.snail.rate=-1
+
+    # Configuration of Shedding for BiomesOPlenty.wasp
+    S:BiomesOPlenty.wasp.item=
+    I:BiomesOPlenty.wasp.lexiconDisplaySize=40
+    I:BiomesOPlenty.wasp.metadata=0
+    I:BiomesOPlenty.wasp.rate=-1
+
+    # Configuration of Shedding for Blaze
+    S:Blaze.item=
+    I:Blaze.lexiconDisplaySize=40
+    I:Blaze.metadata=0
+    I:Blaze.rate=-1
+
+    # Configuration of Shedding for BloodMagic.CorruptedZombie
+    S:BloodMagic.CorruptedZombie.item=
+    I:BloodMagic.CorruptedZombie.lexiconDisplaySize=40
+    I:BloodMagic.CorruptedZombie.metadata=0
+    I:BloodMagic.CorruptedZombie.rate=-1
+
+    # Configuration of Shedding for BloodMagic.Mimic
+    S:BloodMagic.Mimic.item=
+    I:BloodMagic.Mimic.lexiconDisplaySize=40
+    I:BloodMagic.Mimic.metadata=0
+    I:BloodMagic.Mimic.rate=-1
+
+    # Configuration of Shedding for BloodMagic.SentientSpecter
+    S:BloodMagic.SentientSpecter.item=
+    I:BloodMagic.SentientSpecter.lexiconDisplaySize=40
+    I:BloodMagic.SentientSpecter.metadata=0
+    I:BloodMagic.SentientSpecter.rate=-1
+
+    # Configuration of Shedding for Botania.botania:doppleganger
+    S:"Botania.botania:doppleganger.item"=
+    I:"Botania.botania:doppleganger.lexiconDisplaySize"=40
+    I:"Botania.botania:doppleganger.metadata"=0
+    I:"Botania.botania:doppleganger.rate"=-1
+
+    # Configuration of Shedding for Botania.botania:pinkWither
+    S:"Botania.botania:pinkWither.item"=
+    I:"Botania.botania:pinkWither.lexiconDisplaySize"=40
+    I:"Botania.botania:pinkWither.metadata"=0
+    I:"Botania.botania:pinkWither.rate"=-1
+
+    # Configuration of Shedding for Botania.botania:pixie
+    S:"Botania.botania:pixie.item"=
+    I:"Botania.botania:pixie.lexiconDisplaySize"=40
+    I:"Botania.botania:pixie.metadata"=0
+    I:"Botania.botania:pixie.rate"=-1
+
+    # Configuration of Shedding for CaveSpider
+    S:CaveSpider.item=
+    I:CaveSpider.lexiconDisplaySize=40
+    I:CaveSpider.metadata=0
+    I:CaveSpider.rate=-1
+
+    # Configuration of Shedding for Chicken
+    S:Chicken.item=
+    I:Chicken.lexiconDisplaySize=40
+    I:Chicken.metadata=0
+    I:Chicken.rate=-1
+
+    # Configuration of Shedding for Cow
+    S:Cow.item=
+    I:Cow.lexiconDisplaySize=40
+    I:Cow.metadata=0
+    I:Cow.rate=-1
+
+    # Configuration of Shedding for Creeper
+    S:Creeper.item=
+    I:Creeper.lexiconDisplaySize=40
+    I:Creeper.metadata=0
+    I:Creeper.rate=-1
+
+    # Configuration of Shedding for DragonMounts.DragonMount
+    S:DragonMounts.DragonMount.item=
+    I:DragonMounts.DragonMount.lexiconDisplaySize=40
+    I:DragonMounts.DragonMount.metadata=0
+    I:DragonMounts.DragonMount.rate=-1
+
+    # Configuration of Shedding for EnderDragon
+    S:EnderDragon.item=
+    I:EnderDragon.lexiconDisplaySize=40
+    I:EnderDragon.metadata=0
+    I:EnderDragon.rate=-1
+
+    # Configuration of Shedding for Enderman
+    S:Enderman.item=
+    I:Enderman.lexiconDisplaySize=40
+    I:Enderman.metadata=0
+    I:Enderman.rate=-1
+
+    # Configuration of Shedding for Endermite
+    S:Endermite.item=
+    I:Endermite.lexiconDisplaySize=40
+    I:Endermite.metadata=0
+    I:Endermite.rate=-1
+
+    # Configuration of Shedding for EntityHorse
+    S:EntityHorse.item=
+    I:EntityHorse.lexiconDisplaySize=40
+    I:EntityHorse.metadata=0
+    I:EntityHorse.rate=-1
+
+    # Configuration of Shedding for Ghast
+    S:Ghast.item=
+    I:Ghast.lexiconDisplaySize=40
+    I:Ghast.metadata=0
+    I:Ghast.rate=-1
+
+    # Configuration of Shedding for Giant
+    S:Giant.item=
+    I:Giant.lexiconDisplaySize=40
+    I:Giant.metadata=0
+    I:Giant.rate=-1
+
+    # Configuration of Shedding for Guardian
+    S:Guardian.item=
+    I:Guardian.lexiconDisplaySize=40
+    I:Guardian.metadata=0
+    I:Guardian.rate=-1
+
+    # Configuration of Shedding for LavaSlime
+    S:LavaSlime.item=
+    I:LavaSlime.lexiconDisplaySize=40
+    I:LavaSlime.metadata=0
+    I:LavaSlime.rate=-1
+
+    # Configuration of Shedding for Mekanism.BabySkeleton
+    S:Mekanism.BabySkeleton.item=
+    I:Mekanism.BabySkeleton.lexiconDisplaySize=40
+    I:Mekanism.BabySkeleton.metadata=0
+    I:Mekanism.BabySkeleton.rate=-1
+
+    # Configuration of Shedding for Mekanism.Robit
+    S:Mekanism.Robit.item=
+    I:Mekanism.Robit.lexiconDisplaySize=40
+    I:Mekanism.Robit.metadata=0
+    I:Mekanism.Robit.rate=-1
+
+    # Configuration of Shedding for Mob
+    S:Mob.item=
+    I:Mob.lexiconDisplaySize=40
+    I:Mob.metadata=0
+    I:Mob.rate=-1
+
+    # Configuration of Shedding for Monster
+    S:Monster.item=
+    I:Monster.lexiconDisplaySize=40
+    I:Monster.metadata=0
+    I:Monster.rate=-1
+
+    # Configuration of Shedding for MushroomCow
+    S:MushroomCow.item=
+    I:MushroomCow.lexiconDisplaySize=40
+    I:MushroomCow.metadata=0
+    I:MushroomCow.rate=-1
+
+    # Configuration of Shedding for Ozelot
+    S:Ozelot.item=
+    I:Ozelot.lexiconDisplaySize=40
+    I:Ozelot.metadata=0
+    I:Ozelot.rate=-1
+
+    # Configuration of Shedding for Pig
+    S:Pig.item=
+    I:Pig.lexiconDisplaySize=40
+    I:Pig.metadata=0
+    I:Pig.rate=-1
+
+    # Configuration of Shedding for PigZombie
+    S:PigZombie.item=
+    I:PigZombie.lexiconDisplaySize=40
+    I:PigZombie.metadata=0
+    I:PigZombie.rate=-1
+
+    # Configuration of Shedding for PolarBear
+    S:PolarBear.item=
+    I:PolarBear.lexiconDisplaySize=40
+    I:PolarBear.metadata=0
+    I:PolarBear.rate=-1
+
+    # Configuration of Shedding for Quark.ashen
+    S:Quark.ashen.item=
+    I:Quark.ashen.lexiconDisplaySize=40
+    I:Quark.ashen.metadata=0
+    I:Quark.ashen.rate=-1
+
+    # Configuration of Shedding for Quark.dweller
+    S:Quark.dweller.item=
+    I:Quark.dweller.lexiconDisplaySize=40
+    I:Quark.dweller.metadata=0
+    I:Quark.dweller.rate=-1
+
+    # Configuration of Shedding for Quark.pirate
+    S:Quark.pirate.item=
+    I:Quark.pirate.lexiconDisplaySize=40
+    I:Quark.pirate.metadata=0
+    I:Quark.pirate.rate=-1
+
+    # Configuration of Shedding for Quark.wraith
+    S:Quark.wraith.item=
+    I:Quark.wraith.lexiconDisplaySize=40
+    I:Quark.wraith.metadata=0
+    I:Quark.wraith.rate=-1
+
+    # Configuration of Shedding for Rabbit
+    S:Rabbit.item=
+    I:Rabbit.lexiconDisplaySize=40
+    I:Rabbit.metadata=0
+    I:Rabbit.rate=-1
+
+    # Configuration of Shedding for Sheep
+    S:Sheep.item=
+    I:Sheep.lexiconDisplaySize=40
+    I:Sheep.metadata=0
+    I:Sheep.rate=-1
+
+    # Configuration of Shedding for Shulker
+    S:Shulker.item=
+    I:Shulker.lexiconDisplaySize=40
+    I:Shulker.metadata=0
+    I:Shulker.rate=-1
+
+    # Configuration of Shedding for Silverfish
+    S:Silverfish.item=
+    I:Silverfish.lexiconDisplaySize=40
+    I:Silverfish.metadata=0
+    I:Silverfish.rate=-1
+
+    # Configuration of Shedding for Skeleton
+    S:Skeleton.item=
+    I:Skeleton.lexiconDisplaySize=40
+    I:Skeleton.metadata=0
+    I:Skeleton.rate=-1
+
+    # Configuration of Shedding for Slime
+    S:Slime.item=
+    I:Slime.lexiconDisplaySize=40
+    I:Slime.metadata=0
+    I:Slime.rate=-1
+
+    # Configuration of Shedding for SnowMan
+    S:SnowMan.item=
+    I:SnowMan.lexiconDisplaySize=40
+    I:SnowMan.metadata=0
+    I:SnowMan.rate=-1
+
+    # Configuration of Shedding for Spider
+    S:Spider.item=
+    I:Spider.lexiconDisplaySize=40
+    I:Spider.metadata=0
+    I:Spider.rate=-1
+
+    # Configuration of Shedding for Squid
+    S:Squid.item=
+    I:Squid.lexiconDisplaySize=40
+    I:Squid.metadata=0
+    I:Squid.rate=-1
+
+    # Configuration of Shedding for Villager
+    S:Villager.item=
+    I:Villager.lexiconDisplaySize=40
+    I:Villager.metadata=0
+    I:Villager.rate=-1
+
+    # Configuration of Shedding for VillagerGolem
+    S:VillagerGolem.item=
+    I:VillagerGolem.lexiconDisplaySize=40
+    I:VillagerGolem.metadata=0
+    I:VillagerGolem.rate=-1
+
+    # Configuration of Shedding for Witch
+    S:Witch.item=
+    I:Witch.lexiconDisplaySize=40
+    I:Witch.metadata=0
+    I:Witch.rate=-1
+
+    # Configuration of Shedding for WitherBoss
+    S:WitherBoss.item=
+    I:WitherBoss.lexiconDisplaySize=40
+    I:WitherBoss.metadata=0
+    I:WitherBoss.rate=-1
+
+    # Configuration of Shedding for Wolf
+    S:Wolf.item=
+    I:Wolf.lexiconDisplaySize=40
+    I:Wolf.metadata=0
+    I:Wolf.rate=-1
+
+    # Configuration of Shedding for Zombie
+    S:Zombie.item=
+    I:Zombie.lexiconDisplaySize=40
+    I:Zombie.metadata=0
+    I:Zombie.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.Jzahar
+    S:abyssalcraft.Jzahar.item=
+    I:abyssalcraft.Jzahar.lexiconDisplaySize=40
+    I:abyssalcraft.Jzahar.metadata=0
+    I:abyssalcraft.Jzahar.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.abygolem
+    S:abyssalcraft.abygolem.item=
+    I:abyssalcraft.abygolem.lexiconDisplaySize=40
+    I:abyssalcraft.abygolem.metadata=0
+    I:abyssalcraft.abygolem.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.abyssalzombie
+    S:abyssalcraft.abyssalzombie.item=
+    I:abyssalcraft.abyssalzombie.lexiconDisplaySize=40
+    I:abyssalcraft.abyssalzombie.metadata=0
+    I:abyssalcraft.abyssalzombie.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antiabyssalzombie
+    S:abyssalcraft.antiabyssalzombie.item=
+    I:abyssalcraft.antiabyssalzombie.lexiconDisplaySize=40
+    I:abyssalcraft.antiabyssalzombie.metadata=0
+    I:abyssalcraft.antiabyssalzombie.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antibat
+    S:abyssalcraft.antibat.item=
+    I:abyssalcraft.antibat.lexiconDisplaySize=40
+    I:abyssalcraft.antibat.metadata=0
+    I:abyssalcraft.antibat.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antichicken
+    S:abyssalcraft.antichicken.item=
+    I:abyssalcraft.antichicken.lexiconDisplaySize=40
+    I:abyssalcraft.antichicken.metadata=0
+    I:abyssalcraft.antichicken.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.anticow
+    S:abyssalcraft.anticow.item=
+    I:abyssalcraft.anticow.lexiconDisplaySize=40
+    I:abyssalcraft.anticow.metadata=0
+    I:abyssalcraft.anticow.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.anticreeper
+    S:abyssalcraft.anticreeper.item=
+    I:abyssalcraft.anticreeper.lexiconDisplaySize=40
+    I:abyssalcraft.anticreeper.metadata=0
+    I:abyssalcraft.anticreeper.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antighoul
+    S:abyssalcraft.antighoul.item=
+    I:abyssalcraft.antighoul.lexiconDisplaySize=40
+    I:abyssalcraft.antighoul.metadata=0
+    I:abyssalcraft.antighoul.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antipig
+    S:abyssalcraft.antipig.item=
+    I:abyssalcraft.antipig.lexiconDisplaySize=40
+    I:abyssalcraft.antipig.metadata=0
+    I:abyssalcraft.antipig.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antiplayer
+    S:abyssalcraft.antiplayer.item=
+    I:abyssalcraft.antiplayer.lexiconDisplaySize=40
+    I:abyssalcraft.antiplayer.metadata=0
+    I:abyssalcraft.antiplayer.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antiskeleton
+    S:abyssalcraft.antiskeleton.item=
+    I:abyssalcraft.antiskeleton.lexiconDisplaySize=40
+    I:abyssalcraft.antiskeleton.metadata=0
+    I:abyssalcraft.antiskeleton.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antispider
+    S:abyssalcraft.antispider.item=
+    I:abyssalcraft.antispider.lexiconDisplaySize=40
+    I:abyssalcraft.antispider.metadata=0
+    I:abyssalcraft.antispider.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.antizombie
+    S:abyssalcraft.antizombie.item=
+    I:abyssalcraft.antizombie.lexiconDisplaySize=40
+    I:abyssalcraft.antizombie.metadata=0
+    I:abyssalcraft.antizombie.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.chagaroth
+    S:abyssalcraft.chagaroth.item=
+    I:abyssalcraft.chagaroth.lexiconDisplaySize=40
+    I:abyssalcraft.chagaroth.metadata=0
+    I:abyssalcraft.chagaroth.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.chagarothfist
+    S:abyssalcraft.chagarothfist.item=
+    I:abyssalcraft.chagarothfist.lexiconDisplaySize=40
+    I:abyssalcraft.chagarothfist.metadata=0
+    I:abyssalcraft.chagarothfist.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.chagarothspawn
+    S:abyssalcraft.chagarothspawn.item=
+    I:abyssalcraft.chagarothspawn.lexiconDisplaySize=40
+    I:abyssalcraft.chagarothspawn.metadata=0
+    I:abyssalcraft.chagarothspawn.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.demonchicken
+    S:abyssalcraft.demonchicken.item=
+    I:abyssalcraft.demonchicken.lexiconDisplaySize=40
+    I:abyssalcraft.demonchicken.metadata=0
+    I:abyssalcraft.demonchicken.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.demoncow
+    S:abyssalcraft.demoncow.item=
+    I:abyssalcraft.demoncow.lexiconDisplaySize=40
+    I:abyssalcraft.demoncow.metadata=0
+    I:abyssalcraft.demoncow.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.demonpig
+    S:abyssalcraft.demonpig.item=
+    I:abyssalcraft.demonpig.lexiconDisplaySize=40
+    I:abyssalcraft.demonpig.metadata=0
+    I:abyssalcraft.demonpig.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.demonsheep
+    S:abyssalcraft.demonsheep.item=
+    I:abyssalcraft.demonsheep.lexiconDisplaySize=40
+    I:abyssalcraft.demonsheep.metadata=0
+    I:abyssalcraft.demonsheep.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.depthsghoul
+    S:abyssalcraft.depthsghoul.item=
+    I:abyssalcraft.depthsghoul.lexiconDisplaySize=40
+    I:abyssalcraft.depthsghoul.metadata=0
+    I:abyssalcraft.depthsghoul.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dragonboss
+    S:abyssalcraft.dragonboss.item=
+    I:abyssalcraft.dragonboss.lexiconDisplaySize=40
+    I:abyssalcraft.dragonboss.metadata=0
+    I:abyssalcraft.dragonboss.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dragonminion
+    S:abyssalcraft.dragonminion.item=
+    I:abyssalcraft.dragonminion.lexiconDisplaySize=40
+    I:abyssalcraft.dragonminion.metadata=0
+    I:abyssalcraft.dragonminion.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dreadgolem
+    S:abyssalcraft.dreadgolem.item=
+    I:abyssalcraft.dreadgolem.lexiconDisplaySize=40
+    I:abyssalcraft.dreadgolem.metadata=0
+    I:abyssalcraft.dreadgolem.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dreadguard
+    S:abyssalcraft.dreadguard.item=
+    I:abyssalcraft.dreadguard.lexiconDisplaySize=40
+    I:abyssalcraft.dreadguard.metadata=0
+    I:abyssalcraft.dreadguard.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dreadling
+    S:abyssalcraft.dreadling.item=
+    I:abyssalcraft.dreadling.lexiconDisplaySize=40
+    I:abyssalcraft.dreadling.metadata=0
+    I:abyssalcraft.dreadling.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.dreadspawn
+    S:abyssalcraft.dreadspawn.item=
+    I:abyssalcraft.dreadspawn.lexiconDisplaySize=40
+    I:abyssalcraft.dreadspawn.metadata=0
+    I:abyssalcraft.dreadspawn.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.evilchicken
+    S:abyssalcraft.evilchicken.item=
+    I:abyssalcraft.evilchicken.lexiconDisplaySize=40
+    I:abyssalcraft.evilchicken.metadata=0
+    I:abyssalcraft.evilchicken.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.evilcow
+    S:abyssalcraft.evilcow.item=
+    I:abyssalcraft.evilcow.lexiconDisplaySize=40
+    I:abyssalcraft.evilcow.metadata=0
+    I:abyssalcraft.evilcow.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.evilpig
+    S:abyssalcraft.evilpig.item=
+    I:abyssalcraft.evilpig.lexiconDisplaySize=40
+    I:abyssalcraft.evilpig.metadata=0
+    I:abyssalcraft.evilpig.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.evilsheep
+    S:abyssalcraft.evilsheep.item=
+    I:abyssalcraft.evilsheep.lexiconDisplaySize=40
+    I:abyssalcraft.evilsheep.metadata=0
+    I:abyssalcraft.evilsheep.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.greaterdreadspawn
+    S:abyssalcraft.greaterdreadspawn.item=
+    I:abyssalcraft.greaterdreadspawn.lexiconDisplaySize=40
+    I:abyssalcraft.greaterdreadspawn.metadata=0
+    I:abyssalcraft.greaterdreadspawn.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.gskeleton
+    S:abyssalcraft.gskeleton.item=
+    I:abyssalcraft.gskeleton.lexiconDisplaySize=40
+    I:abyssalcraft.gskeleton.metadata=0
+    I:abyssalcraft.gskeleton.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.jzaharminion
+    S:abyssalcraft.jzaharminion.item=
+    I:abyssalcraft.jzaharminion.lexiconDisplaySize=40
+    I:abyssalcraft.jzaharminion.metadata=0
+    I:abyssalcraft.jzaharminion.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.lesserdreadbeast
+    S:abyssalcraft.lesserdreadbeast.item=
+    I:abyssalcraft.lesserdreadbeast.lexiconDisplaySize=40
+    I:abyssalcraft.lesserdreadbeast.metadata=0
+    I:abyssalcraft.lesserdreadbeast.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.lessershoggoth
+    S:abyssalcraft.lessershoggoth.item=
+    I:abyssalcraft.lessershoggoth.lexiconDisplaySize=40
+    I:abyssalcraft.lessershoggoth.metadata=0
+    I:abyssalcraft.lessershoggoth.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.omotholghoul
+    S:abyssalcraft.omotholghoul.item=
+    I:abyssalcraft.omotholghoul.lexiconDisplaySize=40
+    I:abyssalcraft.omotholghoul.metadata=0
+    I:abyssalcraft.omotholghoul.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.remnant
+    S:abyssalcraft.remnant.item=
+    I:abyssalcraft.remnant.lexiconDisplaySize=40
+    I:abyssalcraft.remnant.metadata=0
+    I:abyssalcraft.remnant.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.shadowbeast
+    S:abyssalcraft.shadowbeast.item=
+    I:abyssalcraft.shadowbeast.lexiconDisplaySize=40
+    I:abyssalcraft.shadowbeast.metadata=0
+    I:abyssalcraft.shadowbeast.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.shadowboss
+    S:abyssalcraft.shadowboss.item=
+    I:abyssalcraft.shadowboss.lexiconDisplaySize=40
+    I:abyssalcraft.shadowboss.metadata=0
+    I:abyssalcraft.shadowboss.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.shadowcreature
+    S:abyssalcraft.shadowcreature.item=
+    I:abyssalcraft.shadowcreature.lexiconDisplaySize=40
+    I:abyssalcraft.shadowcreature.metadata=0
+    I:abyssalcraft.shadowcreature.rate=-1
+
+    # Configuration of Shedding for abyssalcraft.shadowmonster
+    S:abyssalcraft.shadowmonster.item=
+    I:abyssalcraft.shadowmonster.lexiconDisplaySize=40
+    I:abyssalcraft.shadowmonster.metadata=0
+    I:abyssalcraft.shadowmonster.rate=-1
+
+    # Configuration of Shedding for correlatedpotentialistics.automaton
+    S:correlatedpotentialistics.automaton.item=
+    I:correlatedpotentialistics.automaton.lexiconDisplaySize=40
+    I:correlatedpotentialistics.automaton.metadata=0
+    I:correlatedpotentialistics.automaton.rate=-1
+
+    # Configuration of Shedding for forestry.butterflyGE
+    S:forestry.butterflyGE.item=
+    I:forestry.butterflyGE.lexiconDisplaySize=40
+    I:forestry.butterflyGE.metadata=0
+    I:forestry.butterflyGE.rate=-1
+
+    # Configuration of Shedding for randomthings.spirit
+    S:randomthings.spirit.item=
+    I:randomthings.spirit.lexiconDisplaySize=40
+    I:randomthings.spirit.metadata=0
+    I:randomthings.spirit.rate=-1
+
+    # Configuration of Shedding for tconstruct.blueslime
+    S:tconstruct.blueslime.item=
+    I:tconstruct.blueslime.lexiconDisplaySize=40
+    I:tconstruct.blueslime.metadata=0
+    I:tconstruct.blueslime.rate=-1
+}

src/config/ChickenChunks.cfg

@@ -0,0 +1,42 @@
+#ChunkLoader Configuration File
+#Deleting any element will restore it to it's default value
+
+#Per player chunk limiting. Values ignored if 0.:Simply add <username>=<value>
+players
+{
+	#Forge gives everyone 12500 by default
+	DEFAULT=5000
+	#For server op's only.
+	OP=5000
+}
+
+#If set to false, players will have to be logged in for their chunkloaders to work.:Simply add <username>=<true|false>
+allowoffline
+{
+	DEFAULT=true
+	OP=true
+}
+
+#Set to false to deny a player access to the chunk viewer
+allowchunkviewer
+{
+	DEFAULT=true
+	OP=true
+}
+
+#The number of minutes since last login within which chunks from a player will remain active, 0 for infinite.
+awayTimeout=2880
+
+checkUpdates=true
+
+#The number of ticks to wait between attempting to unload orphaned chunks
+cleanuptime=1200
+
+#The maximum number of chunks per chunkloader
+maxchunks=400
+
+#Enabling this lets OPs alter other player's chunkloaders. WARNING: If you change a chunkloader, you have no idea what may break/explode by not being chunkloaded.
+op-interact=false
+
+#Set to false to disable the automatic reloading of mystcraft dimensions on server restart
+reload-dimensions=true

src/config/CodeChickenCore.cfg

@@ -0,0 +1,19 @@
+#CodeChickenCore configuration file.
+
+checkUpdates=true
+
+#set to true to completely deobfuscate mcp names
+dev.deobfuscate=false
+
+#Various tweaks that can be applied to game mechanics.
+tweaks
+{
+	#If set to true, creepers will not destroy landscape. (A version of mobGriefing setting just for creepers)
+	environmentallyFriendlyCreepers=false
+	#If set to true two adjacent water source blocks will not generate a third.
+	finiteWater=false
+	#Set this to true to use the pre1.5 lava textures
+	replaceLavaFX=false
+	#Set this to true to use the pre1.5 water textures
+	replaceWaterFX=false
+}

src/config/CompactSolars.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # The EU generation scaling factor. The average number of ticks needed to generate one EU packet.1 is every tick, 2 is every other tick etc. Each Solar will still generate a whole packet (8, 64, 512 EU).
+    I:scaleFactor=1
+}
+
+

src/config/DragonMounts.cfg

@@ -0,0 +1,11 @@
+# Configuration file
+
+client {
+    # Debug mode. Unless you're a developer or are told to activate it, you don't want to set this to true. [default: false]
+    B:debug=false
+
+    # Disables right-click override on the vanilla dragon egg block. May help to fix issues with other mods. [default: false]
+    B:disableBlockOverride=false
+}
+
+

src/config/FastLeaveDecay.cfg

@@ -0,0 +1,11 @@
+# Configuration file
+
+settings {
+    # How noisy will the leave decay be? Higher->More Random
+    I:DecayFuzz=7
+
+    # The Speed at which Leaves Decay Higher->Slower
+    I:DecaySpeed=7
+}
+
+

src/config/Guide-API/Guide-API.cfg

@@ -0,0 +1,40 @@
+# Configuration file
+
+##########################################################################################################
+# books
+#--------------------------------------------------------------------------------------------------------#
+# All settings related to Books.
+##########################################################################################################
+
+books {
+    # Allows books to spawn with new players.
+    # This is a global override for all books. [default: true]
+    B:canSpawnWithBooks=true
+
+    ##########################################################################################################
+    # spawn
+    #--------------------------------------------------------------------------------------------------------#
+    # If true, the user will spawn with the book.
+    # This defaults to the value the book owner has set and is overridden by this config.
+    ##########################################################################################################
+
+    spawn {
+        B:"bloodmagic:BloodMagic"=false
+        B:"crossroads:crossroadsMainGuide"=true
+    }
+
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# Miscellaneous settings.
+##########################################################################################################
+
+general {
+    # Enables extra information being printed to the console. [default: true]
+    B:enableLogging=true
+}
+
+

src/config/IC2.ini

@@ -0,0 +1,180 @@
+; ic2 general config
+; created Sep 26, 2016 2:04:00 AM
+;---
+
+[worldgen]
+; Enable generation of rubber trees in the world.
+rubberTree = true
+; Enable generation of copper in the world.
+copperOre = false
+; Enable generation of tin in the world.
+tinOre = false
+; Enable generation of uranium in the world.
+uraniumOre = true
+; Enable generation of Lead in the world.
+leadOre = true
+; Factor scaling the IC2 ore generation quantity.
+oreDensityFactor = 1.0
+; Factor scaling the IC2 tree generation quantity.
+treeDensityFactor = 1.0
+; Maximum amount of chunks to check for retrogen viability each tick.
+; Retrogen is the retroactive generation of terrain features, e.g. ores and trees.
+; Set it to 0 to disable retrogen.
+; When enabling this the recommended value is 16
+retrogenCheckLimit = 0
+; Maximum amount of chunks to process for retrogen each tick.
+; Values exceeding retrogenCheckLimit are being truncated.
+retrogenUpdateLimit = 2
+
+[protection]
+; Enable logging of players when they remove a machine using a wrench.
+wrenchLogging = true
+; Maximum Explosion power of a nuke, where TNT is 4.
+nukeExplosionPowerLimit = 60
+; Maximum explosion power of a nuclear reactor, where TNT is 4.
+reactorExplosionPowerLimit = 45
+; Enable the nuke
+enableNuke = true
+
+[balance]
+; Maximum battery tier usable by the miner.
+; 1 = batteries, 2 = lead batteries, 3 = energy crystals, 4 = lapotron crystals
+minerDischargeTier = 1
+; Increase the energy use by the player's inventory weight when going through a teleporter.
+teleporterUseInventoryWeight = true
+; Ratio of energy retained inside energy storage block Items when wrenched.
+; 0 (nothing) ... 1 (100%), default 0.8 (80 %)
+energyRetainedInStorageBlockDrops = 0.8
+; Factor to scale the UU-Matter production energy requirement.
+uuEnergyFactor = 1.0
+; Disable the vanilla ender chest, removing existing ones from the world as well.
+disableEnderChest = false
+; Comma separated list of blocks and items which should not be turned into scrap by the recycler.
+; Format: <name>[@metadata], metadata * matches any.
+; Ore dictionary entries can be specified with OreDict:<ore dict name> as the name.
+recyclerBlacklist = minecraft:glass_pane, minecraft:stick, minecraft:snowball, minecraft:snow_layer, minecraft:snow, IC2:scaffold
+; Whitelist for blocks/items allowed to be recycled.
+; The whitelist will be used instead of the blacklist approach if it's non-empty, disallowing everything else.
+; The format is the same as the blacklist.
+recyclerWhitelist =
+; Allow to pick blocks up using just a pickaxe instead of needing a wrench.
+ignoreWrenchRequirement = false
+; Allow the water slot of water mills to be automated.
+watermillAutomation = false
+
+; Base energy generation factors - increase for higher energy yield.
+[balance / energy / generator]
+generator = 1.0
+geothermal = 1.0
+; Deprecated, because of Kinetic Watermill
+water = 1.0
+solar = 1.0
+; Deprecated, because of Kinetic Windmill
+wind = 1.0
+nuclear = 1.0
+semiFluidOil = 1.0
+semiFluidFuel = 1.0
+semiFluidBiomass = 1.0
+semiFluidBioethanol = 1.0
+semiFluidBiogas = 1.0
+Stirling = 1.0
+Kinetic = 1.0
+radioisotope = 1.0
+
+; Base heat generation factors - increase for higher heat yield.
+[balance / energy / heatgenerator]
+semiFluidOil = 1.0
+semiFluidFuel = 1.0
+semiFluidBiomass = 1.0
+semiFluidBioethanol = 1.0
+semiFluidBiogas = 1.0
+solid = 1.0
+radioisotope = 1.0
+electric = 1.0
+
+; Base kinetic generation factors - increase for higher kinetic energy yield.
+[balance / energy / kineticgenerator]
+water = 1.0
+wind = 1.0
+manual = 1.0
+steam = 1.0
+electric = 1.0
+
+; Basically the amount of hU the conversion of one mB of Liquid takes/gives
+[balance / energy / fluidconversion]
+; Lava -> PahoehoeLava
+heatExchangerLava = 1.0
+; Hot Coolant <-> Cold Coolant
+heatExchangerHotCoolant = 1.0
+; Hot Water <- Water
+heatExchangerWater = 1.0
+
+; Base Coolant conversion rate for FluidReactors.
+[balance / energy / FluidReactor]
+outputModifier = 1.0
+
+; Balace Value for Turbine Livetime in sec. Default 86400sec = 24h
+[balance / SteamKineticGenerator]
+rotorlivetime = 86400
+
+; Balace Values for calcification default 100.000mB Water -> to failure
+[balance / steamgenerator / calcification]
+maxcalcification = 100000
+
+; Balance Values for Fermenter
+[balance / fermenter]
+need_amount_biomass_per_run = 10
+output_amount_biogas_per_run = 200
+hU_per_run = 8000
+biomass_per_fertilizier = 500
+
+; Additional initial uu values, a value of 1 equals cobblestone.
+; Recipes may cause the final value be lower than the one specified here.
+; Format: <name>[@metadata] = <value>
+[balance / uu-values / predefined]
+IC2:misc_resource#iridium_ore = 12000
+IC2:misc_resource#iridium_shard = 1333
+
+[recipes]
+; To modify recipes or add custom recipes, copy the corresponding .ini file to
+; "minecraft/config/ic2" and modify it.
+;
+; Disable IC2 crafting recipes with the specified output, comma separated list.
+; Recipes in the additional section below aren't affected.
+; Format: <name>[@metadata], e.g. minecraft:bucket to disable IC2's bucket recipe from tin.
+disable =
+; Purge crafting recipes with the specified output, including vanilla and mod ones, comma separated list.
+; Recipes in the additional section below aren't affected.
+; Format: <name>[@metadata], e.g. minecraft:tnt to disable crafting tnt.
+purge =
+; Enable crafting of IC2 coins, otherwise they have to be spawned in and are thus limited.
+allowCoinCrafting = true
+; Allow only IC2 circuits to be used in IC2's recipes.
+requireIc2Circuits = false
+; Adjust smelting recipes to always output IC2 items if available.
+smeltToIc2Items = false
+; Ignore invalid recipes.
+ignoreInvalidRecipes = false
+
+[misc]
+; Enable IC2's custom sound system.
+enableIc2Audio = true
+; Maximum number of active audio sources, only change it if you know what you're doing.
+maxAudioSourceCount = 32
+; Enable hiding of secret recipes in CraftGuide/NEI.
+hideSecretRecipes = false
+; Enable activation of the quantum leggings' speed boost when sprinting instead of holding the boost key.
+quantumSpeedOnSprint = true
+; Enable burning of scrap in a generator.
+allowBurningScrap = true
+; Comma separated list with ores the miner should harvest.
+; Format: <name>[@metadata], e.g. minecraft:torch, minecraft:chest
+; The metadata * will match any, e.g. minecraft:log@*.
+; Ore dictionary entries can be specified with OreDict:<ore dict name> as the name.
+additionalValuableOres =
+; Use the new highly experimental current + voltage energy net model with energy loss.
+; Only set this to true if you know what you are doing.
+useLinearTransferModel = false
+; Potion ID of radiation potion.
+; Do not change this after you created a world...
+radiationPotionID = 24

src/config/InfernalMobs.cfg

@@ -0,0 +1,123 @@
+# Configuration file
+
+entitiesalwaysinfernal {
+    B:EntityAbyssalZombie=false
+    B:EntityAshen=false
+    B:EntityBabySkeleton=false
+    B:EntityBlueSlime=false
+    B:EntityCreeper=false
+    B:EntityDepthsGhoul=false
+    B:EntityDweller=false
+    B:EntityEnderman=false
+    B:EntityEvilChicken=false
+    B:EntityEvilCow=false
+    B:EntityEvilSheep=false
+    B:EntityEvilpig=false
+    B:EntityGuardian=false
+    B:EntityLesserShoggoth=false
+    B:EntityPirate=false
+    B:EntityShadowBeast=false
+    B:EntityShadowCreature=false
+    B:EntityShadowMonster=false
+    B:EntitySkeleton=false
+    B:EntitySlime=false
+    B:EntitySpider=false
+    B:EntityWitch=false
+    B:EntityZombie=false
+}
+
+
+entitybasehealth {
+    D:EntityAbyssalZombie=25.0
+    D:EntityAshen=20.0
+    D:EntityBabySkeleton=20.0
+    D:EntityBlueSlime=1.0
+    D:EntityCreeper=20.0
+    D:EntityDweller=20.0
+    D:EntityEnderman=40.0
+    D:EntityEvilChicken=10.0
+    D:EntityEvilCow=15.0
+    D:EntityEvilpig=15.0
+    D:EntityGuardian=30.0
+    D:EntityLesserShoggoth=100.0
+    D:EntityPirate=20.0
+    D:EntityShadowCreature=20.0
+    D:EntitySkeleton=20.0
+    D:EntitySpider=16.0
+    D:EntityWitch=26.0
+    D:EntityZombie=20.0
+}
+
+
+general {
+    I:AntiMobFarmCheckInterval=30
+    B:AntiMobfarmingEnabled=true
+    B:"MM_1UP enabled"=true
+    B:"MM_Alchemist enabled"=true
+    B:"MM_Berserk enabled"=true
+    B:"MM_Blastoff enabled"=true
+    B:"MM_Bulwark enabled"=true
+    B:"MM_Choke enabled"=true
+    B:"MM_Cloaking enabled"=true
+    B:"MM_Darkness enabled"=true
+    B:"MM_Ender enabled"=true
+    B:"MM_Exhaust enabled"=true
+    B:"MM_Fiery enabled"=true
+    B:"MM_Ghastly enabled"=true
+    B:"MM_Gravity enabled"=true
+    B:"MM_Lifesteal enabled"=true
+    B:"MM_Ninja enabled"=true
+    B:"MM_Poisonous enabled"=true
+    B:"MM_Quicksand enabled"=true
+    B:"MM_Regen enabled"=true
+    B:"MM_Rust enabled"=true
+    B:"MM_Sapper enabled"=true
+    B:"MM_Sprint enabled"=true
+    B:"MM_Sticky enabled"=true
+    B:"MM_Storm enabled"=true
+    B:"MM_Vengeance enabled"=true
+    B:"MM_Weakness enabled"=true
+    B:"MM_Webber enabled"=true
+    B:"MM_Wither enabled"=true
+    S:dimensionIDBlackList=
+    B:disableGUIoverlay=false
+    S:droppedItemIDsElite=iron_shovel,iron_pickaxe,iron_axe,iron_sword,iron_hoe,chainmail_helmet,chainmail_chestplate,chainmail_leggings,chainmail_boots,iron_helmet,iron_chestplate,iron_leggings,iron_boots,cookie-0-6
+    S:droppedItemIDsInfernal=diamond-0-3,diamond_sword,diamond_shovel,diamond_pickaxe,diamond_axe,diamond_hoe,chainmail_helmet,chainmail_chestplate,chainmail_leggings,chainmail_boots,diamond_helmet,diamond_chestplate,diamond_leggings,diamond_boots,ender_pearl,enchanted_book
+    S:droppedItemIDsUltra=bow,iron_hoe,chainmail_helmet,chainmail_chestplate,chainmail_leggings,chainmail_boots,iron_helmet,iron_chestplate,iron_leggings,iron_boots,golden_helmet,golden_chestplate,golden_leggings,golden_boots,golden_apple,blaze_powder-0-3,enchanted_book
+    I:eliteRarity=15
+    I:infernoRarity=7
+    D:maxOneShotDamage=10.0
+    D:mobFarmDamageThreshold=150.0
+    S:mobHealthFactor=1.0
+    I:ultraRarity=7
+    B:useSimpleEntityClassnames=true
+}
+
+
+permittedentities {
+    B:EntityAbyssalZombie=true
+    B:EntityAshen=true
+    B:EntityBabySkeleton=true
+    B:EntityBlueSlime=true
+    B:EntityCreeper=true
+    B:EntityDepthsGhoul=true
+    B:EntityDweller=true
+    B:EntityEnderman=true
+    B:EntityEvilChicken=true
+    B:EntityEvilCow=true
+    B:EntityEvilSheep=true
+    B:EntityEvilpig=true
+    B:EntityGuardian=true
+    B:EntityLesserShoggoth=true
+    B:EntityPirate=true
+    B:EntityShadowBeast=true
+    B:EntityShadowCreature=true
+    B:EntityShadowMonster=true
+    B:EntitySkeleton=true
+    B:EntitySlime=true
+    B:EntitySpider=true
+    B:EntityWitch=true
+    B:EntityZombie=true
+}
+
+

src/config/InvTweaks.cfg

@@ -0,0 +1,22 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://www.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Mon Sep 26 02:04:48 BST 2016
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=true
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+version=1.61-58-a1fd884

src/config/InvTweaksRules.txt

@@ -0,0 +1,32 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can either add it 
+# or create a rule by ID. Examples: "D5 203", "D9 12345-13"

src/config/JEI/itemBlacklist.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+~CONFIG_VERSION: 0.1.0
+
+##########################################################################################################
+# advanced
+#--------------------------------------------------------------------------------------------------------#
+# Advanced config options to change the way JEI functions.
+##########################################################################################################
+
+advanced {
+    # List of items that should not be displayed in the item list. Format: modId[:name[:meta]]. Edit Mode will automatically add or remove entries here. [Default: []]
+    S:itemBlacklist <
+     >
+}
+
+

src/config/JEI/jei.cfg

@@ -0,0 +1,48 @@
+# Configuration file
+
+~CONFIG_VERSION: 0.2.0
+
+##########################################################################################################
+# advanced
+#--------------------------------------------------------------------------------------------------------#
+# Advanced config options to change the way JEI functions.
+##########################################################################################################
+
+advanced {
+    # Move the JEI search bar to the bottom center of the screen. [default: false]
+    B:centerSearchBarEnabled=false
+
+    # Search items by color and show the searchable item colors on tooltips in the item list. [default: false]
+    B:colorSearchEnabled=false
+    B:debugItemEnabled=false
+    B:debugModeEnabled=false
+
+    # Items with missing models will be hidden from the item list. [default: true]
+    B:hideMissingModelsEnabled=true
+}
+
+
+##########################################################################################################
+# search
+#--------------------------------------------------------------------------------------------------------#
+# Options relating to the search bar.
+##########################################################################################################
+
+search {
+    # Require "@" in front of a word to search by mod name. [default: true]
+    B:atPrefixRequiredForModName=true
+
+    # Require "^" in front of a word to search item colors. [default: true]
+    B:prefixRequiredForColorSearch=true
+
+    # Require "%" in front of a word to search creative tab names. [default: true]
+    B:prefixRequiredForCreativeTabSearch=true
+
+    # Require "$" in front of a word to search ore dictionary names. [default: true]
+    B:prefixRequiredForOreDictSearch=true
+
+    # Require "#" in front of a word to search tooltips. [default: false]
+    B:prefixRequiredForTooltipSearch=false
+}
+
+

src/config/JEI/searchColors.cfg

@@ -0,0 +1,53 @@
+# Configuration file
+
+~CONFIG_VERSION: 0.1.0
+
+##########################################################################################################
+# searchcolors
+#--------------------------------------------------------------------------------------------------------#
+# config.jei.searchColors.comment
+##########################################################################################################
+
+searchcolors {
+    # config.jei.searchColors.searchColors.comment [Default: [White:EEEEEE, LightBlue:7492cc, Cyan:00EEEE, Blue:2222dd, LapisBlue:25418b, Teal:008080, Yellow:cacb58, GoldenYellow:EED700, Orange:d97634, Pink:D1899D, HotPink:FC0FC0, Magenta:b24bbb, Purple:813eb9, JadedPurple:43324f, EvilPurple:2e1649, Lavender:B57EDC, Indigo:480082, Sand:dbd3a0, Tan:bb9b63, LightBrown:A0522D, Brown:634b33, DarkBrown:3a2d13, LimeGreen:43b239, SlimeGreen:83cb73, Green:008000, DarkGreen:224d22, GrassGreen:548049, Red:963430, BrickRed:b0604b, NetherBrick:2a1516, Redstone:ce3e36, Black:181515, CharcoalGray:464646, IronGray:646464, Gray:808080, Silver:C0C0C0]]
+    S:searchColors <
+        White:EEEEEE
+        LightBlue:7492cc
+        Cyan:00EEEE
+        Blue:2222dd
+        LapisBlue:25418b
+        Teal:008080
+        Yellow:cacb58
+        GoldenYellow:EED700
+        Orange:d97634
+        Pink:D1899D
+        HotPink:FC0FC0
+        Magenta:b24bbb
+        Purple:813eb9
+        JadedPurple:43324f
+        EvilPurple:2e1649
+        Lavender:B57EDC
+        Indigo:480082
+        Sand:dbd3a0
+        Tan:bb9b63
+        LightBrown:A0522D
+        Brown:634b33
+        DarkBrown:3a2d13
+        LimeGreen:43b239
+        SlimeGreen:83cb73
+        Green:008000
+        DarkGreen:224d22
+        GrassGreen:548049
+        Red:963430
+        BrickRed:b0604b
+        NetherBrick:2a1516
+        Redstone:ce3e36
+        Black:181515
+        CharcoalGray:464646
+        IronGray:646464
+        Gray:808080
+        Silver:C0C0C0
+     >
+}
+
+

src/config/JEI/worldSettings.cfg

@@ -0,0 +1,25 @@
+# Configuration file
+
+~CONFIG_VERSION: 0.1.0
+
+world-78688046 {
+    B:cheatItemsEnabled=false
+    B:editEnabled=false
+    S:filterText=
+    B:overlayEnabled=true
+}
+
+
+world1690200562 {
+    # Give items instead of showing the recipe.
+    B:cheatItemsEnabled=false
+
+    # Hide and unhide items by clicking them in the item list.
+    B:editEnabled=false
+    S:filterText=
+
+    # Show the list of items next to open guis.
+    B:overlayEnabled=true
+}
+
+

src/config/JustEnoughCalculation.cfg

@@ -0,0 +1,158 @@
+# Configuration file
+
+~CONFIG_VERSION: 1.10.2-2.0.3
+
+general {
+    # Set to true to enable fluid merging when quick transfer recipes
+    B:EnableFluidMerge=false
+
+    # Set to false to disable auto inventory check
+    B:EnableInventoryCheck=true
+
+    # Add string identifier here to disable quick transfer of certain categories of recipe
+    # Names can be found in ListRecipeCategory
+    S:ListRecipeBlackList <
+     >
+
+    # List of recipe categories for reference, this is maintained by the mod automatically
+    # Editing the text here will have no effect
+    S:ListRecipeCategory <
+        minecraft.crafting
+        mekanism.precision_sawmill
+        forestry.still
+        actuallyadditions.booklet
+        oc.api
+        tconstruct.casting_table
+        abyssalcraft.transmutation
+        xreliquary:mortar
+        jeresources.mob
+        mekanism.rotary_condensentrator
+        environmentaltech.voidresminer
+        ie.arcFurnace.Alloying
+        xreliquary:cauldron
+        botania.pureDaisy
+        jefb-bp
+        ie.arcFurnace
+        macerator
+        jefb-bm
+        actuallyadditions.reconstructor
+        mekanism.purification_chamber
+        Calculator
+        fodc.oreconverter
+        minecraft.brewing
+        ie.metalPress
+        BloodMagic:binding
+        Flawless
+        metal_former2
+        BloodMagic:altar
+        metal_former1
+        mekanism.combiner
+        Atomic
+        botania.manaPool
+        extractor
+        actuallyadditions.coffee
+        minecraft.smelting
+        xreliquary:alkahestryCrafting
+        metal_former0
+        forestry.moistener
+        tconstruct.alloy
+        abyssalcraft.crystallization
+        mekanism.osmium_compressor
+        botania.elvenTrade
+        SoulBinder
+        cookingforblockheads.cowjar
+        ie.arcFurnace.Recycling
+        jefb-tm
+        centrifuge
+        abyssalcraft.fuel.transmutation
+        mekanism.chemical_crystallizer
+        RestorationChamber
+        chisel.chiseling
+        ExtractionChamber
+        jefb-tp
+        Imbuing
+        actuallyadditions.crushing
+        jei.description
+        mekanism.chemical_washer
+        mekanism.metallurgic_infuser
+        forestry.squeezer
+        ReassemblyChamber
+        forestry.centrifuge
+        abyssalcraft.ritual
+        jeresources.enchantment
+        botania.brewery
+        botania.runicAltar
+        Enchanter
+        mekanism.chemical_dissolution_chamber
+        EIOTank
+        actuallyadditions.empowerer
+        mekanism.chemical_oxidizer
+        SagMill
+        forestry.fermenter
+        DarkSteelUpgrade
+        oc.manual
+        Scientific
+        jefb-bfm
+        PrecisionChamber
+        ie.cokeoven
+        ProcessingChamber
+        SliceNSPlice
+        abyssalcraft.fuel.crystallization
+        mekanism.chemical_infuser
+        forestry.bottler
+        jeresources.dungeon
+        CombustionGenerator
+        ie.blastfurnace.fuel
+        StoneSeparator
+        tconstruct.smeltery
+        ie.squeezer
+        block_cutter
+        BloodMagic:salchemyTable
+        ie.arcFurnace.Ores
+        mekanism.pressurized_reaction_chamber
+        tconstruct.dryingrack
+        jeresources.worldgen
+        xreliquary:alkahestryCharging
+        BloodMagic:soulForge
+        electrolyzer
+        mekanism.solar_neutron_activator
+        Health Values
+        AlloySmelter
+        ore_washing_plant
+        mekanism.thermal_evaporation_plant
+        compressor
+        blast_furnace
+        BloodMagic:alchemyArray
+        AnvilCraftingRT
+        mekanism.enrichment_chamber
+        forestry.rainmaker
+        mekanism.electrolytic_separator
+        ie.refinery
+        crossroads.grindstone
+        crossroads.fluidCooling
+        AlgorithmSeparator
+        ie.fermenter
+        FabricationChamber
+        crossroads.heatingCrucible
+        jeresources.villager
+        ie.crusher
+        botania.petals
+        Painter
+        forestry.carpenter
+        environmentaltech.voidoreminer
+        ConductorMastItem
+        ie.blastfurnace
+        jeresources.plant
+        mekanism.crusher
+        Vat
+        ic2.scrapbox
+        psionup:trickCrafting
+        minecraft.fuel
+        forestry.fabricator
+        abyssalcraft.engraving
+        mekanism.chemical_injection_chamber
+        ie.workbench
+     >
+}
+
+

src/config/Mekanism.cfg

@@ -0,0 +1,253 @@
+# Configuration file
+
+client {
+    I:AmbientLightingLevel=15
+    B:CTMRenderer=true
+    B:EnableAmbientLighting=true
+    B:EnableMachineSounds=true
+    B:EnablePlayerSounds=true
+    B:Holidays=true
+    B:MachineEffects=true
+    B:OpaqueTransmitterRender=false
+
+    # If true, will reduce lagging between player sounds. Setting to false will reduce GC load
+    B:ReplaceSoundsWhenResuming=true
+    D:SoundVolume=0.5
+}
+
+
+general {
+    B:AestheticWorldDamage=true
+    B:AllowChunkloading=true
+    B:AllowSpawnerBoxPickup=true
+    B:AllowTransmitterAlloyUpgrade=true
+    I:ArmoredJepackDamageMax=115
+    D:ArmoredJetpackDamageRatio=0.8
+    B:BlacklistIC2Power=false
+    B:BlacklistRFPower=false
+    B:BlacklistTeslaPower=false
+    I:ClientUpdateDelay=10
+    B:ControlCircuitOreDict=true
+    I:CopperPerChunk=0
+    B:DestroyDisabledBlocks=true
+    I:DisassemblerEnergyUsage=10
+    B:DynamicTankEasterEgg=false
+    D:EUToJoules=0.1
+    B:EnableWorldRegeneration=false
+    D:EnergyPerHeat=1000.0
+    D:EnergyPerRedstone=10000.0
+    S:EnergyType=J
+    I:EthyleneBurnTime=40
+    D:EvaporationHeatDissipation=0.02
+    D:EvaporationMaxTemp=3000.0
+    D:EvaporationSolarMultiplier=0.2
+    D:EvaporationTempMultiplier=0.1
+    D:HeatPerFuelTick=4.0
+
+    # Determines Electrolytic Separator usage
+    D:HydrogenEnergyDensity=200.0
+    D:JoulesToEU=10.0
+    D:JoulesToRF=2.5
+    D:JoulesToTesla=2.5
+    I:LaserDiggingEnergy=100000
+    I:LaserRange=64
+    B:LogPackets=false
+    D:MaxEnergyPerSteam=100.0
+    I:MaxFlamethrowerGas=24000
+    I:MaxJetpackGas=24000
+    I:MaxPlenisherNodes=4000
+    I:MaxPumpRange=80
+    I:MaxScubaGas=24000
+    I:MinerSilkMultiplier=6
+    I:ObsidianTNTBlastRadius=12
+    I:ObsidianTNTDelay=100
+    B:OpsBypassRestrictions=false
+    I:OsmiumPerChunk=12
+    B:PrefilledGasTanks=true
+    B:PumpWaterSources=false
+    D:RFToJoules=0.4
+    I:SaltPerChunk=2
+    B:SpawnBabySkeletons=true
+    D:SuperheatingHeatTransfer=10000.0
+    S:"Temperature Units"=K
+    D:TeslaToJoules=0.4
+    D:ThermalEvaporationSpeed=1.0
+    I:TinPerChunk=0
+    B:UpdateNotifications=true
+    I:UpgradeModifier=10
+    I:VoicePort=36123
+    B:VoiceServerEnabled=true
+    I:WorldRegenVersion=0
+}
+
+
+generation {
+    D:AdvancedSolarGeneration=300.0
+    D:BioGeneration=350.0
+    D:HeatGeneration=150.0
+    D:HeatGenerationLava=5.0
+    D:HeatGenerationNether=100.0
+    D:SolarGeneration=50.0
+    I:TurbineBladesPerCoil=4
+    I:TurbineCondenserFlowRate=32000
+    D:TurbineDisperserGasFlow=640.0
+    D:TurbineVentGasFlow=16000.0
+    D:WindGenerationMax=480.0
+    I:WindGenerationMaxY=255
+    D:WindGenerationMin=60.0
+    I:WindGenerationMinY=24
+}
+
+
+machines {
+    B:ChargepadEnabled=true
+    B:ChemicalCrystallizerEnabled=true
+    B:ChemicalDissolutionChamberEnabled=true
+    B:ChemicalInfuserEnabled=true
+    B:ChemicalInjectionChamberEnabled=true
+    B:ChemicalOxidizerEnabled=true
+    B:ChemicalWasherEnabled=true
+    B:CombinerEnabled=true
+    B:CrusherEnabled=true
+    B:DigitalMinerEnabled=true
+    B:ElectricPumpEnabled=true
+    B:ElectrolyticSeparatorEnabled=true
+    B:EnergizedSmelterEnabled=true
+    B:EnrichmentChamberEnabled=true
+    B:FactoryEnabled=true
+    B:FluidTankEnabled=true
+    B:FluidicPlenisherEnabled=true
+    B:FormulaicAssemblicatorEnabled=true
+    B:FuelwoodHeaterEnabled=true
+    B:LaserAmplifierEnabled=true
+    B:LaserEnabled=true
+    B:LaserTractorBeamEnabled=true
+    B:LogisticalSorterEnabled=true
+    B:MetallurgicInfuserEnabled=true
+    B:OredictionificatorEnabled=true
+    B:OsmiumCompressorEnabled=true
+    B:PersonalChestEnabled=true
+    B:PrecisionSawmillEnabled=true
+    B:PressurizedReactionChamberEnabled=true
+    B:PurificationChamberEnabled=true
+    B:QuantumEntangloporterEnabled=true
+    B:ResistiveHeaterEnabled=true
+    B:RotaryCondensentratorEnabled=true
+    B:SeismicVibratorEnabled=true
+    B:SolarNeutronActivatorEnabled=true
+    B:TeleporterEnabled=true
+}
+
+
+tier {
+    I:AdvancedBinStorage=8192
+    I:AdvancedCableCapacity=12800
+    D:AdvancedConductorConductionInsulation=400.0
+    D:AdvancedConductorHeatCapacity=1.0
+    D:AdvancedConductorInverseConduction=5.0
+    D:AdvancedEnergyCubeMaxEnergy=8000000.0
+    D:AdvancedEnergyCubeOutput=3200.0
+    I:AdvancedFluidTankOutput=800
+    I:AdvancedFluidTankStorage=28000
+    I:AdvancedGasTankOutput=512
+    I:AdvancedGasTankStorage=128000
+    D:AdvancedInductionCellMaxEnergy=8.0E9
+    D:AdvancedInductionProviderOutput=512000.0
+    I:AdvancedPipeCapacity=4000
+    I:AdvancedPipePullAmount=400
+    I:AdvancedTransporterPullAmount=16
+    I:AdvancedTransporterSpeed=10
+    I:AdvancedTubeCapacity=1024
+    I:AdvancedTubePullAmount=256
+    I:BasicBinStorage=4096
+    I:BasicCableCapacity=3200
+    D:BasicConductorConductionInsulation=10.0
+    D:BasicConductorHeatCapacity=1.0
+    D:BasicConductorInverseConduction=5.0
+    D:BasicEnergyCubeMaxEnergy=2000000.0
+    D:BasicEnergyCubeOutput=800.0
+    I:BasicFluidTankOutput=400
+    I:BasicFluidTankStorage=14000
+    I:BasicGasTankOutput=256
+    I:BasicGasTankStorage=64000
+    D:BasicInductionCellMaxEnergy=1.0E9
+    D:BasicInductionProviderOutput=64000.0
+    I:BasicPipeCapacity=1000
+    I:BasicPipePullAmount=100
+    I:BasicTransporterPullAmount=1
+    I:BasicTransporterSpeed=5
+    I:BasicTubeCapacity=256
+    I:BasicTubePullAmount=64
+    I:CreativeBinStorage=2147483647
+    I:CreativeFluidTankOutput=2147483647
+    I:CreativeFluidTankStorage=2147483647
+    I:CreativeGasTankOutput=2147483647
+    I:CreativeGasTankStorage=2147483647
+    I:EliteBinStorage=32768
+    I:EliteCableCapacity=64000
+    D:EliteConductorConductionInsulation=8000.0
+    D:EliteConductorHeatCapacity=1.0
+    D:EliteConductorInverseConduction=5.0
+    D:EliteEnergyCubeMaxEnergy=3.2E7
+    D:EliteEnergyCubeOutput=12800.0
+    I:EliteFluidTankOutput=1600
+    I:EliteFluidTankStorage=56000
+    I:EliteGasTankOutput=1028
+    I:EliteGasTankStorage=256000
+    D:EliteInductionCellMaxEnergy=6.4E10
+    D:EliteInductionProviderOutput=4096000.0
+    I:ElitePipeCapacity=16000
+    I:ElitePipePullAmount=1600
+    I:EliteTransporterPullAmount=32
+    I:EliteTransporterSpeed=20
+    I:EliteTubeCapacity=4096
+    I:EliteTubePullAmount=1024
+    I:UltimateBinStorage=262144
+    I:UltimateCableCapacity=320000
+    D:UltimateConductorConductionInsulation=100000.0
+    D:UltimateConductorHeatCapacity=1.0
+    D:UltimateConductorInverseConduction=5.0
+    D:UltimateEnergyCubeMaxEnergy=1.28E8
+    D:UltimateEnergyCubeOutput=51200.0
+    I:UltimateFluidTankOutput=3200
+    I:UltimateFluidTankStorage=112000
+    I:UltimateGasTankOutput=2056
+    I:UltimateGasTankStorage=512000
+    D:UltimateInductionCellMaxEnergy=5.12E11
+    D:UltimateInductionProviderOutput=3.2768E7
+    I:UltimatePipeCapacity=64000
+    I:UltimatePipePullAmount=6400
+    I:UltimateTransporterPullAmount=64
+    I:UltimateTransporterSpeed=50
+    I:UltimateTubeCapacity=16384
+    I:UltimateTubePullAmount=4096
+}
+
+
+usage {
+    D:ChemicalCrystallizerUsage=400.0
+    D:ChemicalDissolutionChamberUsage=400.0
+    D:ChemicalInfuserUsage=200.0
+    D:ChemicalInjectionChamberUsage=400.0
+    D:ChemicalWasherUsage=200.0
+    D:CombinerUsage=50.0
+    D:CrusherUsage=50.0
+    D:DigitalMinerUsage=100.0
+    D:ElectricPumpUsage=100.0
+    D:EnergizedSmelterUsage=50.0
+    D:EnrichmentChamberUsage=50.0
+    D:FactoryUsage=50.0
+    D:FluidicPlenisherUsage=100.0
+    D:FormulaicAssemblicatorUsage=100.0
+    D:GasCentrifugeUsage=100.0
+    D:HeavyWaterElectrolysisUsage=800.0
+    D:LaserUsage=5000.0
+    D:MetallurgicInfuserUsage=50.0
+    D:OsmiumCompressorUsage=100.0
+    D:OxidationChamberUsage=200.0
+    D:PrecisionSawmillUsage=50.0
+    D:PressurizedReactionBaseUsage=5.0
+    D:PurificationChamberUsage=200.0
+    D:RotaryCondensentratorUsage=50.0
+    D:SeismicVibratorUsage=50.0
+}

src/config/Morphtool.cfg

@@ -0,0 +1,27 @@
+# Configuration file
+
+general {
+    B:"Allow all items to be added"=false
+    S:"Blacklisted Mods" <
+        tconstruct
+        intangible
+     >
+    S:"Mod Aliases" <
+        botanicaladdons=botania
+        ThermalDynamics=ThermalExpansion
+        rftoolsdim=rftools
+     >
+    B:"Morph in the offhand instead of mainhand"=false
+    S:"Whitelisted Items" <
+        botania:twigWand
+        appliedenergistics2:ToolNetworkTool
+     >
+    S:"Whitelisted Names" <
+        wrench
+        screwdriver
+        hammer
+        rotator
+     >
+}
+
+

src/config/NoMobSpawningOnTrees.cfg

@@ -0,0 +1,22 @@
+# Configuration file
+
+general {
+    # For details, please check https://github.com/oldjunyi/NoMobSpawningOnTrees/wiki
+    S:blacklistRules <
+        woodlogs    # This line disables mob spawning on all types of wood logs.
+        block:minecraft:brown_mushroom_block || block:minecraft:red_mushroom_block
+        # The above line disables mob spawning on mushroom blocks.
+     >
+
+    # Extra spawning tries per tick. This will only applies to hostile mobs.
+    D:extraSpawningTries=0.0
+
+    # The capacity is the maximum (approximate) number of creatures can exist near the player.
+    # Set -1 to use the default value, which is: monster(70), animal(10), ambient(15), water(5)
+    I:spawnCapacityAmbient=-1
+    I:spawnCapacityAnimal=-1
+    I:spawnCapacityMonster=-1
+    I:spawnCapacityWater=-1
+}
+
+

src/config/PressurePipes/client.config

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    B:"Add filled canisters to NEI"=true
+    B:"Show fluid identifier on canisters"=false
+}
+
+

src/config/PressurePipes/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

src/config/Psi.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+general {
+    # The harvest level of a CAD for the purposes of block breaking spells. 3 is diamond level. Defaults to 2 (iron level)
+    I:"CAD Harvest Level"=2
+
+    # Controls whether the Psi Bar should be hidden if it's full and the player is holding an item that uses Psi.
+    B:"Context Sensitive Bar"=true
+
+    # The maximum scale your Psi bar can be. This prevents it from being too large on a bigger GUI scale. This is maximum amount of "on screen pixels" each actual pixel can take.
+    I:"Maximum Psi Bar Scale"=3
+
+    # Controls whether the Psi Bar should be rendered on the right of the screen or not.
+    B:"Psi Bar on the Right"=true
+
+    # How many compiled spells should be kept in a cache. Probably best not to mess with it if you don't know what you're doing.
+    I:"Spell Cache Size"=100
+
+    # Controls whether Psi is allowed to save and load Persistent Data outside your instance. This data is stored where .minecraft would be by default and is independent of instance, world or modpack, and allows you to instantly get back to the highest level you were at previously in your last world.
+    B:"Use Persistent Data"=true
+
+    # Controls whether Psi's shaders are used. If you're using the GLSL Shaders mod and are having graphical troubles with Psi stuff, you may want to turn this off.
+    B:"Use Shaders"=true
+
+    # Controls whether the "Particles" setting in the Vanilla options menu is accounted for when creating particles. Set to false to always have particles even if you change the Vanilla setting.
+    B:"Use Vanilla Particle Limiter"=true
+}
+
+

src/config/Quark.cfg

@@ -0,0 +1,601 @@
+# Configuration file
+
+_modules {
+    B:automation=true
+    B:building=true
+    B:decoration=true
+
+    # Experimental Features. All features in this module are disabled by default. Use at your own risk.
+    B:experimental=true
+    B:management=true
+    B:tweaks=true
+    B:vanity=true
+    B:world=true
+}
+
+
+automation {
+    B:"Dispensers place seeds"=true
+    B:"Ender watcher"=true
+    B:"Obsidian pressure plate"=true
+    B:"Rain detector"=true
+}
+
+
+building {
+    B:"Bark blocks"=true
+    B:"Carved wood"=true
+    B:"Charred nether bricks"=true
+    B:"Hardened clay tiles"=true
+    B:"Iron plates"=true
+    B:"Midori blocks"=true
+    B:"More sandstone"=true
+    B:"Polished stone"=true
+    B:"Sandy bricks"=true
+    B:"Snow bricks"=true
+    B:"Sugar cane blocks"=true
+    B:Thatch=true
+    B:"Vanilla stairs and slabs"=true
+    B:"Vanilla walls"=true
+    B:"World stone bricks"=true
+
+    "sugar cane blocks" {
+        B:"Enable stairs and slabs"=true
+        B:"Enable walls"=true
+    }
+
+    "more sandstone" {
+        B:"Enable stairs and slabs"=true
+    }
+
+    "vanilla walls" {
+        B:Andesite=true
+        B:Bricks=true
+        B:"Dark Prismarine"=true
+        B:Diorite=true
+        B:"End Bricks"=true
+        B:Granite=true
+        B:Prismarine=true
+        B:"Prismarine Bricks"=true
+        B:Purpur=true
+        B:Quartz=true
+        B:"Red Sandstone"=true
+        B:Sandstone=true
+        B:Stone=true
+        B:"Stone Bricks"=true
+    }
+
+    "hardened clay tiles" {
+        B:"Enable stained tiles"=true
+        B:"Enable stairs and slabs"=true
+    }
+
+    "bark blocks" {
+        B:"Enable walls"=true
+    }
+
+    "snow bricks" {
+        B:"Enable stairs and slabs"=true
+        B:"Enable walls"=true
+    }
+
+    "iron plates" {
+        B:"Enable stairs and slabs"=true
+    }
+
+    "sandy bricks" {
+        B:"Enable stairs and slabs"=true
+        B:"Enable walls"=true
+    }
+
+    "vanilla stairs and slabs" {
+        B:Andesite=true
+        B:"Dark Prismarine"=true
+        B:Diorite=true
+        B:"End Bricks"=true
+        B:Granite=true
+        B:Prismarine=true
+        B:"Prismarine Bricks"=true
+        B:"Red Nether Brick"=true
+        B:Stone=true
+    }
+
+    thatch {
+        B:"Enable stairs and slabs"=true
+        D:"Fall damage multiplier"=0.5
+    }
+
+    "charred nether bricks" {
+        B:"Enable stairs and slabs"=true
+    }
+
+    "world stone bricks" {
+        B:"Enable stairs and slabs"=true
+        B:"Enable walls"=true
+    }
+
+    "midori blocks" {
+        B:"Enable walls"=true
+    }
+
+}
+
+
+decoration {
+    B:"Blaze lantern"=true
+    B:"Charcoal block"=true
+    B:"Colored beds"=true
+    B:"Colored item frames"=true
+    B:"Leaf carpets"=true
+    B:"Lit lamp"=true
+    B:"More banners"=true
+    B:"Nether brick fence gate"=true
+    B:"Paper wall"=true
+    B:"Varied bookshelves"=true
+    B:"Varied chests"=true
+    B:"Varied trapdoors"=true
+
+    "more banners" {
+        B:Dragon=true
+        B:Eye=true
+        B:Shield=true
+        B:Sword=true
+    }
+
+    "colored beds" {
+        # This also changes the stack size of the vanilla bed.
+        I:"Bed Stack Size"=64
+
+        # The default color of bed to be created if wool types are mixed. 0 is white, 15 is black, 14 is vanilla red bed.
+        I:"Default Color"=0
+        B:"Rename vanilla bed to Red Bed"=true
+    }
+
+    "varied trapdoors" {
+        I:"Amount of trapdoors crafted (vanilla is 2)"=6
+        B:"Rename vanilla trapdoor to Oak Trapdoor"=true
+    }
+
+    "varied chests" {
+        B:"Add recipe to craft chests using Logs (makes 4 chests)"=true
+        B:"Rename vanilla chests to Oak (Trapped) Chest"=true
+    }
+
+    "varied bookshelves" {
+        B:"Rename vanilla bookshelves to Oak Bookshelf"=true
+    }
+
+}
+
+
+experimental {
+    B:"Bigger caves"=false
+
+    # Adds a /quarkconfig command which allows for modification of the Quark config file through any means that can run commands at permission 2 (command block level) or higher.
+    # 
+    # An example syntax of the command would be /quarkconfig management "store to chests" "B:Invert button" true nosave playerdude
+    # Doing this would set the dropoff button for playerdude to be inverted. "save" means it should save the changes to the config file on disk. Using "nosave" won't save.
+    # 
+    # Another example can be /quarkconfig tweaks - "Shearable chickens" false
+    # This disables shearable chickens for everybody on the server. "nosave" doesn't need to be included, as it's the default.
+    # "nosave" does need to be there if a player name is used. Lastly, - signifies no subcategory inside the module.
+    B:"Config command"=false
+
+    # Suppresses all STDOUT (and STDERR, if enabled) messages so they don't show up in the console.
+    # Use this if some mod left behind debug messages and you don't want to see them.
+    # If important messages end up being disabled by this, tell the modders in case to switch to a proper logger.
+    B:"Print suppressor"=false
+
+    "bigger caves" {
+        # Vanilla value is 1
+        D:"Big Cave Size Minimum"=1.0
+
+        # Vanilla value is 3
+        D:"Big Cave Size Variance"=8.0
+
+        # Given the value of this config as X, in average, 1 in X caves will be a huge cave
+        I:"Huge Cave Chance"=1800
+        I:"Huge Cave Maximum Y Level"=32
+        D:"Huge Cave Size Minimum"=14.0
+        D:"Huge Cave Size Variance"=6.0
+        B:"Huge Caves Enabled"=true
+
+        # Vanilla value is 0
+        D:"Overall Cave Size Minimum"=0.0
+
+        # Vanilla value is 3
+        D:"Overall Cave Size Variance"=7.0
+    }
+
+    "print suppressor" {
+        B:"Suppress STDERR"=false
+        B:"Suppress STDOUT"=true
+    }
+
+}
+
+
+management {
+    B:"Chest buttons"=true
+    B:"Ctrl-click an item to favorite it. Favorited items aren't stored by the other features here"=true
+    B:"Press F in the inventory to switch item to main hand"=true
+    B:"Press T in the inventory to link items to chat"=true
+    B:"Store to chests"=true
+
+    "store to chests" {
+        B:"Invert button"=false
+    }
+
+    "chest buttons" {
+        B:"Enable Deposit Button"=true
+        B:"Enable Restock Button"=true
+        B:"Enable Smart Deposit Button"=true
+    }
+
+}
+
+
+tweaks {
+    B:"Allow crafting stone tools using flint"=true
+    B:"Armed armor stands"=true
+    B:"Auto jump hotkey"=true
+    B:"Baby zombies burn"=true
+    B:"Chickens shed feathers"=true
+    B:"Convert Clay Blocks to Clay"=true
+    B:"Creepers turn red when they're exploding"=true
+    B:"Deploy ladders down"=true
+    B:"Dragon's Breath doesn't leave a bottle behind"=true
+    B:"Endermen teleport you to them if you're in a 2 high area"=true
+    B:"Glass shards"=true
+    B:"Greener grass"=true
+    B:"Hoes break a 5x5 of plants"=true
+    B:"Jump boost allows to step up 1 block"=true
+    B:"Knock on doors"=true
+    B:"Less intrusive shields"=true
+    B:"Look down on ladders to descend fast"=true
+    B:"Named snow golems with pumpkins drop player heads if killed by a witch"=true
+    B:"No potion shift"=true
+    B:"Note blocks play mob sounds if there's a head attached"=true
+    B:"Remove layers of snow by right clicking with a shovel"=true
+    B:"Ridable mobs are immune to rider's arrows"=true
+    B:"Right click minecarts to add blocks to them"=true
+    B:"Right click sign edit"=true
+    B:"Shearable chickens"=true
+    B:"Sheep have armor while wearing wool"=true
+    B:"Slabs to blocks recipe"=true
+    B:"Stackable items"=true
+    B:"Stair crafting makes more"=true
+
+    "greener grass" {
+        # Sets the grass color to be a "Minecraft Alpha" tone.
+        # This will override all manual shift values.
+        B:"Alpha grass"=false
+        S:"Extra blocks" <
+            buildingbrickscompatvanilla:grass_slab
+            buildingbrickscompatvanilla:grass_step
+            buildingbrickscompatvanilla:grass_corner
+            buildingbrickscompatvanilla:grass_vertical_slab
+            buildingbrickscompatvanilla:grass_stairs
+         >
+        I:"Shift blues by"=-30
+        I:"Shift greens by"=30
+        I:"Shift reds by"=-30
+        B:"Should affect folliage"=true
+        B:"Treat shifts as absolute and ignore biome colors"=false
+    }
+
+    "sheep have armor while wearing wool" {
+        # The amount of armor points to give to a sheep when it is not sheared.
+        D:"Sheep Armor Amount"=1.0
+    }
+
+    "slabs to blocks recipe" {
+        # The stack size for the vanilla slab recipe, used for automatically detecting slab recipes
+        I:"Vanilla stack size"=6
+    }
+
+    "endermen teleport you to them if you're in a 2 high area" {
+        # The minimum difficulty in which this effect should take place. (1: easy, 2: normal, 3: hard)
+        I:"Minimum Difficulty"=2
+    }
+
+    "right click minecarts to add blocks to them" {
+        B:"Enable Command Block and Mob Spawner"=true
+    }
+
+    "stackable items" {
+        I:Minecarts=16
+    }
+
+    "jump boost allows to step up 1 block" {
+        B:"Can toggle with sneaking"=true
+        I:"Minimum Jump Boost level"=2
+    }
+
+    "right click sign edit" {
+        B:"Requires Empty Hands"=false
+    }
+
+    "stair crafting makes more" {
+        B:"Add stairs to blocks recipe"=true
+        I:"Target stack size (must be a divisor of 24 if 'Reversion recipe' is enabled)"=8
+
+        # The stack size for the vanilla stair recipe, used for automatically detecting stair recipes
+        I:"Vanilla stack size"=4
+    }
+
+    "chickens shed feathers" {
+        B:"Chicks drop feathers"=true
+        I:"Drop frequency (lower means more)"=28000
+        B:"Force at least one feather on kill"=true
+    }
+
+}
+
+
+vanity {
+    B:"Boat sails"=true
+    B:"Dyable elytra"=true
+    B:"Emote system"=true
+    B:"Firework cloning"=true
+
+    # Shift-Ctrl-F12 for panorama screenshot.
+    # Panoramas show up in the main menu.
+    # Rename a panorama folder to 'main_menu' and it'll always show that one.
+    B:"Panorama maker"=true
+    B:"Sit in stairs"=true
+    B:"Witch hat"=true
+
+    "emote system" {
+        # Should keybinds for emotes be generated? (They're all unbound by default)
+        B:"Enable Keybinds"=true
+    }
+
+    "panorama maker" {
+        B:"Use panorama screenshots on main menu"=true
+    }
+
+    "witch hat" {
+        D:"Drop Chance boost per looting level"=0.01
+        D:"Drop Chance from witches"=0.025
+        B:"Halve witch damage"=true
+    }
+
+}
+
+
+world {
+    B:"Ancient tomes"=true
+    B:Basalt=true
+    B:"Big mushrooms generate in swamps"=true
+    B:Biotite=true
+    B:"Blazes spawn naturally in the nether"=true
+    B:"Buried treasure"=true
+    B:"Color runes"=true
+    B:"Default world options"=true
+    B:"Depth mobs"=true
+    B:"Extra arrows"=true
+    B:"Generate clay underground like dirt"=true
+    B:"Guardians spawn in oceans"=true
+    B:"Pirate ships"=true
+
+    # Allows for usage of a new Realistic world type, made by /u/Soniop.
+    # https://www.reddit.com/r/Minecraft/comments/4nfw3t/more_realistic_generation_preset_in_comment/
+    # If you want to use it in multiplayer, set the world type to "quark_realistic"
+    B:"Realistic world type"=true
+    B:"Slime bucket"=true
+    B:Wraiths=true
+
+    "pirate ships" {
+        # Disables the pirate mob and generator, only adds the hat
+        B:"Only hat"=false
+
+        # Given this value as X, 1 ship will spawn in X ocean biome chunks
+        I:"Pirate Ship Rarity"=1200
+    }
+
+    "guardians spawn in oceans" {
+        B:"Deep ocean only"=false
+        I:"Largest spawn group"=4
+
+        # Disables guardians' attack sound if they aren't attacking a player
+        B:"Shut Guardians Up"=true
+        I:"Smallest spawn group"=2
+
+        # (Squids have 10, note that guardians have a 95% chance to not spawn when they would be spawned)
+        I:"Spawn Weight"=15
+    }
+
+    "blazes spawn naturally in the nether" {
+        I:"Largest spawn group"=3
+        I:"Smallest spawn group"=1
+        I:"Spawn Weight"=20
+    }
+
+    "extra arrows" {
+        B:"Enable Ender Arrow"=true
+        B:"Enable Explosive Arrow"=true
+        B:"Enable Torch Arrow"=true
+        B:"Explosive Arrow Destroys Blocks"=true
+        D:"Explosive Arrow Power"=2.0
+    }
+
+    "color runes" {
+        I:"Desert Temple loot weight"=15
+        I:"Dungeon loot weight"=20
+        I:"Item quality for loot"=0
+        I:"Jungle Temple loot weight"=15
+        I:"Nether Fortress loot weight"=15
+    }
+
+    "default world options" {
+        I:andesiteCount=10
+        I:andesiteMaxHeight=80
+        I:andesiteMinHeight=0
+        I:andesiteSize=33
+        D:baseSize=8.5
+        D:biomeDepthOffset=0.0
+        D:biomeDepthWeight=1.0
+        D:biomeScaleOffset=0.0
+        D:biomeScaleWeight=1.0
+        I:biomeSize=4
+        I:coalCount=20
+        I:coalMaxHeight=128
+        I:coalMinHeight=0
+        I:coalSize=17
+        D:coordinateScale=684.412
+        D:depthNoiseScaleExponent=0.5
+        D:depthNoiseScaleX=200.0
+        D:depthNoiseScaleZ=200.0
+        I:diamondCount=1
+        I:diamondMaxHeight=16
+        I:diamondMinHeight=0
+        I:diamondSize=8
+        I:dioriteCount=10
+        I:dioriteMaxHeight=80
+        I:dioriteMinHeight=0
+        I:dioriteSize=33
+        I:dirtCount=10
+        I:dirtMaxHeight=256
+        I:dirtMinHeight=0
+        I:dirtSize=33
+        I:dungeonChance=8
+        I:fixedBiome=-1
+        I:goldCount=2
+        I:goldMaxHeight=32
+        I:goldMinHeight=0
+        I:goldSize=9
+        I:graniteCount=10
+        I:graniteMaxHeight=80
+        I:graniteMinHeight=0
+        I:graniteSize=33
+        I:gravelCount=8
+        I:gravelMaxHeight=256
+        I:gravelMinHeight=0
+        I:gravelSize=33
+        D:heightScale=684.412
+        I:ironCount=20
+        I:ironMaxHeight=64
+        I:ironMinHeight=0
+        I:ironSize=9
+        I:lapisCenterHeight=16
+        I:lapisCount=1
+        I:lapisSize=7
+        I:lapisSpread=16
+        I:lavaLakeChance=80
+        D:lowerLimitScale=512.0
+        D:mainNoiseScaleX=80.0
+        D:mainNoiseScaleY=160.0
+        D:mainNoiseScaleZ=80.0
+        I:redstoneCount=8
+        I:redstoneMaxHeight=16
+        I:redstoneMinHeight=0
+        I:redstoneSize=8
+        I:riverSize=4
+        I:seaLevel=63
+        D:stretchY=12.0
+        D:upperLimitScale=512.0
+        B:useCaves=true
+        B:useDungeons=true
+        B:useLavaLakes=true
+        B:useLavaOceans=false
+        B:useMineShafts=true
+        B:useMonuments=true
+        B:useRavines=true
+        B:useStrongholds=true
+        B:useTemples=true
+        B:useVillages=true
+        B:useWaterLakes=true
+        I:waterLakeChance=4
+    }
+
+    wraiths {
+        I:"Curse Range"=64
+
+        # How long the curse effect lasts for (in ticks)
+        I:"Curse Time"=24000
+        B:"Enable Curse"=true
+        I:"Largest spawn group"=6
+        I:"Smallest spawn group"=4
+        I:"Spawn Weight"=60
+    }
+
+    "generate clay underground like dirt" {
+        I:"Cluster count"=3
+        I:"Cluster size"=20
+    }
+
+    biotite {
+        I:"Cluster count for natural generation"=16
+        I:"Cluster size"=14
+        I:"Clusters generated per dragon death tick"=16
+        B:"Enable walls"=true
+        B:"Generate by dragon kill"=true
+        B:"Generate naturally"=false
+        I:"Generation delay on dragon death"=1
+    }
+
+    "depth mobs" {
+        # (Skeleton is 100)
+        I:"Ashen Spawn Weight"=10
+
+        # (Zombie is 100)
+        I:"Dweller Spawn Weight"=10
+        B:"Enable Ashen"=true
+        B:"Enable Dweller"=true
+        I:"Highest Y level for spawns"=20
+        I:"Largest Ashen spawn group"=2
+        I:"Largest Dweller spawn group"=2
+        I:"Smallest Ashen spawn group"=1
+        I:"Smallest Dweller spawn group"=1
+    }
+
+    "buried treasure" {
+        I:"Treasure map Rarity"=10
+
+        # This is used for the luck attribute in loot tables. It doesn't affect the loot you get from the map itself.
+        I:"Treasure map item quality"=2
+    }
+
+    "ancient tomes" {
+        I:"Dungeon loot weight"=8
+        I:"Item quality for loot"=2
+        I:"Stronghold Library loot weight"=12
+        S:"Valid Enchantments" <
+            minecraft:feather_falling
+            minecraft:thorns
+            minecraft:sharpness
+            minecraft:smite
+            minecraft:bane_of_arthropods
+            minecraft:knockback
+            minecraft:fire_aspect
+            minecraft:looting
+            minecraft:efficiency
+            minecraft:unbreaking
+            minecraft:fortune
+            minecraft:power
+            minecraft:punch
+            minecraft:luck_of_the_sea
+            minecraft:lure
+         >
+    }
+
+    basalt {
+        B:"Enable stairs and slabs"=true
+        B:"Enable walls"=true
+        B:"Generate in nether"=true
+        B:"Generate in overworld"=false
+        I:"Nether cluster count"=1
+        I:"Nether cluster size"=80
+        I:"Overworld cluster count"=10
+        I:"Overworld cluster size"=33
+    }
+
+    "big mushrooms generate in swamps" {
+        # Must be an integer if above 1. If below 1, works as a chance to generate one per chunk.
+        D:"Big Mushroom count per chunk"=0.5
+    }
+
+}
+
+

src/config/SpiceOfLife.cfg

@@ -0,0 +1,144 @@
+# Configuration file
+
+##########################################################################################################
+#  main
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are server-side only
+# Their values will get synced to all clients on the server
+##########################################################################################################
+
+" main " {
+    # If false, disables the entire diminishing returns part of the mod
+    B:food.modifier.enabled=true
+}
+
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are client-side only
+##########################################################################################################
+
+client {
+    # If true, left clicking the air while holding a food container will open it (so that it can be eaten from)
+    B:left.click.opens.food.containers=false
+}
+
+
+##########################################################################################################
+# foodgroups
+#--------------------------------------------------------------------------------------------------------#
+# Food groups are defined using .json files in /config/SpiceOfLife/
+# See /config/SpiceOfLife/example-food-group.json
+##########################################################################################################
+
+foodgroups {
+}
+
+
+##########################################################################################################
+# server
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are server-side only
+# Their values will get synced to all clients on the server
+##########################################################################################################
+
+server {
+    # If true, foods' hunger value will be multiplied by the current nutritional value
+    # Setting this to false and affect.food.saturation.modifiers to true will make diminishing returns affect saturation only
+    B:affect.food.hunger.values=true
+
+    # If true, foods' saturation modifier will be multiplied by the current nutritional value
+    # NOTE: When affect.food.hunger.values is true, saturation bonuses of foods will automatically decrease as the hunger value of the food decreases
+    # Setting this to true when affect.food.hunger.values is true will make saturation bonuses decrease disproportionately more than hunger values
+    # Setting this to true and affect.food.saturation.modifiers to false will make diminishing returns affect saturation only
+    B:affect.food.saturation.modifiers=false
+
+    # If true, foods with negative hunger values will be made more negative as nutritional value decreases
+    # NOTE: affect.food.hunger.values must be true for this to have any affect
+    B:affect.negative.food.hunger.values=false
+
+    # If true, foods with negative saturation modifiers will be made more negative as nutritional value decreases
+    # NOTE: affect.food.saturation.modifiers must be true for this to have any affect
+    B:affect.negative.food.saturation.modifiers=false
+
+    # If true, a player's food history will be empty once they pass the new.player.food.eaten.threshold
+    # If false, any food eaten before the threshold is passed will also count after it is passed
+    B:clear.history.after.food.eaten.threshold.reached=false
+
+    # The chance for food to drop from an open food container when the player jumps
+    # Temporarily disabled while a better implementation is written (this config option will do nothing)
+    D:food.containers.chance.to.drop.food=0.25
+
+    # The maximum stacksize per slot in a food container
+    I:food.containers.max.stacksize=16
+
+    # The maximum time it takes to eat a food after being modified by food.eating.speed.modifier
+    # The default eating duration is 32. Set this to 0 to remove the limit on eating speed.
+    # Note: If this is set to 0 and food.eating.speed.modifier is > 0, a food with 0% nutrtional value will take nearly infinite time to eat
+    I:food.eating.duration.max=0
+
+    # If set to greater than zero, food eating speed will be affected by nutritional value
+    # (meaning the lower the nutrtional value, the longer it will take to eat it)
+    # Eating duration is calcualted using the formula (eating_duration / (nutritional_value^eating_speed_modifier))
+    D:food.eating.speed.modifier=1.0
+
+    # The maximum amount of eaten foods stored in the history at a time
+    I:food.history.length=8
+
+    # If true, food history will not get reset after every death
+    B:food.history.persists.through.death=false
+
+    # Rounding mode used on the hunger value of foods
+    # Valid options: 'round', 'floor', 'ceiling'
+    S:food.hunger.rounding.mode=round
+
+    # Uses the EvalEx expression parser
+    # See: https://github.com/uklimaschewski/EvalEx for syntax/function documentation
+    #
+    # Available variables:
+    # 	count : The number of times the food (or its food group) has been eaten within the food history
+    # 	hunger_count : The total amount of hunger that the food (or its food group) has restored within the food history (1 hunger unit = 1/2 hunger bar)
+    # 	saturation_count : The total amount of saturation that the food (or its food group) has restored within the food history (1 saturation unit = 1/2 saturation bar)
+    # 	max_history_length : The maximum length of the food history (see food.history.length)
+    # 	cur_history_length : The current length of the food history (<= max_history_length)
+    # 	food_hunger_value : The default amount of hunger the food would restore in hunger units (1 hunger unit = 1/2 hunger bar)
+    # 	food_saturation_mod : The default saturation modifier of the food
+    # 	cur_hunger : The current hunger value of the player in hunger units (20 = full)
+    # 	cur_saturation : The current saturation value of the player
+    # 	total_food_eaten : The all-time total number of times any food has been eaten by the player
+    # 	food_group_count : The number of food groups that the food belongs to
+    # 	distinct_food_groups_eaten : The number of distinct food groups in the player's current food history
+    # 	total_food_groups : The total number of enabled food groups
+    #
+    S:food.modifier.formula=MAX(0, (1 - count/12))^MIN(8, food_hunger_value)
+
+    # If true, a food journal will be given to each player as a starting item
+    B:give.food.journal.as.starting.item=false
+
+    # If true, a food journal will be given to each player once diminishing returns start for them
+    # Not given if a player was given a food journal by give.food.journal.as.starting.item
+    B:give.food.journal.on.dimishing.returns.start=false
+
+    # The number of times a new player (by World) needs to eat before this mod has any effect
+    I:new.player.food.eaten.threshold=50
+
+    # If true, any foods not in a food group will be excluded from diminishing returns
+    B:use.food.groups.as.whitelists=false
+
+    # If true, food.history.length will use amount of hunger restored instead of number of foods eaten for its maximum length
+    # For example, a food.history.length length of 12 will store a max of 2 foods that restored 6 hunger each,
+    # 3 foods that restored 4 hunger each, 12 foods that restored 1 hunger each, etc
+    # NOTE: food.history.length uses hunger units, where 1 hunger unit = 1/2 hunger bar
+    B:use.hunger.restored.for.food.history.length=false
+
+    # If true, food.history.length will use time (in Minecraft days) instead of number of foods eaten for its maximum length
+    # For example, a food.history.length length of 12 will store all foods eaten in the last 12 Minecraft days.
+    # Note: On servers, time only advances for each player while they are logged in unless use.time.progress.time.while.logged.off is set to true
+    # Also note: use.hunger.restored.for.food.history.length must be false for this config option to take effect
+    B:use.time.for.food.history.length=false
+
+    # If true, food history time will still progress for each player while that player is logged out.
+    # NOTE: use.time.for.food.history.length must be true for this to have any affect
+    B:use.time.progress.time.while.logged.off=false
+}

src/config/StorageDrawers.cfg

@@ -0,0 +1,107 @@
+# Configuration file
+
+addons {
+    B:showBlocksInCreative=true
+    B:showBlocksInNEI=true
+    B:useSeparateCreativeTabs=true
+}
+
+
+blocks {
+
+    fulldrawers1 {
+        I:baseStorage=32
+        B:enabled=true
+        I:recipeOutput=1
+    }
+
+    fulldrawers2 {
+        I:baseStorage=16
+        B:enabled=true
+        I:recipeOutput=2
+    }
+
+    fulldrawers4 {
+        I:baseStorage=8
+        B:enabled=true
+        I:recipeOutput=4
+    }
+
+    halfdrawers2 {
+        I:baseStorage=8
+        B:enabled=true
+        I:recipeOutput=2
+    }
+
+    halfdrawers4 {
+        I:baseStorage=4
+        B:enabled=true
+        I:recipeOutput=4
+    }
+
+    compdrawers {
+        I:baseStorage=16
+        B:enabled=true
+        I:recipeOutput=1
+    }
+
+    controller {
+        B:enabled=true
+        I:range=12
+    }
+
+    trim {
+        B:enabled=true
+        I:recipeOutput=4
+    }
+
+    controllerslave {
+        B:enabled=true
+    }
+
+}
+
+
+general {
+    B:creativeTabVanillaWoods=true
+    B:enableCreativeUpgrades=true
+
+    # Writes additional log messages while using the mod.  Mainly for debug purposes.  Should be kept disabled unless instructed otherwise.
+    B:enableDebugLogging=false
+    B:enableDrawerUI=true
+    B:enableFallbackRecipes=true
+    B:enableFramedDrawers=true
+    B:enableIndicatorUpgrades=true
+    B:enableItemConversion=true
+    B:enableLockUpgrades=true
+    B:enablePersonalUpgrades=true
+    B:enableRedstoneUpgrades=true
+    B:enableShroudUpgrades=true
+    B:enableSidedInput=true
+    B:enableSidedOutput=true
+    B:enableStorageUpgrades=true
+    B:enableTape=true
+    B:enableVoidUpgrades=true
+
+    # Inverts how shift works with drawers. If this is true, shifting will only give one item, where regular clicks will give a full stack. Leave false for default behavior.
+    B:invertShift=false
+    S:itemRenderType=fast
+    S:wailaStackRemainder=stack + remainder
+}
+
+
+integration {
+    B:enableThaumcraft=true
+    B:enableWaila=true
+}
+
+
+upgrades {
+    I:level2Mult=2
+    I:level3Mult=3
+    I:level4Mult=5
+    I:level5Mult=8
+    I:level6Mult=13
+}
+
+

src/config/TinkerModules.cfg

@@ -0,0 +1,25 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Debug utilities
+    B:TinkerDebug=false
+
+    # All the fun toys
+    B:TinkerGadgets=true
+
+    # The smeltery and items needed for it
+    B:TinkerSmeltery=true
+
+    # All the tools and everything related to it.
+    B:TinkerTools=true
+
+    # Everything that's found in the world and worldgen
+    B:TinkerWorld=true
+    B:WailaIntegration=true
+    B:chiselsandbitsIntegration=true
+    B:craftingtweaksIntegration=true
+}
+
+

src/config/Translocator.cfg

@@ -0,0 +1,7 @@
+#Translocator Configuration File
+#Deleting any element will restore it to it's default value
+
+clientUpdateCheck=true
+
+#Setting this to true will disable the placement of the CraftingGrid.
+disableCraftingGrid=false

src/config/UniDict.cfg

@@ -0,0 +1,174 @@
+# Configuration file
+
+~CONFIG_VERSION: 1.10.2-1.8c
+
+general {
+    # auto hide items in JEI? [default: true]
+    B:autoHideInJEI=true
+
+    # put here things that you don't want to hide in JEI.
+    # only works if keepOneEntry is false. [default: [ore]]
+    S:autoHideInJEIBlackList <
+        ore
+     >
+
+    # Enabling this will remove all non-standard items as input.
+    # Note: this will only affect machines that doesn't use OreDictionary. [default: false]
+    B:inputReplacement=false
+
+    # keep only one entry per ore dict entry? [default: false]
+    B:keepOneEntry=false
+
+    # mods listed here will be blacklisted in keepOneEntry.
+    # must be the exact modID. [default: ]
+    S:keepOneEntryModBlackList <
+     >
+
+    # Enable this to keep track of all the kinds.
+    # the output will be in logs folder. [default: false]
+    B:kindDebugMode=false
+
+    # This allows to the user register their own ore entries before the Unification happen.
+    # this is mainly useful when the user is trying to unify things that aren't registered previously in the Ore Dictionary.
+    # 
+    # Format:
+    # weirdStone+minecraft:stone#1
+    # The example above will register Granite as weirdStone. [default: ]
+    S:userRegisteredOreDictEntries <
+     >
+}
+
+
+integrations {
+    # AbyssalCraft Integration. [default: true]
+    B:abyssalCraft=true
+
+    # Base Metals Integration. [default: true]
+    B:baseMetals=true
+
+    # Blood Magic Integration. [default: true]
+    B:bloodMagic=true
+
+    # Calculator Integration. [default: false]
+    B:calculator=false
+
+    # Ender IO Integration. [default: true]
+    B:enderIO=true
+
+    # Forestry Integration. [default: true]
+    B:forestry=true
+
+    # Foundry Integration. [default: true]
+    B:foundry=true
+
+    # Immersive Engineering Integration. [default: true]
+    B:immersiveEngineering=true
+
+    # Industrial Craft 2 Integration. [default: true]
+    B:industrialCraft2=true
+
+    # Mekanism Integration. [default: true]
+    B:mekanism=true
+
+    # TechReborn Integration. [default: true]
+    B:techReborn=true
+
+    # Techy Integration. [default: true]
+    B:techy=true
+}
+
+
+modules {
+    # Integration Module enabled?
+    # if false all the Integrations will be disabled.
+    #  [default: true]
+    B:integration=true
+}
+
+
+resources {
+    # what kind of child do you want to make a standard?
+    #  [default: [ore], [dustTiny], [dustSmall], [chunk], [dust], [nugget], [ingot], [block], [plate], [gear], [rod]]
+    S:childrenOfMetals <
+        ore
+        dustTiny
+        dustSmall
+        chunk
+        dust
+        nugget
+        ingot
+        block
+        plate
+        gear
+        rod
+     >
+
+    # Here you can put a list to custom unify them.
+    # must be in this format "ResourceName:kind1|kind2|...". [default: [Obsidian:dustTiny|dust], [Stone:dust]]
+    S:customUnifiedResources <
+        Obsidian:dustTiny|dust
+        Stone:dust
+     >
+
+    # enabling this allow you to specify the "owner" of each kind.
+    # also will make "S:ownerOfEveryThing" be ignored. [default: false]
+    B:enableSpecificKindSort=false
+
+    # list of things to do unifying things.
+    #  [default: [Iron], [Gold], [Copper], [Tin], [Silver], [Lead], [Nickel], [Platinum], [Zinc], [Aluminium], [Aluminum], [Alumina], [Chrome], [Chromium], [Iridium], [Osmium], [Titanium], [Tungsten], [Bronze], [Steel], [Brass], [Invar], [Electrum], [Signalum], [Cupronickel]]
+    S:metalsToUnify <
+        Iron
+        Gold
+        Copper
+        Tin
+        Silver
+        Lead
+        Nickel
+        Platinum
+        Zinc
+        Aluminium
+        Aluminum
+        Alumina
+        Chrome
+        Chromium
+        Iridium
+        Osmium
+        Titanium
+        Tungsten
+        Bronze
+        Steel
+        Brass
+        Invar
+        Electrum
+        Signalum
+        Cupronickel
+     >
+
+    # all the entries will be sorted according to the modID list below
+    # must be the exact modID.
+    #  [default: [substratum], [minecraft], [ic2], [techreborn]]
+    S:ownerOfEveryThing <
+        substratum
+        minecraft
+        ic2
+        techreborn
+     >
+
+    # resources to be black-listed.
+    # this exists to avoid duplicates.
+    # this affect the API. [default: [Aluminium]]
+    S:resourceBlackList <
+        Aluminium
+     >
+}
+
+
+vanillaintegrations {
+    # Crafting Integration [default: true]
+    B:craftingIntegration=true
+
+    # Furnace Integration [default: true]
+    B:furnaceIntegration=true
+}
+
+

src/config/Waila.cfg

@@ -0,0 +1,126 @@
+# Configuration file
+
+general {
+    I:waila.cfg.alpha=80
+    I:waila.cfg.bgcolor=1048592
+    I:waila.cfg.fontcolor=10526880
+    I:waila.cfg.gradient1=5243135
+    I:waila.cfg.gradient2=2621567
+    I:waila.cfg.heartsperline=20
+    B:waila.cfg.keybind=true
+    B:waila.cfg.liquid=false
+    I:waila.cfg.maxhpbeforetext=40
+    B:waila.cfg.metadata=false
+    B:waila.cfg.newfilters=true
+    I:waila.cfg.posx=5000
+    I:waila.cfg.posy=100
+    I:waila.cfg.scale=100
+    B:waila.cfg.shiftblock=false
+    B:waila.cfg.shiftents=false
+    B:waila.cfg.show=true
+    B:waila.cfg.showmode=true
+}
+
+
+##########################################################################################################
+# modules
+#--------------------------------------------------------------------------------------------------------#
+# Those are the config keys defined in modules.
+# Server side, it is used to enforce keys client side using the next section.
+##########################################################################################################
+
+modules {
+    B:BloodMagic.array=true
+    B:BloodMagic.bloodAltar=true
+    B:BloodMagic.bypassSneak=false
+    B:BloodMagic.ritualController=true
+    B:BloodMagic.teleposer=true
+    B:darkutils.feeder.info=true
+    B:darkutils.filter.type=true
+    B:darkutils.sneaky.owner=true
+    B:darkutils.timer.time=true
+    B:endertanks.showtankdata=true
+    B:general.showcrop=true
+    B:general.showents=true
+    B:general.showhp=true
+    B:harvestability.currentlyharvestable=true
+    B:harvestability.currentlyharvestable.sneakingonly=false
+    B:harvestability.effectivetool=true
+    B:harvestability.effectivetool.sneakingonly=false
+    B:harvestability.harvestlevel=true
+    B:harvestability.harvestlevel.sneakingonly=false
+    B:harvestability.harvestlevelnum=false
+    B:harvestability.harvestlevelnum.sneakingonly=false
+    B:harvestability.minimal=false
+    B:harvestability.oresonly=false
+    B:harvestability.shearability=true
+    B:harvestability.shearability.sneakingonly=false
+    B:harvestability.silktouchability=true
+    B:harvestability.silktouchability.sneakingonly=false
+    B:harvestability.toolrequiredonly=true
+    B:harvestability.unharvestableonly=false
+    B:soulshardstow.displayOwner=false
+    B:tconstruct.casting=true
+    B:tconstruct.progress=true
+    B:tconstruct.tank=true
+    B:vanilla.comparator=true
+    B:vanilla.jukebox=true
+    B:vanilla.leverstate=true
+    B:vanilla.redstone=true
+    B:vanilla.repeater=true
+    B:vanilla.silverfish=true
+    B:vanilla.spawntype=true
+}
+
+
+##########################################################################################################
+# server_forcing
+#--------------------------------------------------------------------------------------------------------#
+# Any key set to true here will ensure that the client is using the configuration set in the 'module' section above.
+# This is useful for enforcing false to 'cheating' keys like silverfish.
+##########################################################################################################
+
+server_forcing {
+    B:BloodMagic.array=false
+    B:BloodMagic.bloodAltar=false
+    B:BloodMagic.bypassSneak=false
+    B:BloodMagic.ritualController=false
+    B:BloodMagic.teleposer=false
+    B:darkutils.feeder.info=false
+    B:darkutils.filter.type=false
+    B:darkutils.sneaky.owner=false
+    B:darkutils.timer.time=false
+    B:endertanks.showtankdata=false
+    B:general.showcrop=false
+    B:general.showents=false
+    B:general.showhp=false
+    B:harvestability.currentlyharvestable=false
+    B:harvestability.currentlyharvestable.sneakingonly=false
+    B:harvestability.effectivetool=false
+    B:harvestability.effectivetool.sneakingonly=false
+    B:harvestability.harvestlevel=false
+    B:harvestability.harvestlevel.sneakingonly=false
+    B:harvestability.harvestlevelnum=false
+    B:harvestability.harvestlevelnum.sneakingonly=false
+    B:harvestability.minimal=false
+    B:harvestability.oresonly=false
+    B:harvestability.shearability=false
+    B:harvestability.shearability.sneakingonly=false
+    B:harvestability.silktouchability=false
+    B:harvestability.silktouchability.sneakingonly=false
+    B:harvestability.toolrequiredonly=false
+    B:harvestability.unharvestableonly=false
+    B:soulshardstow.displayOwner=false
+    B:tconstruct.casting=false
+    B:tconstruct.progress=false
+    B:tconstruct.tank=false
+    B:vanilla.comparator=false
+    B:vanilla.jukebox=false
+    B:vanilla.leverstate=false
+    B:vanilla.redstone=false
+    B:vanilla.repeater=false
+    B:vanilla.silverfish=false
+    B:vanilla.spawntype=false
+}
+
+

src/config/WailaHarvestability.cfg

@@ -0,0 +1,12 @@
+# Configuration file
+
+main {
+    B:harvest.level.tooltip=false
+    S:is.currently.harvestable.string=✔
+    S:minimal.mode.separator= : 
+    S:not.currently.harvestable.string=✘
+    S:shearability.string=✂
+    S:silk.touchability.string=✒
+}
+
+

src/config/_CLIENT/CustomMainMenu/mainmenu.json

@@ -0,0 +1,142 @@
+{
+    "images":
+    {
+        "title":
+        {
+            "image" : "menu:logo.png",
+            "posX" : -40,
+            "posY" : 20,
+            "width" : 80 ,
+            "height" : 80,
+            "alignment" : "top_center"
+        }
+    },
+
+    "buttons":
+    {
+        "clockwork":
+        {
+            "text" : "Connect to Clockwork",
+            "posX" : -101,
+            "posY" : -20,
+            "width" : 202,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "connectToServer",
+                "ip" : "forge.cwgaming.co.uk"
+            }
+        },
+
+        "singleplayer":
+        {
+            "text" : "menu.singleplayer",
+            "posX" : -101,
+            "posY" : 2,
+            "width" : 100,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "openGui",
+                "gui" : "singleplayer"
+            }
+        },
+
+        "multiplayer":
+        {
+            "text" : "menu.multiplayer",
+            "posX" : 1,
+            "posY" : 2,
+            "width" : 100,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "openGui",
+                "gui" : "multiplayer"
+            }
+        },
+
+        "mods":
+        {
+            "text" : "fml.menu.mods",
+            "posX" : 1,
+            "posY" : 24,
+            "width" : 100,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "openGui",
+                "gui" : "mods"
+            }
+        },
+
+        "options":
+        {
+            "text" : "menu.options",
+            "posX" : -101,
+            "posY" : 24,
+            "width" : 100,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "openGui",
+                "gui" : "options"
+            }
+        },
+
+        "quit":
+        {
+            "text" : "menu.quit",
+            "posX" : -50,
+            "posY" : 63,
+            "width" : 100,
+            "height" : 20,
+            "alignment" : "center",
+            "texture" : "menu:button.png",
+            "shadow" : true,
+            "action" :
+            {
+                "type" : "quit"
+            }
+        }
+    },
+
+    "labels":
+    {
+        "mojang":
+        {
+            "text" : "Copyright Mojang AB. Do not distribute! Unless you wanna. Then w/e",
+            "posX" : -197,
+            "posY" : -10,
+            "color" : -1,
+            "alignment" : "bottom_right"
+        }
+    },
+
+    "other":
+    {
+        "panorama":
+        {
+            "images" : "minecraft:textures/gui/title/background/panorama_%c.png",
+            "animate" : true,
+            "animationSpeed" : 1,
+            "blur" : true,
+            "gradient" : false
+        }
+    }
+}

src/config/_SERVER/Morpheus.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+groundlevel {
+    # Ground Level (1-255) [range: 1 ~ 255, default: 64]
+    I:settings=64
+}
+
+
+settings {
+    B:AlertEnabled=true
+    B:AllowSetSpawnDaytime=true
+    B:IncludeMiners=true
+    S:OnMorningText=Wakey, wakey ya little shits!
+    S:OnSleepText=is now sleeping.
+    S:OnWakeText=has left their bed.
+    I:SleeperPerc=40
+}

src/config/abyssalcraft.cfg

@@ -0,0 +1,264 @@
+# Configuration file
+
+biome_generation {
+    # Set true for the Coralium Infested Swamp to generate.
+    B:"Coralium Infested Swamp"=true
+
+    # Set true for the Darklands biome to generate.
+    B:Darklands=true
+
+    # Set true for the Darklands Forest biome to generate.
+    B:"Darklands Forest"=true
+
+    # Set true for the Darklands Highland biome to generate.
+    B:"Darklands Highland"=true
+
+    # Set true for the Darklands Mountain biome to generate.
+    B:"Darklands Mountain"=true
+
+    # Set true for the Darklands Plains biome to generate.
+    B:"Darklands Plains"=true
+}
+
+
+biome_spawning {
+    # If true, you can spawn in the Coralium Infested Swamp biome.
+    B:"Coralium Infested Swamp"=false
+
+    # If true, you can spawn in the Darklands biome.
+    B:Darklands=false
+
+    # If true, you can spawn in the Darklands Forest biome.
+    B:"Darklands Forest"=false
+
+    # If true, you can spawn in the Darklands Highland biome.
+    B:"Darklands Highland"=false
+
+    # If true, you can spawn in the Darklands Mountain biome.
+    B:"Darklands Mountain"=false
+
+    # If true, you can spawn in the Darklands Plains biome.
+    B:"Darklands Plains"=false
+}
+
+
+biome_weight {
+    # Biome weight for the Coralium Infested Swamp biome, controls the chance of it generating (n out of 100)
+    I:"Coralium Infested Swamp"=1
+
+    # Biome weight for the Darklands biome, controls the chance of it generating (n out of 100)
+    I:Darklands=2
+
+    # Biome weight for the Darklands Forest biome, controls the chance of it generating (n out of 100)
+    I:"Darklands Forest"=1
+
+    # Biome weight for the Darklands Highland biome, controls the chance of it generating (n out of 100)
+    I:"Darklands Highland"=1
+
+    # Biome weight for the Darklands Mountain biome, controls the chance of it generating (n out of 100)
+    I:"Darklands Mountain"=1
+
+    # Biome weight for the Darklands Plains biome, controls the chance of it generating (n out of 100)
+    I:"Darklands Plains"=1
+}
+
+
+dimensions {
+    # The third dimension, also known as §oThe Realm of J'zahar§r.
+    I:Omothol=52
+
+    # Set true to prevent Omothol from automatically unloading (might affect performance)
+    B:"Prevent unloading: Omothol"=false
+
+    # Set true to prevent The Abyssal Wasteland from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Abyssal Wasteland"=false
+
+    # Set true to prevent The Dark Realm from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Dark Realm"=false
+
+    # Set true to prevent The Dreadlands from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Dreadlands"=false
+
+    # The first dimension, full of undead monsters.
+    I:"The Abyssal Wasteland"=50
+
+    # Hidden fourth dimension, reached by falling down from Omothol
+    I:"The Dark Realm"=53
+
+    # The second dimension, infested with mutated monsters.
+    I:"The Dreadlands"=51
+}
+
+
+general {
+    # Toggles whether blocks that emits particles should do so.
+    B:"Block particles"=true
+
+    # Set true to allow the Coralium Plague to spread outside The Abyssal Wasteland.
+    B:"Coralium Plague spreading"=false
+
+    # Set to false to disable the random blindness within Darklands biomes
+    B:Darkness=true
+
+    # Set to false to prevent Demon Animals (Pigs, Cows, Chickens) from burning in the overworld.
+    B:"Demon Animal burning"=true
+
+    # Spawn weight for the Demon Animals (Pigs, Cows, Chickens) spawning in the Nether.
+    I:"Demon Animal spawn weight"=30
+
+    # Spawn weight for Abyssal Zombies in The End. Setting to 0 will stop them from spawning altogether.
+    I:"End Abyssal Zombie spawn weight"=10
+
+    # Toggles whether entities that emits particles should do so.
+    B:"Entity particles"=true
+
+    # Spawn weight for the Evil Animals (Pigs, Cows, Chickens), keep under 35 to avoid complete annihilation.
+    I:"Evil Animal spawn weight"=20
+
+    # If enabled, sets the creature type of Evil Animals to "monster". The creature type affects how a entity spawns, eg "creature" treats the entity as an animal, while "monster" treats it as a hostile mob. If you enable this, Evil Animals will spawn like any other hostile mobs, instead of mimicking vanilla animals.
+    # §c[Minecraft Restart Required]§r
+    B:"Evil Animals Are Monsters"=false
+
+    # Toggles Hardcore mode. If set to true, all mobs will become tougher.
+    B:"Hardcore Mode"=false
+
+    # Toggles whether or not Liquid Antimatter will disintegrate any items dropped into a pool of it.
+    B:"Liquid Antimatter item disintegration"=true
+
+    # Set true to allow the Liquid Coralium to break the laws of physics in terms of movement
+    B:"Liquid Coralium Physics"=false
+
+    # Set true for the Liquid Coralium to convert other liquids into itself in the overworld.
+    B:"Liquid Coralium transmutation"=true
+
+    # Set true to allow the Liquid Coralium to spread across oceans. WARNING: The game can crash from this.
+    B:"Oceanic Coralium Pollution"=false
+
+    # Cooldown after using a portal, increasing the value increases the delay until you can teleport again. Measured in ticks (20 ticks = 1 second).
+    I:"Portal cooldown"=10
+}
+
+
+item_blacklist {
+    # Items/Blocks added to this list won't be picked up by Abyssal Anti-Zombies. Format: modid:name:meta, where meta is optional.
+    S:"Abyssal Anti-Zombie Item Blacklist" <
+     >
+
+    # Items/Blocks added to this list won't be picked up by Abyssal Zombies. Format: modid:name:meta, where meta is optional.
+    S:"Abyssal Zombie Item Blacklist" <
+     >
+
+    # Items/Blocks added to this list won't be picked up by Anti-Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Anti-Ghoul Item Blacklist" <
+     >
+
+    # Items/Blocks added to this list won't be picked up by Depths Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Depths Ghoul Item Blacklist" <
+     >
+
+    # Items/Blocks added to this list won't be picked up by Omothol Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Omothol Ghoul Item Blacklist" <
+     >
+}
+
+
+shoggoth {
+    # Toggles ooze spreading on blocks with the Clay material (Clay blocks).
+    B:"Ooze Spread: Clay"=true
+
+    # Toggles ooze spreading on blocks with the Cloth material (Wool blocks).
+    B:"Ooze Spread: Cloth"=true
+
+    # Toggles ooze spreading on blocks with the Gourd material (Pumpkin, Melon).
+    B:"Ooze Spread: Gourd"=true
+
+    # Toggles ooze spreading on blocks with the Grass material (Grass blocks).
+    B:"Ooze Spread: Grass"=true
+
+    # Toggles ooze spreading on blocks with the Ground material (Dirt, Podzol).
+    B:"Ooze Spread: Ground"=true
+
+    # Toggles ooze spreading on blocks with the Iron material (Iron blocks, Gold blocks, Diamond blocks).
+    B:"Ooze Spread: Iron"=true
+
+    # Toggles ooze spreading on blocks with the Leaves material (Leaf blocks).
+    B:"Ooze Spread: Leaves"=true
+
+    # Toggles ooze spreading on blocks with the Rock material (Stone, Cobblestone, Stone Bricks, Ores).
+    B:"Ooze Spread: Rock"=true
+
+    # Toggles ooze spreading on blocks with the Sand material (Sand, Gravel, Soul Sand).
+    B:"Ooze Spread: Sand"=true
+
+    # Toggles ooze spreading on blocks with the Wood material (Logs, Planks).
+    B:"Ooze Spread: Wood"=true
+
+    # Toggles whether or not Lesser Shoggoths should spread their ooze when walking around. (Overrides all the Ooze Spread options)
+    B:"Shoggoth Ooze Spread"=true
+}
+
+
+worldgen {
+    # Toggles whether or not to generate Copper Ore in the Abyssal Wasteland.
+    B:"Abyssal Copper Ore"=true
+
+    # Toggles whether or not to generate Coralium Ore in the Abyssal Wasteland.
+    B:"Abyssal Coralium Ore"=true
+
+    # Toggles whether or not to generate Diamond Ore in the Abyssal Wasteland
+    B:"Abyssal Diamond Ore"=true
+
+    # Toggles whether or not to generate Gold Ore in the Abyssal Wasteland.
+    B:"Abyssal Gold Ore"=true
+
+    # Toggles whether or not to generate Iron Ore in the Abyssal Wasteland.
+    B:"Abyssal Iron Ore"=true
+
+    # Toggles whether or not to generate Nitre Ore in the Abyssal Wasteland.
+    B:"Abyssal Nitre Ore"=true
+
+    # Toggles whether or not to generate Tin Ore in the Abyssal Wasteland
+    B:"Abyssal Tin Ore"=true
+
+    # Toggles whether or not to generate Tall Obsidian Pillars in the Abyssal Wasteland.
+    B:"Abyssal Wasteland Pillars"=true
+
+    # Toggles whether or not to generate small ruins in the Abyssal Wasteland.
+    B:"Abyssal Wasteland Ruins"=true
+
+    # Toggles wheter or not to generate Abyssalnite Ore in Darklands Biomes.
+    B:"Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Coralium Ore in the Overworld.
+    B:"Coralium Ore"=true
+
+    # Toggles whether or not to generate random Darklands structures.
+    B:"Darklands Structures"=true
+
+    # Toggles whether or not to generate Dreaded Abyssalnite Ore in the Dreadlands.
+    B:"Dreaded Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Abyssalnite Ore in the Dreadlands.
+    B:"Dreadlands Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Stalagmites in Dreadlands and Purified Dreadlands biomes.
+    B:"Dreadlands Stalagmites"=true
+
+    # Toggles whether or not to generate Liquid Antimatter Lakes in Coralium Infested Swamps.
+    B:"Liquid Antimatter Lakes"=true
+
+    # Toggles whether or not to generate Liquid Coralium Lakes in the Abyssal Wasteland.
+    B:"Liquid Coralium Lakes"=false
+
+    # Toggles whether or not to generate Liquified Coralium Ore in the Abyssal Wasteland.
+    B:"Liquified Coralium Ore"=true
+
+    # Toggles whether or not to generate Nitre Ore in the Overworld.
+    B:"Nitre Ore"=true
+
+    # Toggles whether or not to generate Pearlescent Coralium Ore in the Abyssal Wasteland.
+    B:"Pearlescent Coralium Ore"=true
+
+    # Toggles whether or not to generate Shoggoth Lairs (however, they will still generate in Omothol).
+    B:"Shoggoth Lairs"=true
+}

src/config/actuallyadditions.cfg

@@ -0,0 +1,629 @@
+# Configuration file
+
+"block crafting" {
+    # If the Recipe for the Advanced Item Laser Relay is Enabled
+    B:"Advanced Item Laser Relay"=true
+
+    # If the Recipe for the Atomic Reconstructor is Enabled
+    B:"Atomic Reconstructor"=true
+
+    # If the Recipe for the Bio Reactor is Enabled
+    B:"Bio Reactor"=true
+
+    # If the Recipe for the Breaker is Enabled
+    B:Breaker=true
+
+    # If the Recipe for the Canola Press is Enabled
+    B:"Canola Press"=true
+
+    # If the Recipe for the Casing is Enabled
+    B:Casing=true
+
+    # If the Recipe for the Charcoal Block is Enabled
+    B:"Charcoal Block"=true
+
+    # If the Recipe for the Coal Generator is Enabled
+    B:"Coal Generator"=true
+
+    # If the Recipe for the Coffee Machine is Enabled
+    B:"Coffee Machine"=true
+
+    # If the Recipe for the Compost is Enabled
+    B:Compost=true
+
+    # If the Recipe for the Crusher is Enabled
+    B:Crusher=true
+
+    # If the Recipe for the Display Stand is Enabled
+    B:"Display Stand"=true
+
+    # If the Recipe for the Double Crusher is Enabled
+    B:"Double Crusher"=true
+
+    # If the Recipe for the Double Furnace is Enabled
+    B:"Double Furnace"=true
+
+    # If the Recipe for the Dropper is Enabled
+    B:Dropper=true
+
+    # If the Recipe for the ESD is Enabled
+    B:ESD=true
+
+    # If the Recipe for the Empowerer is Enabled
+    B:Empowerer=true
+
+    # If the Recipe for the Ender Casing is Enabled
+    B:"Ender Casing"=true
+
+    # If the Recipe for the Energizer is Enabled
+    B:Energizer=true
+
+    # If the Recipe for the Enervator is Enabled
+    B:Enervator=true
+
+    # If the Recipe for the Experience Solidifier is Enabled
+    B:"Experience Solidifier"=true
+
+    # If the Recipe for the Feeder is Enabled
+    B:Feeder=true
+
+    # If the Recipe for the Fermenting Barrel is Enabled
+    B:"Fermenting Barrel"=true
+
+    # If the Recipe for the Firework Box is Enabled
+    B:"Firework Box"=true
+
+    # If the Recipe for the Fishing Net is Enabled
+    B:"Fishing Net"=true
+
+    # If the Recipe for the Fluid Laser Relay is Enabled
+    B:"Fluid Laser Relay"=true
+
+    # If the Recipe for the Greenhouse Glass is Enabled
+    B:"Greenhouse Glass"=true
+
+    # If the Recipe for the Heat Collector is Enabled
+    B:"Heat Collector"=true
+
+    # If the Recipe for the Iron Casing is Enabled
+    B:"Iron Casing"=true
+
+    # If the Recipe for the Item Distributor is Enabled
+    B:"Item Distributor"=true
+
+    # If the Recipe for the Item Interface is Enabled
+    B:"Item Interface"=true
+
+    # If the Recipe for the Item Laser Relay is Enabled
+    B:"Item Laser Relay"=true
+
+    # If the Recipe for the Lamps is Enabled
+    B:Lamps=true
+
+    # If the Recipe for the Laser Relay is Enabled
+    B:"Laser Relay"=true
+
+    # If the Recipe for the Lava Factory is Enabled
+    B:"Lava Factory"=true
+
+    # If the Recipe for the Leaf Generator is Enabled
+    B:"Leaf Generator"=true
+
+    # If the Recipe for the Liquid Collector is Enabled
+    B:"Liquid Collector"=true
+
+    # If the Recipe for the Liquid Placer is Enabled
+    B:"Liquid Placer"=true
+
+    # If the Recipe for the Long-Range Breaker is Enabled
+    B:"Long-Range Breaker"=true
+
+    # If the Recipe for the Miner is Enabled
+    B:Miner=true
+
+    # If the Recipe for the Oil Generator is Enabled
+    B:"Oil Generator"=true
+
+    # If the Recipe for the Phantom Booster is Enabled
+    B:"Phantom Booster"=true
+
+    # If the Recipe for the Phantom Breaker is Enabled
+    B:"Phantom Breaker"=true
+
+    # If the Recipe for the Phantom Energyface is Enabled
+    B:"Phantom Energyface"=true
+
+    # If the Recipe for the Phantom Liquiface is Enabled
+    B:"Phantom Liquiface"=true
+
+    # If the Recipe for the Phantom Placer is Enabled
+    B:"Phantom Placer"=true
+
+    # If the Recipe for the Phantom Redstoneface is Enabled
+    B:"Phantom Redstoneface"=true
+
+    # If the Recipe for the Phantomface is Enabled
+    B:Phantomface=true
+
+    # If the Recipe for the Placer is Enabled
+    B:Placer=true
+
+    # If the Recipe for the Player Interface is Enabled
+    B:"Player Interface"=true
+
+    # If the Recipe for the Ranged Collector is Enabled
+    B:"Ranged Collector"=true
+
+    # If the Recipe for the Repairer is Enabled
+    B:Repairer=true
+
+    # If the Recipe for the Shock Absorber is Enabled
+    B:"Shock Absorber"=true
+
+    # If the Recipe for the Smiley Cloud is Enabled
+    B:"Smiley Cloud"=true
+
+    # If the Recipe for the Solar Panel is Enabled
+    B:"Solar Panel"=true
+
+    # If the Recipe for the Speed Upgrade is Enabled
+    B:"Speed Upgrade"=true
+
+    # If the Recipe for the Storage Crate is Enabled
+    B:"Storage Crate"=true
+
+    # If the Recipe for the Wood Casing is Enabled
+    B:"Wood Casing"=true
+}
+
+
+"food crafting" {
+    # If the Recipe for the Bacon is Enabled
+    B:Bacon=true
+
+    # If the Recipe for the Baguette is Enabled
+    B:Baguette=true
+
+    # If the Recipe for the Big Cookie is Enabled
+    B:"Big Cookie"=true
+
+    # If the Recipe for the Carrot Juice is Enabled
+    B:"Carrot Juice"=true
+
+    # If the Recipe for the Cheese is Enabled
+    B:Cheese=true
+
+    # If the Recipe for the Chocolate is Enabled
+    B:Chocolate=true
+
+    # If the Recipe for the Chocolate Cake is Enabled
+    B:"Chocolate Cake"=true
+
+    # If the Recipe for the Chocolate Toast is Enabled
+    B:"Chocolate Toast"=true
+
+    # If the Recipe for the Fish And Chips is Enabled
+    B:"Fish And Chips"=true
+
+    # If the Recipe for the French Fries is Enabled
+    B:"French Fries"=true
+
+    # If the Recipe for the French Fry is Enabled
+    B:"French Fry"=true
+
+    # If the Recipe for the Hamburger is Enabled
+    B:Hamburger=true
+
+    # If the Recipe for the Noodle is Enabled
+    B:Noodle=true
+
+    # If the Recipe for the Pizza is Enabled
+    B:Pizza=true
+
+    # If the Recipe for the Pumpkin Stew is Enabled
+    B:"Pumpkin Stew"=true
+
+    # If the Recipe for the Rice Bread is Enabled
+    B:"Rice Bread"=true
+
+    # If the Recipe for the Rice Dough is Enabled
+    B:"Rice Dough"=true
+
+    # If the Recipe for the Spaghetti is Enabled
+    B:Spaghetti=true
+
+    # If the Recipe for the Sub Sandwich is Enabled
+    B:"Sub Sandwich"=true
+
+    # If the Recipe for the Toast is Enabled
+    B:Toast=true
+}
+
+
+"item crafting" {
+    # If the Recipe for the Advanced Coil is Enabled
+    B:"Advanced Coil"=true
+
+    # If the Recipe for the Advanced Leaf Blower is Enabled
+    B:"Advanced Leaf Blower"=true
+
+    # If the Recipe for the Bag is Enabled
+    B:Bag=true
+
+    # If the Recipe for the Battery is Enabled
+    B:Battery=true
+
+    # If the Recipe for the Black Quartz in a Crafting Table is Enabled
+    B:"Black Quartz in a Crafting Table"=true
+
+    # If the Recipe for the Chest To Crate Upgrade is Enabled
+    B:"Chest To Crate Upgrade"=true
+
+    # If the Recipe for the Coil is Enabled
+    B:Coil=true
+
+    # If the Recipe for the Crafting Table On A Stick is Enabled
+    B:"Crafting Table On A Stick"=true
+
+    # If the Recipe for the Crate Keeper is Enabled
+    B:"Crate Keeper"=true
+
+    # If the Recipe for the Crystal Tools is Enabled
+    B:"Crystal Tools"=true
+
+    # If the Recipe for the Cup is Enabled
+    B:Cup=true
+
+    # If the Recipe for the Disenchanting Lens is Enabled
+    B:"Disenchanting Lens"=true
+
+    # If the Recipe for the Double Battery is Enabled
+    B:"Double Battery"=true
+
+    # If the Recipe for the Dough is Enabled
+    B:Dough=true
+
+    # If the Recipe for the Drill is Enabled
+    B:Drill=true
+
+    # If the Recipe for the Drill Core is Enabled
+    B:"Drill Core"=true
+
+    # If the Recipe for the Drill Fortune Upgrades is Enabled
+    B:"Drill Fortune Upgrades"=true
+
+    # If the Recipe for the Drill Placing Upgrade is Enabled
+    B:"Drill Placing Upgrade"=true
+
+    # If the Recipe for the Drill Silk Touch Upgrade is Enabled
+    B:"Drill Silk Touch Upgrade"=true
+
+    # If the Recipe for the Drill Size Upgrades is Enabled
+    B:"Drill Size Upgrades"=true
+
+    # If the Recipe for the Drill Speed Upgrades is Enabled
+    B:"Drill Speed Upgrades"=true
+
+    # If the Recipe for the Emerald Tools is Enabled
+    B:"Emerald Tools"=true
+
+    # If the Recipe for the Ender Star is Enabled
+    B:"Ender Star"=true
+
+    # If the Recipe for the Growth Ring is Enabled
+    B:"Growth Ring"=true
+
+    # If the Recipe for the Item Filter is Enabled
+    B:"Item Filter"=true
+
+    # If the Recipe for the Knife is Enabled
+    B:Knife=true
+
+    # If the Recipe for the Knife Blade is Enabled
+    B:"Knife Blade"=true
+
+    # If the Recipe for the Knife Handle is Enabled
+    B:"Knife Handle"=true
+
+    # If the Recipe for the Laser Wrench is Enabled
+    B:"Laser Wrench"=true
+
+    # If the Recipe for the Leaf Blower is Enabled
+    B:"Leaf Blower"=true
+
+    # If the Recipe for the Magnet Ring is Enabled
+    B:"Magnet Ring"=true
+
+    # If the Recipe for the Mashed Food is Enabled
+    B:"Mashed Food"=true
+
+    # The ItemFood, IGrowable and IPlantable Items that can not be used to craft Mashed Food. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Mashed Food Crafting Exceptions" <
+        ActuallyAdditions:itemCoffee
+     >
+
+    # If the Recipe for the Obsidian Tools is Enabled
+    B:"Obsidian Tools"=true
+
+    # If the Recipe for the Paper Cone is Enabled
+    B:"Paper Cone"=true
+
+    # If the Recipe for the Paxels is Enabled
+    B:Paxels=true
+
+    # If the Recipe for the Phantom Connector is Enabled
+    B:"Phantom Connector"=true
+
+    # If the Recipe for the Player Probe is Enabled
+    B:"Player Probe"=true
+
+    # If the Recipe for the Quadruple Battery is Enabled
+    B:"Quadruple Battery"=true
+
+    # If the Recipe for the Quartz Tools is Enabled
+    B:"Quartz Tools"=true
+
+    # If the Recipe for the Quintuple Battery is Enabled
+    B:"Quintuple Battery"=true
+
+    # If the Recipe for the Rarmor Reconstructor Module is Enabled
+    B:"Rarmor Reconstructor Module"=true
+
+    # If the Recipe for the Resonant Rice is Enabled
+    B:"Resonant Rice"=true
+
+    # If the Recipe for the Rice Gadgets is Enabled
+    B:"Rice Gadgets"=true
+
+    # If the Recipe for the Spawner Changer is Enabled
+    B:"Spawner Changer"=true
+
+    # If the Recipe for the Tele Staff is Enabled
+    B:"Tele Staff"=true
+
+    # If the Recipe for the Tiny Coal is Enabled
+    B:"Tiny Coal"=true
+
+    # If the Recipe for the Triple Battery is Enabled
+    B:"Triple Battery"=true
+
+    # If the Recipe for the Void Bag is Enabled
+    B:"Void Bag"=true
+
+    # If the Recipe for the Water Ring is Enabled
+    B:"Water Ring"=true
+
+    # If the Recipe for the Wings Of The Bats is Enabled
+    B:"Wings Of The Bats"=true
+}
+
+
+"machine values" {
+    # By default, the Item Repairer only repairs items which are repairable in an anvil. Add an item's REGISTRY NAME here if you want it to be repairable.
+    S:"Item Repairer Extra Whitelist" <
+        tconstruct:pickaxe
+        tconstruct:shovel
+        tconstruct:hatchet
+        tconstruct:mattock
+        tconstruct:broadsword
+        tconstruct:longsword
+        tconstruct:frypan
+        tconstruct:battlesign
+        tconstruct:hammer
+        tconstruct:excavator
+        tconstruct:lumberaxe
+        tconstruct:cleaver
+        tconstruct:rapier
+     >
+
+    # If Energy Laser Relays should have energy loss
+    B:"Laser Relay Energy Loss"=true
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can mine, but shouldn't be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option will apply in both modes.
+    S:"Vertical Digger Blacklist" <
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option only applies if the miner is in Ores Only Mode.
+    S:"Vertical Digger Extra Whitelist" <
+     >
+}
+
+
+"mob drops" {
+    # If Wings should sometimes drop from Bats
+    B:"Bat Wing Drop"=true
+
+    # If Mobs should randomly drop solidified XP occasionally
+    B:"Solidified XP Drop"=true
+
+    # If Cobwebs should sometimes drop from Spiders
+    B:"Spider Cobweb Drop"=true
+}
+
+
+other {
+    # Show Advanced Item Info when holding Control on every Item
+    B:"Advanced Info"=false
+
+    # The maximum amount of characters that is displayed by the NBT view of the CTRL Advanced Info. Set to a zero to have no limit
+    I:"Advanced Info NBT Character Limit"=1000
+
+    # Show the 'Press Control for more Info'-Text on Item Tooltips
+    B:"Advanced Info Tooltips"=true
+
+    # Should the entire text of the booklet be put into a new file in the Minecraft Folder on startup or resource reload. This is for debug purposes only and shouldn't really ever be needed.
+    B:"Booklet Text to File"=false
+
+    # The Ingots, Dusts and Ores blacklisted from being auto-registered to be crushed by the Crusher. This list uses OreDictionary Names of the Inputs only.
+    S:"Crusher Recipe Exceptions" <
+        ingotBrick
+        ingotBrickNether
+     >
+
+    # If Cats drop Hairy Balls on Occasion
+    B:"Do Cat Drops"=true
+
+    # If Actually Additions should check for an Update on joining a World
+    B:"Do Update Check"=true
+
+    # Should Actually Additions Loot spawn in Dungeons
+    B:"Dungeon Loot"=true
+
+    # If the booklet should be given to the player when he first crafts something from the Mod
+    B:"Give Booklet on First Craft"=true
+
+    # If the Recipe for the Horse Armor -> Raw Materials (Crusher) is Enabled
+    B:"Horse Armor -> Raw Materials (Crusher)"=true
+
+    # If the Recipe for the Lens of Detonation (Reconstructor) is Enabled
+    B:"Lens of Detonation (Reconstructor)"=true
+
+    # If the Recipe for the Misc. Recipes like Soul Sand (Reconstructor) is Enabled
+    B:"Misc. Recipes like Soul Sand (Reconstructor)"=true
+
+    # By default, the Spawner Changer allows every living entity to be put into a spawner. If there is one that shouldn't be able to, put its MAPPING NAME here.
+    S:"Spawner Changer Blacklist" <
+        VillagerGolem
+     >
+
+    # Turn this on to make recipes for items from the mod really hard. (This is a joke feature making fun of the whole FTB Infinity Expert Mode style of playing. You shouldn't really turn this on as it makes the mod completely unplayable.)
+    B:"Super Duper Hard Recipes"=false
+
+    # The amount of ticks waited before a TileEntity sends an additional Update to the Client
+    I:"Tile Entities: Update Interval"=5
+
+    # If Actually Additions' Update Check should only search for updates for the Minecraft Version you currently have
+    B:"Version Specific Update Checker"=true
+
+    # If right-clicking a bowl on water should create a water bowl
+    B:"Water Bowl"=true
+
+    # The amount of ticks it takes for a worm to die. Set it to zero to make worms not die at all.
+    I:"Worm Death Time"=0
+
+    # If worms should drop from tilling the ground
+    B:Worms=true
+}
+
+
+performance {
+    # If there should not be a sound effect and particles when a block is being destroyed by a breaker or similar
+    B:"Less Block Breaking Effects"=false
+
+    # If blocks in Actually Additions should have less particles
+    B:"Less Particles"=false
+
+    # If blocks in Actually Additions should have less sounds
+    B:"Less Sound"=false
+}
+
+
+"ring crafting" {
+    # If the Recipe for the Fire Resistance Ring is Enabled
+    B:"Fire Resistance Ring"=true
+
+    # If the Recipe for the Haste Ring is Enabled
+    B:"Haste Ring"=true
+
+    # If the Recipe for the Invisibility Ring is Enabled
+    B:"Invisibility Ring"=true
+
+    # If the Recipe for the Jump Boost Ring is Enabled
+    B:"Jump Boost Ring"=true
+
+    # If the Recipe for the Night Vision Ring is Enabled
+    B:"Night Vision Ring"=true
+
+    # If the Recipe for the Regen Ring is Enabled
+    B:"Regen Ring"=true
+
+    # If the Recipe for the Resistance Ring is Enabled
+    B:"Resistance Ring"=true
+
+    # If the Recipe for the Speed Ring is Enabled
+    B:"Speed Ring"=true
+
+    # If the Recipe for the Strength Ring is Enabled
+    B:"Strength Ring"=true
+
+    # If the Recipe for the Water Breathing Ring is Enabled
+    B:"Water Breathing Ring"=true
+}
+
+
+"tool values" {
+    # By default, the AIOT can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"AIOT Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+
+    # If the 'Press key for more information'-text should show when the item has a page in the booklet
+    B:"Booklet Quick Opening Info"=true
+
+    # By default, the Drill can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Drill Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+}
+
+
+"world gen" {
+    # If the Black Lotus should generate in the World
+    B:"Black Lotus Gen"=true
+
+    # The Amount of Black Lotus generating
+    I:"Black Lotus: Amount"=14
+
+    # If the Black Quartz generates in the world
+    B:"Black Quartz"=true
+
+    # If Canola should generate in the World
+    B:"Canola Gen"=true
+
+    # The Amount of Canola generating
+    I:"Canola: Amount"=10
+
+    # If Coffee should generate in the World
+    B:"Coffee Gen"=true
+
+    # The Amount of Coffee generating
+    I:"Coffee: Amount"=6
+
+    # If the Custom Crop Fields exist
+    B:"Crop Field: Existence"=true
+
+    # If Flax should generate in the World
+    B:"Flax Gen"=true
+
+    # The Amount of Flax generating
+    I:"Flax: Amount"=8
+
+    # Should caves with trees and grass randomly generate underground
+    B:"Generate Lush Caves"=true
+
+    # If the Jam Villager and his House exist
+    B:"Jam Villager: Existence"=true
+
+    # The ID of the Jam Villager
+    I:"Jam Villager: ID"=493827
+
+    # The chance for lush caves to generate. The lower the number, the likelier.
+    I:"Lush Caves: Chance"=20
+
+    # The IDs of the dimensions that Actually Additions OreGen (Black Quartz for example) is banned in. This also applies for other world gen like lush caves.
+    I:"OreGen Dimension Blacklist" <
+     >
+
+    # The IDs of the dimensions that Actually Additions Plants (Rice for example) are banned in
+    I:"Plant Blacklist" <
+     >
+
+    # If Rice should generate in the World
+    B:"Rice Gen"=true
+
+    # The Amount of Rice generating
+    I:"Rice: Amount"=15
+
+    # If Treasure Chests should generate in the World
+    B:"Treasure Chest Gen"=true
+}

src/config/appleskin.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are client-side only
+##########################################################################################################
+
+client {
+    # If true, shows your food exhaustion as a progress bar behind the hunger bars
+    B:show.food.exhaustion.hud.underlay=true
+
+    # If true, adds a line that shows your hunger, saturation, and exhaustion level in the F3 debug overlay
+    B:show.food.stats.in.debug.overlay=true
+
+    # If true, shows the hunger (and saturation if show.saturation.hud.overlay is true) that would be restored by food you are currently holding
+    B:show.food.values.hud.overlay=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip while holding SHIFT
+    B:show.food.values.in.tooltip=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip automatically (without needing to hold SHIFT)
+    B:show.food.values.in.tooltip.always=true
+
+    # If true, shows your current saturation level overlayed on the hunger bar
+    B:show.saturation.hud.overlay=true
+}
+
+

src/config/autopackager.cfg

@@ -0,0 +1,9 @@
+# Configuration file
+
+general {
+    I:RF_per_cycle=1000
+    I:cycle_delay_ticks=10
+    I:idle_delay_ticks=200
+}
+
+

src/config/biomesoplenty/biome_ids.json

@@ -0,0 +1,65 @@
+{
+  "oasis": 108,
+  "woodland": 104,
+  "shrubland": 95,
+  "xeric_shrubland": 105,
+  "tropical_rainforest": 100,
+  "fen": 68,
+  "steppe": 98,
+  "bayou": 56,
+  "overgrown_cliffs": 87,
+  "highland": 73,
+  "volcanic_island": 114,
+  "quagmire": 89,
+  "marsh": 79,
+  "chaparral": 60,
+  "flower_island": 115,
+  "flower_field": 69,
+  "wetland": 103,
+  "mystic_grove": 83,
+  "cold_desert": 62,
+  "mountain_foothills": 106,
+  "maple_woods": 78,
+  "coral_reef": 109,
+  "orchard": 85,
+  "moor": 81,
+  "land_of_lakes": 74,
+  "bog": 57,
+  "coniferous_forest": 63,
+  "eucalyptus_forest": 67,
+  "outback": 86,
+  "shield": 94,
+  "alps": 54,
+  "wasteland": 102,
+  "lush_desert": 76,
+  "mangrove": 111,
+  "boreal_forest": 58,
+  "redwood_forest": 91,
+  "cherry_blossom_grove": 61,
+  "snowy_forest": 97,
+  "seasonal_forest": 93,
+  "temperate_rainforest": 99,
+  "dead_forest": 65,
+  "bamboo_forest": 55,
+  "dead_swamp": 66,
+  "kelp_forest": 110,
+  "heathland": 72,
+  "glacier": 107,
+  "meadow": 80,
+  "lush_swamp": 77,
+  "mountain_peaks": 82,
+  "tropical_island": 113,
+  "grassland": 70,
+  "prairie": 88,
+  "snowy_coniferous_forest": 96,
+  "tundra": 101,
+  "origin_island": 112,
+  "gravel_beach": 53,
+  "grove": 71,
+  "lavender_fields": 75,
+  "rainforest": 90,
+  "sacred_springs": 92,
+  "crag": 64,
+  "brushland": 59,
+  "ominous_woods": 84
+}

src/config/biomesoplenty/gameplay.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+"convenience settings" {
+    # Require shears to be used to collect flower drops. [default: false]
+    B:"Flower Drops Need Shears"=false
+}
+
+

src/config/biomesoplenty/misc.cfg

@@ -0,0 +1,15 @@
+# Configuration file
+
+"gui settings" {
+    # Use the Biomes O' Plenty World Type by default when selecting a world. [default: false]
+    B:"Default to BoP World Type"=true
+}
+
+
+"texture settings" {
+    # Override the Forge bucket texture and use ours instead (It's nicer!) [default: true]
+    B:"Enable Biomes O' Plenty Bucket Textures"=false
+
+    # Override the main menu panorama and use ours instead (It's nicer!) [default: true]
+    B:"Enable Biomes O' Plenty Main Menu Panorama"=false
+}

src/config/bookshelf.cfg

@@ -0,0 +1,50 @@
+# Configuration file
+
+attributefix {
+    # The highest possible attack speed [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:AttackSpeed=4096.0
+
+    # The highest possible attack damage [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:Damage=4096.0
+
+    # Should the max armor amount cap be raised? [default: true]
+    B:Enabled=true
+
+    # The highest possible follow range. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:FollowRange=4096.0
+
+    # The highest possible knockback resistance [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:Knockback=4096.0
+
+    # The highest possible amount of luck. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:Luck=4096.0
+
+    # The highest possible amount of armor points. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:MaxArmor=4096.0
+
+    # The highest possible amount of armor toughness. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:MaxArmorToughness=4096.0
+
+    # The highest possible amount of health. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:MaxHealth=4096.0
+
+    # The highest possible movement speed. [range: 0.0 ~ 3.4028235E38, default: 4096.0]
+    S:Speed=4096.0
+}
+
+
+bookshelves {
+    # Should the new varients be craftable? [default: true]
+    B:Crafting=true
+
+    # While enabled, new bookshelf varients for the other wood types will be added to the game [default: true]
+    B:Enabled=true
+}
+
+
+"player heads" {
+    # While enabled, variations of the vanilla mob heads will be added in the form of a new creative tab. [default: true]
+    B:Enabled=true
+}
+
+

src/config/bullseye/config.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+"arrow settings" {
+    # Allow Bomb Arrows to destroy blocks. [default: true]
+    B:"Bombs Arrows Destroy Blocks"=true
+
+    # Allow Fire Arrows to catch fire to blocks. [default: true]
+    B:"Fire Arrows Burn Blocks"=true
+
+    # Allow Lightning Arrows to catch fire to blocks. [default: true]
+    B:"Lightning Arrows Burn Blocks"=true
+}
+
+

src/config/calculator/AtomicMultiplier-BlackList.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+"atomic multiplier blacklist" {
+    S:disabled <
+        minecraft:nether_star
+        Calculator:AtomicMultiplier
+        Calculator:EndBlock
+        Calculator:ElectricBlock
+        Calculator:FlawlessFireBlock
+        Calculator:FlawlessBlock
+        Calculator:ElectricDiamond
+        Calculator:FlawlessFireDiamond
+        Calculator:FlawlessDiamond
+     >
+}
+
+

src/config/calculator/Blocks-BlackList.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+"block config" {
+    S:Disabled <
+        ExampleBlock
+        ExampleBlock2
+     >
+}
+
+

src/config/calculator/Calculator-Config.cfg

@@ -0,0 +1,150 @@
+# Configuration file
+
+api {
+    # Waila [default: true]
+    B:"enable Waila integration"=true
+}
+
+
+"base speed" {
+    # Algorithm Seperator [range: 20 ~ 10000, default: 200]
+    I:"Algorithm Seperator"=200
+
+    # Extraction Chamber [range: 20 ~ 10000, default: 1000]
+    I:"Extraction Chamber"=1000
+
+    # Precision Chamber [range: 20 ~ 10000, default: 500]
+    I:"Precision Chamber"=500
+
+    # Processing Chamber [range: 20 ~ 10000, default: 500]
+    I:"Processing Chamber"=500
+
+    # Reassembly Chamber [range: 20 ~ 10000, default: 1000]
+    I:"Reassembly Chamber"=1000
+
+    # Reinforced Furnace [range: 20 ~ 10000, default: 200]
+    I:"Reinforced Furnace"=200
+
+    # Restoration Chamber [range: 20 ~ 10000, default: 1000]
+    I:"Restoration Chamber"=1000
+
+    # Stone Seperator [range: 20 ~ 10000, default: 200]
+    I:"Stone Seperator"=200
+}
+
+
+"energy storage" {
+    # Advanced Terrain Module [range: 10 ~ 50000, default: 2000]
+    I:"Advanced Terrain Module"=2000
+
+    # Calculator [range: 10 ~ 50000, default: 1000]
+    I:Calculator=1000
+
+    # Crafting Calculator [range: 10 ~ 50000, default: 5000]
+    I:"Crafting Calculator"=5000
+
+    # Energy Module [range: 1000 ~ 500000, default: 100000]
+    I:"Energy Module"=100000
+
+    # Scientific Calculator [range: 10 ~ 50000, default: 2000]
+    I:"Scientific Calculator"=2000
+
+    # Standard Machine [range: 1000 ~ 1000000, default: 50000]
+    I:"Standard Machine"=50000
+
+    # Terrain Module [range: 10 ~ 50000, default: 400]
+    I:"Terrain Module"=400
+}
+
+
+"energy usage" {
+    # Algorithm Seperator [range: 1 ~ 50000, default: 5000]
+    I:"Algorithm Seperator"=5000
+
+    # Extraction Chamber [range: 1 ~ 50000, default: 5000]
+    I:"Extraction Chamber"=5000
+
+    # Precision Chamber [range: 1 ~ 50000, default: 5000]
+    I:"Precision Chamber"=5000
+
+    # Processing Chamber [range: 1 ~ 50000, default: 1000]
+    I:"Processing Chamber"=1000
+
+    # Reassembly Chamber [range: 1 ~ 50000, default: 1000]
+    I:"Reassembly Chamber"=1000
+
+    # Reinforced Furnace [range: 1 ~ 50000, default: 500]
+    I:"Reinforced Furnace"=500
+
+    # Restoration Chamber [range: 1 ~ 50000, default: 1000]
+    I:"Restoration Chamber"=1000
+
+    # Stone Seperator [range: 1 ~ 50000, default: 500]
+    I:"Stone Seperator"=500
+
+    # Weather Controller [range: 1 ~ 1000000, default: 250000]
+    I:"Weather Controller"=250000
+}
+
+
+generation {
+    # Calculator Locator Multiplier [range: 0.1 ~ 64.0, default: 2.0]
+    S:"Calculator Locator Multiplier"=2.0
+
+    # Conductor Mast [range: 200 ~ 5000000, default: 5000]
+    I:"Conductor Mast"=5000
+
+    # Glowstone Extractor [range: 16 ~ 256, default: 160]
+    I:"Glowstone Extractor"=160
+
+    # Redstone Extractor [range: 4 ~ 192, default: 80]
+    I:"Redstone Extractor"=80
+
+    # Starch Extractor [range: 1 ~ 128, default: 40]
+    I:"Starch Extractor"=40
+
+    # Weather Station [range: 200 ~ 5000000, default: 1000]
+    I:"Weather Station"=1000
+}
+
+
+greenhouses {
+    # Adding Farmland [range: 1 ~ 50000, default: 50]
+    I:"Adding Farmland"=50
+
+    # Adding Water [range: 1 ~ 50000, default: 1000]
+    I:"Adding Water"=1000
+
+    # Build Energy [range: 1 ~ 50000, default: 100]
+    I:"Build Energy"=100
+
+    # Growth Energy [range: 1 ~ 50000, default: 150]
+    I:"Growth Energy"=150
+
+    # Plant Energy [range: 1 ~ 50000, default: 50]
+    I:"Plant Energy"=50
+}
+
+
+scarecrow {
+    # Scarecrow Range [range: 1 ~ 25, default: 3]
+    I:"Scarecrow Range"=3
+
+    # Scarecrow Tick Rate [range: 1 ~ 10000, default: 500]
+    I:"Scarecrow Tick Rate"=500
+}
+
+
+settings {
+    # Tool Models [default: true]
+    B:"Enable Tool Models"=true
+
+    # Calculator Locator [default: true]
+    B:"Locator Can Change Time"=true
+
+    # Calculator Locator [default: true]
+    B:"Locator has a beam"=true
+
+    # Grenades [default: true]
+    B:"allow grenades?"=false
+}

src/config/calculator/Items-BlackList.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+"item config" {
+    S:Disabled <
+        ExampleItem
+        ExampleItem2
+     >
+}
+
+

src/config/chisel.cfg

@@ -0,0 +1,236 @@
+# Configuration file
+
+block {
+    # The tool that is able to break roadLines (requires useRoadLineTool to be true to take effect)
+    S:getRoadLineTool=pickaxe
+
+    # The lowest harvest level of the tool able to break the road lines (requires useRoadLineTool to be true to take effect) (0 = Wood/Gold, 1 = Stone, 2 = Iron, 3 = Diamond) Default: 0
+    I:roadLineToolLevel=0
+
+    # Should the road line require a tool to break (If false, road lines can be broken in Adventure)
+    B:useRoadLineTool=false
+}
+
+
+chisel {
+    # Should someone be able to chisel something into a different color.
+    B:allowChiselCrossColors=true
+
+    # Should the chisel be damageable and take damage when it chisels something.
+    B:allowChiselDamage=true
+
+    # The extra attack damage points (in half hearts) that the diamond chisel inflicts when it is used to attack an entity.
+    I:diamondChiselAttackDamage=3
+
+    # The max damage of the diamond chisel. [range: 1 ~ 32767, default: 5000]
+    I:diamondChiselMaxDamage=5000
+
+    # The extra attack damage points (in half hearts) that the iChisel inflicts when it is used to attack an entity.
+    I:hitechChiselAttackDamage=3
+
+    # The max damage of the iChisel. [range: 1 ~ 32767, default: 10000]
+    I:hitechChiselMaxDamage=10000
+
+    # The extra attack damage points (in half hearts) that the iron chisel inflicts when it is used to attack an entity.
+    I:ironChiselAttackDamage=2
+
+    # If this is true, the iron chisel can left click chisel blocks. If false, it cannot.
+    B:ironChiselCanLeftClick=true
+
+    # If this is true, the iron chisel can change its chisel mode just as the diamond chisel can.
+    B:ironChiselHasModes=false
+
+    # The max damage of the standard iron chisel. [range: 1 ~ 32767, default: 500]
+    I:ironChiselMaxDamage=500
+}
+
+
+client {
+    # Choose whether the inside corner is disconnected on a CTM block - http://imgur.com/eUywLZ4
+    B:connectInsideCTM=false
+
+    # Enable connected textures
+    B:connectedTextures=true
+
+    # For those people who just hate block descriptions on the world gen!
+    B:imTooGoodForBlockDescriptions=false
+
+    # Particle tick rate. Greater value = less particles.
+    I:particleTickrate=1
+
+    # Use old pillar textures
+    B:pillarOldGraphics=false
+
+    # Make variations of blocks have the same name, and use the description in tooltip to distinguish them.
+    B:tooltipsUseBlockDescriptions=true
+}
+
+
+features {
+    B:aluminum=true
+    B:andesite=true
+    B:antiblock=true
+    B:basalt=true
+    B:bloodMagic=true
+    B:bookshelf=true
+    B:bricks=true
+    B:bronze=true
+    B:carpet=true
+    B:cloud=true
+    B:cobalt=true
+    B:cobblestone=true
+    B:cobblestonemossy=true
+    B:copper=true
+    B:diamond=true
+    B:diorite=true
+    B:dirt=true
+    B:electrum=true
+    B:emerald=true
+    B:endPurpur=true
+    B:endstone=true
+    B:factory=true
+    B:futura=true
+    B:glass=true
+    B:glassdyed=true
+    B:glowstone=true
+    B:gold=true
+    B:granite=true
+    B:hardenedClay=true
+    B:ice=true
+    B:icepillar=true
+    B:invar=true
+    B:iron=true
+    B:ironpane=true
+    B:laboratory=true
+    B:lapis=true
+    B:lavastone=true
+    B:lead=true
+    B:limestone=true
+    B:marble=true
+    B:marblepillar=true
+    B:netherbrick=true
+    B:netherrack=true
+    B:nickel=true
+    B:obsidian=true
+    B:paper=true
+    B:planks=true
+    B:platinum=true
+    B:prismarine=true
+    B:quartz=true
+    B:redstone=true
+    B:sandstone=true
+    B:sandstoneRed=true
+    B:sandstoneScribbles=true
+    B:silver=true
+    B:steel=true
+    B:stonebrick=true
+    B:technical=true
+    B:temple=true
+    B:tin=true
+    B:tyrian=true
+    B:uranium=true
+    B:valentines=true
+    B:voidstone=true
+    B:waterstone=true
+}
+
+
+general {
+    # If true, you can chisel stone brick to mossy stone brick.
+    B:allowBrickToMossyInChisel=true
+    B:allowSmoothStoneToStoneBricksAndBack=true
+    I:amountYouGetFromFactoryBlockCrafting=32
+
+    # Use alternative crafting recipe for the chisel
+    B:chiselAlternateRecipe=false
+
+    # If this is true, you can chisel from the chisel leaves back to vanilla ones. If it is false, you cannot.
+    B:chiselBackToVanillaLeaves=false
+
+    # Chisel stone to cobblestone and bricks by left clicking.
+    B:chiselStoneToCobbleBricks=true
+
+    # The factor that concrete increases your velocity. Default is 1.35, set to 1 for no change.
+    D:concreteVelocityMult=1.35
+    B:doesCloudRenderLikeGhost=true
+
+    # Should concrete be a full block. This will also unavoidably disable speed increase if set to true.
+    B:fullBlockConcrete=false
+}
+
+
+hexcolors {
+    # Black color for hex block overlay #RRGGBB
+    S:hexblack=#f0f0f0
+
+    # Blue color for hex block overlay #RRGGBB
+    S:hexblue=#decf2a
+
+    # Brown color for hex block overlay #RRGGBB
+    S:hexbrown=#6689d3
+
+    # Cyan color for hex block overlay #RRGGBB
+    S:hexcyan=#d88198
+
+    # Gray color for hex block overlay #RRGGBB
+    S:hexgray=#ababab
+
+    # Green color for hex block overlay #RRGGBB
+    S:hexgreen=#c354cd
+
+    # Light_blue color for hex block overlay #RRGGBB
+    S:hexlight_blue=#51301a
+
+    # Lime color for hex block overlay #RRGGBB
+    S:hexlime=#7b2fbe
+
+    # Magenta color for hex block overlay #RRGGBB
+    S:hexmagenta=#3b511a
+
+    # Orange color for hex block overlay #RRGGBB
+    S:hexorange=#b3312c
+
+    # Pink color for hex block overlay #RRGGBB
+    S:hexpink=#287697
+
+    # Purple color for hex block overlay #RRGGBB
+    S:hexpurple=#41cd34
+
+    # Red color for hex block overlay #RRGGBB
+    S:hexred=#eb8844
+
+    # Silver color for hex block overlay #RRGGBB
+    S:hexsilver=#434343
+
+    # White color for hex block overlay #RRGGBB
+    S:hexwhite=#1e1b1b
+
+    # Yellow color for hex block overlay #RRGGBB
+    S:hexyellow=#253192
+}
+
+
+worldgen {
+    # Amount of limestone to generate in the world; use 0 for none [range: 0 ~ 30, default: 18]
+    I:limestoneAmount=18
+
+    # Amount of marble to generate in the world; use 0 for none [range: 0 ~ 30, default: 20]
+    I:marbleAmount=20
+
+    basalt {
+        # Thickness of the basalt at the bottom of lava lakes. 0 for none. [range: 0 ~ 5, default: 3]
+        I:bottomThickness=3
+
+        # Thickness of the basalt around the sides of lava lakes. 0 for none. [range: 0 ~ 5, default: 1]
+        I:sideThickness=1
+
+        # True to generate basalt only around lava lakes. False to do standard vein generation. [default: true]
+        B:specialGen=true
+
+        # Amount of basalt to generate in the world if not using special generation. Has no effect if basaltSpecialGen is true. Use 0 for none [range: 0 ~ 30, default: 15]
+        I:veinAmount=15
+    }
+
+}
+
+

src/config/chiselsandbits.cfg

@@ -0,0 +1,310 @@
+# Configuration file
+
+"balance settings" {
+    I:bagStackSize=512
+    D:bitLightPercentage=6.25
+    B:compatabilityMode=true
+    B:damageTools=true
+    I:diamondChiselUses=796480
+    I:diamondSawUses=7980
+    B:enableBitLightSource=true
+    B:enableChiselToolHarvestCheck=true
+    S:enableChiselToolHarvestCheckTools=pickaxe,axe,shovel
+    B:enableSetBitCommand=false
+    B:enableToolHarvestLevels=true
+    I:goldChiselUses=1024
+    I:ironChiselUses=293440
+    D:maxDrawnRegionSize=4.0
+    I:stoneChiselUses=8384
+    I:wrenchUses=1888
+}
+
+
+"client performance settings" {
+    B:defaultToDynamicRenderer=false
+    I:dynamicMaxConcurrentTessalators=32
+    I:dynamicModelFaceCount=40
+    B:dynamicModelMinimizeLatancy=true
+    I:dynamicModelRange=128
+    B:forceDynamicRenderer=false
+    I:maxMillisecondsPerBlock=10
+    I:maxMillisecondsUploadingPerFrame=15
+    S:useVBO=AUTOMATIC
+}
+
+
+"client settings" {
+    B:addBrokenBlocksToCreativeClipboard=true
+    B:chatModeNotification=false
+    I:creativeClipboardSize=32
+    B:displayMeasuringTapeInChat=false
+    B:enableChiselMode_ConnectedPlane=true
+    B:enableChiselMode_DrawnRegion=true
+    B:enableChiselMode_LargeCube=true
+    B:enableChiselMode_Line=true
+    B:enableChiselMode_MediumCube=true
+    B:enableChiselMode_Plane=true
+    B:enableChiselMode_SmallCube=true
+    B:enableChiselMode_Snap2=true
+    B:enableChiselMode_Snap4=true
+    B:enableChiselMode_Snap8=true
+    B:enablePositivePatternMode_Additive=true
+    B:enablePositivePatternMode_Impose=true
+    B:enablePositivePatternMode_Placement=true
+    B:enablePositivePatternMode_Replace=true
+    B:enableRightClickModeChange=false
+    B:enableTapeMeasure_Bit=true
+    B:enableTapeMeasure_Block=true
+    B:enableTapeMeasure_Distance=true
+    B:enableToolbarIcons=true
+    B:fluidBitsAreClickThrough=true
+    B:invertBitBagFullness=false
+    B:itemNameModeDisplay=true
+    I:maxTapeMeasures=5
+    I:maxUndoLevel=32
+    B:perChiselMode=true
+    B:persistCreativeClipboard=true
+    B:showUsage=true
+}
+
+
+crafting {
+    B:enableNegativePrintInversionCrafting=true
+    B:enablePositivePrintCrafting=true
+    B:enableStackableCrafting=true
+}
+
+
+"enabled blocks" {
+    B:WayofTime.bloodmagic.block.BlockBloodRune=true
+    B:WayofTime.bloodmagic.block.BlockBloodStoneBrick=true
+    B:WayofTime.bloodmagic.block.BlockCrystal=true
+    B:WayofTime.bloodmagic.block.BlockDemonBase=true
+    B:WayofTime.bloodmagic.block.BlockDemonLight=true
+    B:WayofTime.bloodmagic.block.BlockDemonPillarBase=true
+    B:WayofTime.bloodmagic.block.BlockDemonPillarCapBase=true
+    B:WayofTime.bloodmagic.block.BlockPath=true
+    B:WayofTime.bloodmagic.block.BlockRitualStone=true
+    B:biomesoplenty.common.block.BlockBOPBiomeBlock=true
+    B:biomesoplenty.common.block.BlockBOPCrystal=true
+    B:biomesoplenty.common.block.BlockBOPGem=true
+    B:biomesoplenty.common.block.BlockBOPGemOre=true
+    B:biomesoplenty.common.block.BlockBOPGeneric=true
+    B:biomesoplenty.common.block.BlockBOPHive=true
+    B:biomesoplenty.common.block.BlockBOPLog=true
+    B:biomesoplenty.common.block.BlockBOPPlanks=true
+    B:biomesoplenty.common.block.BlockBOPStone=true
+    B:blusunrize.immersiveengineering.common.blocks.BlockIEBase=true
+    B:com.Da_Technomancer.crossroads.blocks.BasicBlock=true
+    B:com.jaquadro.minecraft.storagedrawers.block.BlockTrim=true
+    B:com.pam.harvestcraft.blocks.blocks.BeeBlock=true
+    B:com.pam.harvestcraft.blocks.blocks.BeehiveBlock=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockACBasic=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockACBrick=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockACDoubleSlab=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockACLog=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockACOre=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockDarkstone=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockEthaxiumPillar=true
+    B:com.shinoow.abyssalcraft.common.blocks.BlockSolidLava=true
+    B:com.shinoow.abyssalcraft.common.blocks.IngotBlock=true
+    B:com.valkyrieofnight.environmentaltech.block.BlockDec=true
+    B:com.valkyrieofnight.environmentaltech.block.decorative.BlockDecorative=true
+    B:com.valkyrieofnight.environmentaltech.block.decorative.BlockLonsdaleite=true
+    B:crazypants.enderio.block.BlockDecorationFacing=true
+    B:crazypants.enderio.block.BlockReinforcedObsidian=true
+    B:crazypants.enderio.material.BlockIngotStorage=true
+    B:de.ellpeck.actuallyadditions.mod.blocks.BlockColoredLamp=true
+    B:de.ellpeck.actuallyadditions.mod.blocks.BlockCrystal=true
+    B:de.ellpeck.actuallyadditions.mod.blocks.BlockGeneric=true
+    B:de.ellpeck.actuallyadditions.mod.blocks.BlockLampPowerer=true
+    B:de.ellpeck.actuallyadditions.mod.blocks.BlockMisc=true
+    B:exter.fodc.block.BlockOreConversionTable=true
+    B:exter.substratum.block.BlockDustOre=true
+    B:exter.substratum.block.BlockOre=true
+    B:"exter.substratum.block.SubstratumBlocks$7"=true
+    B:"exter.substratum.block.SubstratumBlocks$8"=true
+    B:"forestry.arboriculture.blocks.log.BlockArbLog$1"=true
+    B:"forestry.arboriculture.blocks.log.BlockFireproofVanillaLog$1"=true
+    B:"forestry.arboriculture.blocks.planks.BlockArbPlanks$1"=true
+    B:"forestry.arboriculture.blocks.planks.BlockFireproofVanillaPlanks$1"=true
+    B:forestry.core.blocks.BlockResourceOre=true
+    B:forestry.core.blocks.BlockResourceStorage=true
+    B:ic2.core.block.BlockMultiID=true
+    B:ic2.core.block.BlockTexGlass=true
+    B:ic2.core.block.BlockWall=true
+    B:ic2.core.block.machine.BlockMiningPipe=true
+    B:li.cil.oc.common.block.ChameliumBlock=true
+    B:li.cil.oc.common.block.FakeEndstone=true
+    B:lumien.randomthings.block.BlockBiomeStone=true
+    B:lumien.randomthings.block.BlockContactLever=true
+    B:lumien.randomthings.block.BlockDyeingMachine=true
+    B:lumien.randomthings.block.BlockLapisLamp=true
+    B:lumien.randomthings.block.BlockPod=true
+    B:lumien.randomthings.block.BlockQuartzLamp=true
+    B:lumien.randomthings.block.BlockRainbowLamp=true
+    B:lumien.randomthings.block.BlockStainedBrick=true
+    B:mcjty.deepresonance.blocks.MachineFrame=true
+    B:mcjty.deepresonance.blocks.ore.DenseObsidianBlock=true
+    B:mcjty.deepresonance.blocks.ore.ResonatingOreBlock=true
+    B:mcjty.deepresonance.blocks.poisondirt.PoisonedDirtBlock=true
+    B:mcjty.deepresonance.blocks.radiationsensor.RadiationSensorBlock=true
+    B:mcjty.rftools.blocks.MachineBase=true
+    B:mcjty.rftools.blocks.MachineFrame=true
+    B:mcjty.rftools.blocks.ores.DimensionalShardBlock=true
+    B:mcjty.rftools.blocks.teleporter.DestinationAnalyzerBlock=true
+    B:mcjty.rftools.blocks.teleporter.MatterBoosterBlock=true
+    B:mcjty.rftoolsdim.blocks.probe.ActivityProbeBlock=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalBlankBlock=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalBlock=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalCross2Block=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalCrossBlock=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalPattern1Block=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalPattern2Block=true
+    B:mcjty.rftoolsdim.blocks.shards.DimensionalSmallBlocks=true
+    B:mekanism.common.block.BlockOre=true
+    B:mekanism.common.block.BlockPlastic=true
+    B:mekanism.common.block.BlockSalt=true
+    B:net.darkhax.bookshelf.features.bookshelves.BlockWoodenShelf=true
+    B:net.darkhax.darkutils.features.shulkerpearl.BlockShulkerPearl=true
+    B:net.malisis.doors.block.RustyLadder=true
+    B:net.minecraft.block.Block=true
+    B:net.minecraft.block.BlockBone=true
+    B:net.minecraft.block.BlockBookshelf=true
+    B:net.minecraft.block.BlockClay=true
+    B:net.minecraft.block.BlockColored=true
+    B:net.minecraft.block.BlockCompressedPowered=true
+    B:net.minecraft.block.BlockDirt=true
+    B:net.minecraft.block.BlockGlass=true
+    B:net.minecraft.block.BlockGlowstone=true
+    B:net.minecraft.block.BlockGrass=true
+    B:net.minecraft.block.BlockGravel=true
+    B:net.minecraft.block.BlockHardenedClay=true
+    B:net.minecraft.block.BlockHay=true
+    B:net.minecraft.block.BlockHugeMushroom=true
+    B:net.minecraft.block.BlockIce=true
+    B:net.minecraft.block.BlockMelon=true
+    B:net.minecraft.block.BlockNetherBrick=true
+    B:net.minecraft.block.BlockNetherrack=true
+    B:net.minecraft.block.BlockNewLeaf=true
+    B:net.minecraft.block.BlockNewLog=true
+    B:net.minecraft.block.BlockObsidian=true
+    B:net.minecraft.block.BlockOldLeaf=true
+    B:net.minecraft.block.BlockOldLog=true
+    B:net.minecraft.block.BlockOre=true
+    B:net.minecraft.block.BlockPackedIce=true
+    B:net.minecraft.block.BlockPlanks=true
+    B:net.minecraft.block.BlockPrismarine=true
+    B:net.minecraft.block.BlockQuartz=true
+    B:net.minecraft.block.BlockRedSandstone=true
+    B:net.minecraft.block.BlockRedstoneLight=true
+    B:net.minecraft.block.BlockRedstoneOre=true
+    B:net.minecraft.block.BlockRotatedPillar=true
+    B:net.minecraft.block.BlockSand=true
+    B:net.minecraft.block.BlockSandStone=true
+    B:net.minecraft.block.BlockSeaLantern=true
+    B:net.minecraft.block.BlockSilverfish=true
+    B:net.minecraft.block.BlockSlime=true
+    B:net.minecraft.block.BlockSnowBlock=true
+    B:net.minecraft.block.BlockSponge=true
+    B:net.minecraft.block.BlockStainedGlass=true
+    B:net.minecraft.block.BlockStone=true
+    B:net.minecraft.block.BlockStoneBrick=true
+    B:net.minecraft.block.BlockWorkbench=true
+    B:slimeknights.tconstruct.gadgets.block.BlockBrownstone=true
+    B:slimeknights.tconstruct.gadgets.block.BlockDriedClay=true
+    B:slimeknights.tconstruct.shared.block.BlockClearGlass=true
+    B:slimeknights.tconstruct.shared.block.BlockClearStainedGlass=true
+    B:slimeknights.tconstruct.shared.block.BlockDecoGround=true
+    B:slimeknights.tconstruct.shared.block.BlockFirewood=true
+    B:slimeknights.tconstruct.shared.block.BlockMetal=true
+    B:slimeknights.tconstruct.shared.block.BlockOre=true
+    B:slimeknights.tconstruct.shared.block.BlockSlime=true
+    B:slimeknights.tconstruct.shared.block.BlockSlimeCongealed=true
+    B:slimeknights.tconstruct.shared.block.BlockSoil=true
+    B:slimeknights.tconstruct.smeltery.block.BlockSeared=true
+    B:slimeknights.tconstruct.world.block.BlockSlimeDirt=true
+    B:slimeknights.tconstruct.world.block.BlockSlimeLeaves=true
+    B:sonar.calculator.mod.common.block.CalculatorLogs=true
+    B:sonar.calculator.mod.common.block.CalculatorPlanks=true
+    B:sonar.calculator.mod.common.block.MaterialBlock=true
+    B:sonar.core.common.block.BlockBase=true
+    B:sonar.core.common.block.StableStone=true
+    B:team.chisel.common.block.BlockCarvable=true
+    B:team.chisel.common.block.BlockCarvableBookshelf=true
+    B:vazkii.botania.common.block.BlockDreamwood=true
+    B:vazkii.botania.common.block.BlockEnchantedSoil=true
+    B:vazkii.botania.common.block.BlockFelPumpkin=true
+    B:vazkii.botania.common.block.BlockLivingrock=true
+    B:vazkii.botania.common.block.BlockLivingwood=true
+    B:vazkii.botania.common.block.BlockManaBomb=true
+    B:vazkii.botania.common.block.BlockRoot=true
+    B:vazkii.botania.common.block.BlockStorage=true
+    B:vazkii.botania.common.block.decor.BlockBlaze=true
+    B:vazkii.botania.common.block.decor.BlockCustomBrick=true
+    B:vazkii.botania.common.block.decor.BlockElfGlass=true
+    B:vazkii.botania.common.block.decor.BlockManaGlass=true
+    B:vazkii.botania.common.block.decor.BlockPavement=true
+    B:vazkii.botania.common.block.decor.BlockPetalBlock=true
+    B:vazkii.botania.common.block.decor.BlockShimmerrock=true
+    B:vazkii.botania.common.block.decor.BlockShimmerwoodPlanks=true
+    B:vazkii.botania.common.block.decor.biomestone.BlockBiomeStoneA=true
+    B:vazkii.botania.common.block.decor.biomestone.BlockBiomeStoneB=true
+    B:vazkii.botania.common.block.decor.quartz.BlockSpecialQuartz=true
+    B:vazkii.botania.common.block.mana.BlockAlchemyCatalyst=true
+    B:vazkii.botania.common.block.mana.BlockConjurationCatalyst=true
+    B:vazkii.psi.common.block.BlockPsiDecorative=true
+    B:vazkii.quark.building.block.BlockBark=true
+    B:vazkii.quark.building.block.BlockCarvedWood=true
+    B:vazkii.quark.building.block.BlockCharredNetherBricks=true
+    B:vazkii.quark.building.block.BlockHardenedClayTiles=true
+    B:vazkii.quark.building.block.BlockIronPlate=true
+    B:vazkii.quark.building.block.BlockMidori=true
+    B:vazkii.quark.building.block.BlockMidoriPillar=true
+    B:vazkii.quark.building.block.BlockNewSandstone=true
+    B:vazkii.quark.building.block.BlockPolishedStone=true
+    B:vazkii.quark.building.block.BlockReed=true
+    B:vazkii.quark.building.block.BlockSandyBricks=true
+    B:vazkii.quark.building.block.BlockSnowBricks=true
+    B:vazkii.quark.building.block.BlockStainedClayTiles=true
+    B:vazkii.quark.building.block.BlockThatch=true
+    B:vazkii.quark.building.block.BlockWorldStoneBricks=true
+    B:vazkii.quark.decoration.block.BlockBlazeLantern=true
+    B:vazkii.quark.decoration.block.BlockCharcoal=true
+    B:vazkii.quark.decoration.block.BlockCustomBookshelf=true
+    B:vazkii.quark.decoration.block.BlockLitLamp=true
+    B:vazkii.quark.world.block.BlockBasalt=true
+    B:vazkii.quark.world.block.BlockBiotite=true
+    B:vazkii.quark.world.block.BlockBiotiteOre=true
+    B:wiresegal.psionup.common.block.BlockPlate=true
+}
+
+
+"integration settings" {
+    B:ShowBitsInJEI=false
+}
+
+
+items {
+    B:enableBitBag=true
+    B:enableBitSaw=true
+    B:enableBitTank=true
+    B:enableChisledBits=true
+    B:enableDiamondChisel=true
+    B:enableGoldChisel=true
+    B:enableIronChisel=true
+    B:enableMirrorPrint=true
+    B:enableNegativePrint=true
+    B:enablePositivePrint=true
+    B:enableStoneChisel=true
+    B:enableTapeMeasure=true
+    B:enableWoodenWrench=true
+}
+
+
+troubleshooting {
+    B:enableAPITestingItem=false
+    B:logTileErrors=false
+}
+
+

src/config/cookingforblockheads.cfg

@@ -0,0 +1,57 @@
+# Configuration file
+
+##########################################################################################################
+# blocks
+#--------------------------------------------------------------------------------------------------------#
+# Setting any of these options to false will disable their crafting recipe.
+##########################################################################################################
+
+blocks {
+}
+
+
+compat {
+    # Set this to true if you'd like the oven to only accept cooking oil as fuel (requires Pam's Harvestcraft) [default: false]
+    B:"Oven Requires Cooking Oil"=false
+}
+
+
+general {
+    # If true, a cow can be squished into a Milk Jar by dropping an anvil on top. [default: true]
+    B:"Cow in a Jar"=true
+
+    # The amount of milk the cow in a jar generates per tick. [range: 0.0 ~ 3.4028235E38, default: 0.5]
+    S:"Cow in a Jar Milk per Tick"=0.5
+
+    # Set this to true if you'd like to disallow automation of the oven (pipes and such won't be able to insert/extract) [default: false]
+    B:"Disallow Oven Automation"=false
+
+    # The cooking time multiplier for the cooking oven. Higher values means it will take longer. [range: 0.25 ~ 9.0, default: 1.0]
+    S:"Oven Cook Time Multiplier"=1.0
+
+    # The fuel multiplier for the cooking oven. Higher values means fuel lasts longer, 1.0 is furnace default. [range: 0.1 ~ 2.0, default: 0.33]
+    S:"Oven Fuel Time Multiplier"=0.5
+
+    # Set this to true if you'd like the sink to require water to be piped in, instead of providing infinite of it. [default: false]
+    B:"Sink Requires Water"=false
+}
+
+
+##########################################################################################################
+# items
+#--------------------------------------------------------------------------------------------------------#
+# Setting any of these options to false will disable their crafting recipe.
+##########################################################################################################
+
+items {
+}
+
+
+##########################################################################################################
+# modules
+#--------------------------------------------------------------------------------------------------------#
+# Setting any of these options to false will disable their specific mod support.
+##########################################################################################################
+
+modules {
+}

src/config/correlatedpotentialistics.cfg

@@ -0,0 +1,65 @@
+# Configuration file
+
+balance {
+    # The default radius of wireless transmitters, in blocks. [range: 1.0 ~ 65536.0, default: 64.0]
+    S:defaultWirelessRange=64.0
+
+    # If enabled, the Weldthrower will damage mobs and set them on fire. [default: true]
+    B:weldthrowerHurts=true
+}
+
+
+crafting {
+    # If true, processors can be crafted without going to the limbo dungeon. Not recommended. [default: false]
+    B:easyProcessors=false
+}
+
+
+ids {
+    # The dimension ID for the glitch dungeon. [range: -256 ~ 256, default: -31]
+    I:limboDimId=-31
+}
+
+
+import {
+    # The mode for the old network importer, which will run on any 1.x networks loaded with CoPo 2.x. Possible values are:
+    # refund_all: Refund components, convert drives into Data Cores, and refund Interface contents. [default]
+    # refund_some: Convert drives into Data Cores and refund Interface contents, but do not refund drive crafting ingredients. Useful if you used MineTweaker to change the recipes. Blocks will still be refunded.
+    # refund_content: Convert drives into Data Cores and refund Interface contents, but do not refund anything else.
+    # destroy: Outright delete the network, and all items that were contained in it. If you use this option, PLEASE state it prominently on your modpack page, and warn people.
+    # leave: Leave the network alone. May result in glitchy drives holding more data than they should be able to, crashes, and general strangeness. Not recommended. [default: refund_all]
+    S:mode=refund_all
+}
+
+
+powerusage {
+    # The RF/t used by the Controller. [range: 0 ~ 640, default: 32]
+    I:controller=32
+
+    # The RF/t used by the Drive Bay. [range: 0 ~ 640, default: 8]
+    I:driveBay=8
+
+    # Drive power usage is (pow**tier)/div [range: 0 ~ 8, default: 2]
+    I:driveDiv=2
+
+    # Drive power usage is (pow**tier)/div [range: 0 ~ 8, default: 2]
+    I:drivePow=2
+
+    # The RF/t used by the Interface. [range: 0 ~ 640, default: 8]
+    I:interface=8
+
+    # The RF/t used by the Memory Bay. [range: 0 ~ 640, default: 4]
+    I:memoryBay=4
+
+    # The RF/t used by the Wireless Receiver. [range: 0 ~ 640, default: 16]
+    I:receiver=16
+
+    # The RF/t used by the Terminal. [range: 0 ~ 640, default: 4]
+    I:terminal=4
+
+    # The RF/t used by the Wireless Transmitter. [range: 0 ~ 640, default: 16]
+    I:transmitter=16
+
+    # The RF/t used by the Void Drive. [range: 0 ~ 640, default: 4]
+    I:voidDrive=4
+}

src/config/craftingtweaks.cfg

@@ -0,0 +1,39 @@
+# Configuration file
+
+##########################################################################################################
+# addons
+#--------------------------------------------------------------------------------------------------------#
+# Here you can control whether support for a mod should be enabled, buttons_only, hotkeys_only or disabled. For Vanilla Minecraft, see the option 'minecraft'. Mods are identified by their mod ids.
+##########################################################################################################
+
+addons {
+    # enabled, buttons_only, hotkeys_only or disabled [default: enabled]
+    S:minecraft=enabled
+
+    # enabled, buttons_only, hotkeys_only or disabled [default: enabled]
+    S:tconstruct=enabled
+}
+
+
+general {
+    # Set this to true if you want the (de)compress feature to work outside of crafting GUIs (only works if installed on server) [default: false]
+    B:compressAnywhere=false
+
+    # A list of modid:name entries that will not be crafted by the compress key. [default: [ExtraUtilities:decorativeBlock1], [minecraft:sandstone], [minecraft:iron_trapdoor]]
+    S:compressBlacklist <
+        ExtraUtilities:decorativeBlock1
+        minecraft:sandstone
+        minecraft:iron_trapdoor
+     >
+
+    # Set this to true if you don't want the tweak buttons' tooltips to show. [default: false]
+    B:hideButtonTooltips=false
+
+    # This option is toggled by the 'Toggle Buttons' key that can be defined in the Controls settings. [default: false]
+    B:hideButtons=false
+
+    # If set to true, right-clicking the result slot in a crafting table will craft a full stack. [default: true]
+    B:rightClickCraftsStack=true
+}
+
+

src/config/crossroads.cfg

@@ -0,0 +1,19 @@
+# Configuration file
+
+misc {
+    B:"Enable rain idol? (default true)"=true
+}
+
+
+ores {
+    B:"Generate Copper Ore?"=false
+    B:"Generate Native Copper Ore?"=true
+    B:"Generate Ruby Ore?"=true
+    B:"Generate Tin Ore?"=false
+}
+
+
+rotary {
+    # Higher value means smoother gear rotation, but more packets sent AKA lag. range 1-100 default 4
+    I:"Speed Tiers"=4
+}

src/config/darkutils.cfg

@@ -0,0 +1,320 @@
+# Configuration file
+
+##########################################################################################################
+# _features
+#--------------------------------------------------------------------------------------------------------#
+# Allows features to be completely disabled
+##########################################################################################################
+
+_features {
+    # A block for auto breeding [default: true]
+    B:"Animal Feeder"=true
+
+    # Undo slime chunks [default: true]
+    B:"Anti Slime Block"=true
+
+    # Material items used throughout DarkUtils [default: true]
+    B:"Crafting Materials"=true
+
+    # A hopper which can pick up blocks within range. [default: true]
+    B:"Ender Hopper"=true
+
+    # A block to redirect ender teleportation [default: true]
+    B:"Ender Tether"=true
+
+    # A safe TNT alternative [default: true]
+    B:"Fake TNT"=true
+
+    # Prevents 1-hit K.Os while in the inventory. [default: true]
+    B:"Focus Sash"=true
+
+    # A block that allows items through [default: true]
+    B:"Item Grate"=true
+
+    # Blocks for filtering mobs [default: true]
+    B:"Mob Filters"=true
+
+    # Strange potions with abnormal effects [default: true]
+    B:"Mysterious Potion"=true
+
+    # A charm to clean up useless items. [default: true]
+    B:"Null Charm"=true
+
+    # A charm to make traveling through portals faster [default: true]
+    B:"Portal Charm"=true
+
+    # A block for timing redstone [default: true]
+    B:"Redstone Timer"=true
+
+    # Gives sheep armor when they have wool [default: true]
+    B:"Sheep Armor"=true
+
+    # Adds shulker pearls and related content [default: true]
+    B:"Shlker Pearls"=true
+
+    # A charm to make sleeping faster [default: true]
+    B:"Sleep Charm"=true
+
+    # Blocks that can hide as other blocks [default: true]
+    B:"Sneaky Blocks"=true
+
+    # Trap blocks that have certain effects when stepped on [default: true]
+    B:"Trap Blocks"=true
+
+    # A block for detecting block updates [default: true]
+    B:"Update Detector"=true
+
+    # Adds several vanilla items and blocks to Forge's Ore Dictionary [default: true]
+    B:"Vanilla Ore Dictionary"=true
+
+    # A block that pushes entities around [default: true]
+    B:"Vector Plate"=true
+}
+
+
+animal_feeder {
+    # Should the feeder be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+anti_slime_block {
+    # Should the Anti Slime block be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+crafting_materials {
+    # Should Dwingle Cream be craftable? [default: true]
+    B:"Craft Dwindle Cream"=true
+
+    # Should Unstable Enderpearls be craftable? [default: true]
+    B:"Craft Unstable Enderpealr"=true
+
+    # Should the Wither Dust be craftable from Wither Skulls? [default: true]
+    B:"Craft Wither Dust"=true
+
+    # The weighting for Wither Skeletons dropping Wither Dust [range: 0 ~ 256, default: 1]
+    I:"Dust Drop Weight"=1
+
+    # Should wither skeletons drop wither dust? [default: true]
+    B:"WSkeleton Drop Dust"=true
+}
+
+
+ender_hopper {
+    # Should the Ender Hopper be craftable? [default: true]
+    B:Craftable=true
+
+    # The detection range of the ender hopper. Distance in blocks outwards, starting at the hopper position, but not including it. A range of 4 does a 9x9x9 area around the hopper. [range: 0 ~ 32, default: 4]
+    I:Range=4
+
+    # Sneak clicking a hopper will render an outline of it's area of effect. This will render for all players. Allow this? [default: true]
+    B:"Render Block Bounds"=true
+}
+
+
+ender_tether {
+    # Should the Ender Tether catch players using ender teleportation? [default: true]
+    B:"Affect Players"=true
+
+    # Should the Ender Tether be craftable? [default: true]
+    B:Craftable=true
+
+    # The range of the effect given by the tether. Distance is measured in blocks. [range: 0.0 ~ 512.0, default: 32.0]
+    S:"Tether Range"=32.0
+}
+
+
+fake_tnt {
+    # Should fake TNT be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+focus_sash {
+    # Should the focus sash be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+item_grate {
+    # Should the Item Grate be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+mob_filters {
+    # Should the animal filter be craftable? [default: true]
+    B:"Craft Animal Filter"=true
+
+    # Should the arthropod filter be craftable? [default: true]
+    B:"Craft Arthropod Filter"=true
+
+    # Should the baby filter be craftable? [default: true]
+    B:"Craft Baby Filter"=true
+
+    # Should the monster filter be craftable? [default: true]
+    B:"Craft Monster Filter"=true
+
+    # Should the pet filter be craftable? [default: true]
+    B:"Craft Pet Filter"=true
+
+    # Should the player filter be craftable? [default: true]
+    B:"Craft Player Filter"=true
+
+    # Should the slime filter be craftable? [default: true]
+    B:"Craft Slime Filter"=true
+
+    # Should the undead filter be craftable? [default: true]
+    B:"Craft Undead Filter"=true
+
+    # Should the water filter be craftable? [default: true]
+    B:"Craft Water Filter"=true
+}
+
+
+mysterious_potion {
+    # Should mysterious potions show up in dungeon chests? [default: true]
+    B:"Dungeon Loot"=true
+
+    # Weight for potions in dungeon chests [range: 0 ~ 10, default: 5]
+    I:"Dungeon Weight"=5
+}
+
+
+null_charm {
+    # Should the null charm be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+portal_charm {
+    # Should the portal charm be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+redstone_timer {
+    # Should the timer be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+sheep_armor {
+    # How many armor points should sheep have while they have wool? [range: 0.0 ~ 512.0, default: 1.0]
+    S:"Armor Points"=1.0
+}
+
+
+shlker_pearls {
+    # Can pearl blocks be crafted? [default: true]
+    B:"Craft Blocks"=true
+
+    # Can end rods be crafted? [default: true]
+    B:"Craft End Rods"=true
+
+    # Should pearls be harvestable from shulkers? [default: true]
+    B:"Harvest Pearls"=true
+
+    # The pearl harvest cooldown tile, in ticks [range: 0 ~ 2147483647, default: 6000]
+    I:"Shulker Cooldown"=6000
+}
+
+
+sleep_charm {
+    # Should the sleep charm be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+sneaky_blocks {
+    # Should the sneaky block be craftable? [default: true]
+    B:"Craft Sneaky Block"=true
+
+    # Should the sneaky false block be craftable? [default: true]
+    B:"Craft Sneaky False Block"=true
+
+    # Should the sneaky lever be craftable? [default: true]
+    B:"Craft Sneaky Lever"=true
+
+    # Should the sneaky obsidian be craftable? [default: true]
+    B:"Craft Sneaky Obsidian"=true
+
+    # Should the sneaky pressure plate be craftable? [default: true]
+    B:"Craft Sneaky Pressure Plate"=true
+
+    # Should the sneaky torch be craftable? [default: true]
+    B:"Craft Sneaky Torch"=true
+}
+
+
+trap_blocks {
+    # Should the fire trap be craftable? [default: true]
+    B:craftFire=true
+
+    # Should the harming trap be craftable? [default: true]
+    B:craftHarming=true
+
+    # Should the poison trap be craftable? [default: true]
+    B:craftPoison=true
+
+    # Should the slowness trap be craftable? [default: true]
+    B:craftSlowness=true
+
+    # Should the weakness trap be craftable? [default: true]
+    B:craftWeakness=true
+
+    # Should the wither trap be craftable? [default: true]
+    B:craftWither=true
+}
+
+
+update_detector {
+    # Should the Update Detector be craftable? [default: true]
+    B:Craftable=true
+}
+
+
+vanilla_ore_dictionary {
+    # When enabled, DarkUtils will register vanilla's wooden fence gates with Forge's ore dictionary under the name fenceGateWood. Disabling this will prevent several recipes in DarkUtils from working. [default: true]
+    B:oredictVanillaFenceGate=true
+
+    # When enabled, DarkUtils will register vanilla's stone blocks with Forge's ore dictionary using the name stone. Disabling this will prevent several recipes in DarkUtils from working. [default: true]
+    B:oredictVanillaStone=true
+}
+
+
+vector_plate {
+    # Should fast vector plates be convertable to hyper vector plates? [default: true]
+    B:"Convert Fast to Hyper"=true
+
+    # Should hyper vector plates be convertable to normal vector plates? [default: true]
+    B:"Convert Hyper to Fast"=true
+
+    # Should normal vector plates be convertable to fast vector plates? [default: true]
+    B:"Convert Normal to Fast"=true
+
+    # Should the Vector Plate be craftable? [default: true]
+    B:"Craft Vector Plate"=true
+
+    # The amount of vector plates to give per recipe set [range: 1 ~ 64, default: 8]
+    I:"Crafting Amount"=8
+
+    # Speed modifier for the fast vector plate [range: 0.0 ~ 5.0, default: 0.3]
+    S:"Fast Speed"=0.3
+
+    # Speed modifier for the hyper vector plate [range: 0.0 ~ 5.0, default: 1.5]
+    S:"Hyper Speed"=1.5
+
+    # Speed modifier for the normal vector plate [range: 0.0 ~ 5.0, default: 0.06]
+    S:"Normal Speed"=0.06
+
+    # Should vector plates prevent item despawn? [default: true]
+    B:"Prevent Item Despawn"=true
+
+    # Should vector plates prevent items from being picked up, while they are being pushed? [default: true]
+    B:"Prevent Item Pickup"=true
+}
+
+

src/config/deepresonance/machines.cfg

@@ -0,0 +1,123 @@
+# Configuration file
+
+collector {
+    # Maximum horizontal distance to look for crystals [range: 1 ~ 16, default: 10]
+    I:maxHorizontalCrystalDistance=10
+
+    # Maximum vertical distance to look for crystals [range: 1 ~ 16, default: 1]
+    I:maxVerticalCrystalDistance=1
+}
+
+
+crystalizer {
+    # The amount of RCL that is needed for one crystal [range: 10 ~ 100000, default: 6000]
+    I:rclPerCrystal=4000
+
+    # The amount of RCL/t that is consumed during crystalizing [range: 1 ~ 100000, default: 1]
+    I:rclPerTick=1
+
+    # Maximum RF that can be stored in this machine [range: 0 ~ 1000000000, default: 50000]
+    I:rfMaximum=50000
+
+    # How much RF this machine consumes for one crystalizing step [range: 0 ~ 1000, default: 20]
+    I:rfPerRcl=20
+
+    # How much RF/t this machine can input from a generator/capacitor [range: 0 ~ 1000, default: 200]
+    I:rfPerTick=200
+}
+
+
+laser {
+    # The maximum amount of liquified crystal this machine can hold (this is not RCL!) [range: 1 ~ 100000000, default: 20000]
+    I:crystalLiquidMaximum=20000
+
+    # The amount of crystal liquid we consume per catalyst item [range: 1 ~ 10000000, default: 25]
+    I:crystalLiquidPerCatalyst=25
+
+    # The maximum amount of liquified crystal one crystal will yield (this is not RCL!). This value is for a 100% strength crystal [range: 1 ~ 10000000, default: 10000]
+    I:maxCrystalLiquidPerCrystal=10000
+
+    # The minimum amount of liquified crystal one crystal will yield (this is not RCL!). This value is for a 0% strength crystal [range: 1 ~ 10000000, default: 2000]
+    I:minCrystalLiquidPerCrystal=2000
+
+    # The amount of RCL we improve with one catalyst item [range: 1 ~ 10000000, default: 500]
+    I:rclPerCatalyst=500
+
+    # Maximum RF that can be stored in this machine [range: 0 ~ 1000000000, default: 100000]
+    I:rfMaximum=100000
+
+    # How much RF/t this machine can input from a generator/capacitor [range: 0 ~ 50000, default: 2000]
+    I:rfPerTick=2000
+
+    # How much RF this machine consumes for infusing one catalyst item [range: 0 ~ 50000, default: 4000]
+    I:rfUsePerCatalyst=4000
+
+    # How many multiples of 10 ticks are needed to infuse one catalyst item [range: 0 ~ 10000, default: 4]
+    I:ticks10PerCatalyst=4
+}
+
+
+plateblock {
+    # Radius of radiation that a plate block gives when it has a redstone signal [range: 0 ~ 100000, default: 10]
+    I:radiationRadius=10
+
+    # Strength of radiation that a plate block gives when it has a redstone signal. 0 to disable [range: 0 ~ 100000, default: 20000]
+    I:radiationStrength=20000
+
+    # Amount of ticks that the radiation lasts from a plate block [range: 0 ~ 100000, default: 100]
+    I:radiationTicks=100
+}
+
+
+power {
+    # The maximum kilo-RF (per 1000, so 1000 = 1milion RF) that a crystal with 100% power can hold [range: 1 ~ 2000000000, default: 1000000]
+    I:maximumKiloRF=1000000
+
+    # The maximum RF/tick that a crystal with 100% efficiency can give [range: 0 ~ 20000, default: 20000]
+    I:maximumRFPerTick=20000
+}
+
+
+purifier {
+    # How much the purifier adds to the purity of a liquid (in %) [range: 1 ~ 100, default: 25]
+    I:addedPurity=25
+
+    # Maximum purity that the purifier can handle (in %) [range: 1 ~ 100, default: 85]
+    I:maxPurity=85
+
+    # The amount of RCL we purify as one unit [range: 1 ~ 10000, default: 200]
+    I:rclPerPurify=200
+
+    # Amount of ticks needed to purify one unit of RCL [range: 1 ~ 10000, default: 100]
+    I:ticksPerPurify=100
+}
+
+
+smelter {
+    # The amount of lava to smelt one ore [range: 100 ~ 10000, default: 200]
+    I:lavaCost=200
+
+    # The number of ticks to smelt one ore [range: 10 ~ 1000, default: 200]
+    I:processTime=200
+
+    # The amount of RCL to produce with one ore [range: 50 ~ 1000, default: 200]
+    I:rclPerOre=200
+
+    # Maximum RF that can be stored in this machine [range: 0 ~ 1000000000, default: 50000]
+    I:rfMaximum=50000
+
+    # How much RF/t this machine consumes during smelting ores [range: 0 ~ 1000, default: 10]
+    I:rfPerOre=10
+
+    # How much RF/t this machine can input from a generator/capacitor [range: 0 ~ 1000, default: 200]
+    I:rfPerTick=200
+}
+
+
+valve {
+    # The amount of RCL we process in one operation [range: 1 ~ 10000, default: 100]
+    I:rclPerOperation=100
+
+    # Amount of ticks needed to transfer one unit of RCL [range: 1 ~ 10000, default: 5]
+    I:ticksPerOperation=5
+}

src/config/deepresonance/main.cfg

@@ -0,0 +1,411 @@
+# Configuration file
+
+compat {
+    #  [default: AUTO]
+    S:ComputerCraft=AUTO
+}
+
+
+##########################################################################################################
+# generator
+#--------------------------------------------------------------------------------------------------------#
+# Configuration for the generator multiblock
+##########################################################################################################
+
+generator {
+    # The volume for the generator sound (1.0 is default, 0.0 is off)
+    D:baseGeneratorVolume=0.5
+
+    # Relative volume of the generator looping sound. With 1.0 the looping sound has equal loudness as the generator base volume
+    D:loopVolumeFactor=1.0
+
+    # The maximum amount of crystals supported by one generator
+    I:maxCrystalsPerBlock=2
+
+    # The maximum amount of RF/tick input that one block can support
+    I:maxRFInputPerBlock=10000
+
+    # The RF storage per generator block
+    I:rfPerGeneratorBlock=500000
+
+    # The RF/t output for a given side of the generator block
+    I:rfPerTickGenerator=100000
+
+    # Shutdown time of the generator (in ticks)
+    I:shutdownTime=70
+
+    # Startup time of the generator (in ticks)
+    I:startupTime=70
+}
+
+
+##########################################################################################################
+# lasercatalysts
+#--------------------------------------------------------------------------------------------------------#
+# Configuration for the laser bonuses
+##########################################################################################################
+
+lasercatalysts {
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:blaze_powder_color=4
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:blaze_powder_efficiency=5.0:70.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:blaze_powder_purity=-6.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:blaze_powder_strength=5.0:70.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:coal_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:coal_efficiency=0.0:0.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:coal_purity=-1.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:coal_strength=-10.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:diamond_color=1
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:diamond_efficiency=0.0:0.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:diamond_purity=5.0:100.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:diamond_strength=0.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:emerald_color=3
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:emerald_efficiency=0.0:0.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:emerald_purity=8.0:100.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:emerald_strength=0.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:ender_pearl_color=3
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:ender_pearl_efficiency=0.0:0.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:ender_pearl_purity=2.0:100.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:ender_pearl_strength=0.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:ghast_tear_color=4
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:ghast_tear_efficiency=15.0:100.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:ghast_tear_purity=-20.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:ghast_tear_strength=25.0:100.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:glowstone_dust_color=4
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:glowstone_dust_efficiency=3.0:50.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:glowstone_dust_purity=-2.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:glowstone_dust_strength=6.0:50.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:gold_ingot_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:gold_ingot_efficiency=1.0:30.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:gold_ingot_purity=0.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:gold_ingot_strength=-1.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:gunpowder_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:gunpowder_efficiency=4.0:60.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:gunpowder_purity=-5.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:gunpowder_strength=8.0:70.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:iron_ingot_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:iron_ingot_efficiency=1.0:20.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:iron_ingot_purity=0.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:iron_ingot_strength=-2.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:nether_star_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:nether_star_efficiency=90.0:100.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:nether_star_purity=-60.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:nether_star_strength=90.0:100.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:nether_wart_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:nether_wart_efficiency=-2.0:1.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:nether_wart_purity=-3.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:nether_wart_strength=2.0:35.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:prismarine_crystals_color=4
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_crystals_efficiency=4.0:35.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_crystals_purity=0.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_crystals_strength=4.0:35.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:prismarine_shard_color=4
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_shard_efficiency=3.0:30.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_shard_purity=0.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:prismarine_shard_strength=3.0:30.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:quartz_color=1
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:quartz_efficiency=7.0:80.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:quartz_purity=-1.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:quartz_strength=0.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:redstone_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:redstone_efficiency=0.0:0.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:redstone_purity=-1.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:redstone_strength=5.0:60.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:slime_ball_color=3
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:slime_ball_efficiency=-10.0:1.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:slime_ball_purity=0.0:0.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:slime_ball_strength=0.0:0.0
+
+    # Beam color (1 = blue, 2 = red, 3 = green, 4 = yellow)
+    I:snowball_color=2
+
+    # A percentage:minmax efficiency bonus to add or subtract to the rcl infuse unit volume
+    S:snowball_efficiency=1.0:40.0
+
+    # A percentage:minmax purity bonus to add or subtract to the rcl infuse unit volume
+    S:snowball_purity=1.0:30.0
+
+    # A percentage:minmax strength bonus to add or subtract to the rcl infuse unit volume
+    S:snowball_strength=0.0:0.0
+}
+
+
+##########################################################################################################
+# radiation
+#--------------------------------------------------------------------------------------------------------#
+# Configuration for the radiation
+##########################################################################################################
+
+radiation {
+    # The maximum explosion multiplier that is possible. Set to 0 to disable all explosions
+    D:absoluteMaximumExplosionMultiplier=20.0
+
+    # Every 10 ticks (half a second) this chance is evaluated to see if there should be a destruction event. 1.0 means it will always occur
+    D:destructionEventChance=0.019999999552965164
+
+    # The maximum that a radiation meter can measure
+    D:maxRadiationMeter=200000.0
+
+    # The maximum radiation radius for a 100/100/100 crystal
+    D:maxRadiationRadius=50.0
+
+    # The maximum radiation strength for a 100/100/100 crystal
+    D:maxRadiationStrength=600000.0
+
+    # The maximum explosion multiplier for a 100%/100% power/strength crystal
+    D:maximumExplosionMultiplier=17.0
+
+    # The minimum radiation radius
+    D:minRadiationRadius=7.0
+
+    # The minimum radiation strength
+    D:minRadiationStrength=3000.0
+
+    # The minimum explosion multiplier
+    D:minimumExplosionMultiplier=6.0
+
+    # The radiation strength at which point destruction events can happen
+    D:radiationDestructionEventLevel=300000.0
+
+    # Radiation strength level 0
+    D:radiationEffectLevel0=20000.0
+
+    # Radiation strength level 1
+    D:radiationEffectLevel1=50000.0
+
+    # Radiation strength level 2
+    D:radiationEffectLevel2=100000.0
+
+    # Radiation strength level 3
+    D:radiationEffectLevel3=200000.0
+
+    # Radiation strength level 4
+    D:radiationEffectLevel4=500000.0
+
+    # Radiation strength level 5
+    D:radiationEffectLevel5=1000000.0
+
+    # Below this level no effects occur
+    D:radiationEffectLevelNone=2000.0
+
+    # This factor increases the radius of radiation on explosion and decreases the strength
+    D:radiationExplosionFactor=1.2999999523162842
+
+    # RF per tick/per block for the radiation screen module (if rftools is present)
+    I:radiationModuleRFPerTick=6
+
+    # The color for the radiation overlay text in case the radiation monitor is in the players hand
+    I:radiationOverlayColor=-65536
+
+    # The color for the radiation overlay text in case the radiation monitor is in the players hand (in case there is no radiation)
+    I:radiationOverlayColorNoRadiation=-16711936
+
+    # The X coordinate (with 0 being left) for the radiation overlay text. Use -1 to disable
+    I:radiationOverlayX=10
+
+    # The Y coordinate (with 0 being top) for the radiation overlay text. Use -1 to disable
+    I:radiationOverlayY=10
+
+    # How much dense glass blocks radiation (0.0 is total block, 1.0 is not block at all)
+    D:radiationShieldDenseGlassFactor=0.10000000149011612
+
+    # How much dense obsidian blocks radiation (0.0 is total block, 1.0 is not block at all)
+    D:radiationShieldDenseObsidianFactor=0.05000000074505806
+
+    # How much dense lead blocks radiation (0.0 is total block, 1.0 is not block at all)
+    D:radiationShieldLeadFactor=0.10000000149011612
+
+    # How much obsidian blocks radiation (0.0 is total block, 1.0 is not block at all)
+    D:radiationShieldObsidianFactor=0.20000000298023224
+
+    # RF per tick/per block for the RCL screen module (if rftools is present)
+    I:rclModuleRFPerTick=6
+
+    # How much the radiation strength decreases every tick
+    D:strengthDecreasePerTick=3.0
+
+    # How much percentage of the maximum strength the radiation increases every tick
+    D:strengthGrowthFactor=0.0020000000949949026
+
+    # How much protection you get from radiation with 1 radiation suit piece equipped
+    D:suitProtection1=0.25
+
+    # How much protection you get from radiation with 2 radiation suit pieces equipped
+    D:suitProtection2=0.5
+
+    # How much protection you get from radiation with 3 radiation suit pieces equipped
+    D:suitProtection3=0.75
+
+    # How much protection you get from radiation with 4 radiation suit pieces equipped
+    D:suitProtection4=0.949999988079071
+}
+
+
+##########################################################################################################
+# worldgen
+#--------------------------------------------------------------------------------------------------------#
+# Configuration for wodlgen
+##########################################################################################################
+
+worldgen {
+    # Chances for the ore to spawn in a chunk
+    I:chancesToSpawn=10
+
+    # The chance that a crystal will spawn in a chunk. Higher number means less chance. 0 means no crystal will ever spawn.
+    I:crystalSpawnChance=15
+
+    # The number of times that the worldgen will try to spawn a crystal in a chunk before it fails.
+    I:crystalSpawnTries=10
+
+    # Maximum size of the ore veines
+    I:maxVeinSize=12
+
+    # Maximum ore height
+    I:maxY=30
+
+    # Minimum size of the ore veines
+    I:minVeinSize=5
+
+    # Minimum ore height
+    I:minY=2
+
+    # Enable this if you want to get retrogen (generation of ores/crystals) for already existing chunks
+    B:retrogen=true
+
+    # Enable this if you want to see in the log where crystals are spawned
+    B:verboseSpawn=false
+}

src/config/deepresonance/version.cfg

@@ -0,0 +1,7 @@
+# Configuration file
+
+version {
+    I:version=1
+}
+
+

src/config/endercore/cropConfig.json

@@ -0,0 +1,26 @@
+{"data":
+	[
+	{
+            "seed":"minecraft:wheat_seeds",
+            "block":"minecraft:wheat"
+        },
+        {
+            "seed":"minecraft:carrot",
+            "block":"minecraft:carrots"
+        },
+        {
+            "seed":"minecraft:potato",
+            "block":"minecraft:potatoes"
+        },
+        {
+            "seed":"minecraft:beetroot_seeds",
+            "block":"minecraft:beetroots",
+            "meta":3
+        },
+        {
+            "seed":"minecraft:nether_wart",
+            "block":"minecraft:nether_wart",
+            "meta":3
+        }
+	]
+}

src/config/endercore/endercore.cfg

@@ -0,0 +1,85 @@
+# Configuration file
+
+enchants {
+    # Allow the Auto Smelt enchant to be registered.
+    # [default: true]
+    B:allowAutoSmelt=true
+
+    # Allow the XP Boost enchant to be registered.
+    # [default: true]
+    B:allowXPBoost=true
+}
+
+
+general {
+    # Disabling this option will prevent any crops added to the config json from being right clickable.
+    # [default: true]
+    B:allowCropRC=true
+
+    # Disabling this option will prevent tick speedup (i.e. torcherino) on any TE that uses the base TE class from EnderCore
+    # [default: true]
+    B:allowExternalTickSpeedup=true
+
+    # The max amount of XP levels an anvil recipe can use.
+    # [default: 40]
+    I:anvilMaxLevel=40
+
+    # The way the game should have been made (Yes this is the fireworks thing).
+    # [default: false]
+    B:betterAchievements=true
+
+    # Control the behavior of invisible mode (disables all gameplay features). Having this setting be different between client and server could cause some desync, but otherwise is harmless.
+    # 0 - Default. Lets other mods request invisible mode. If none do, invisible mode is off.
+    # -1 (or below) - Never invisible, even if mods request it.
+    # 1 (or above) - Always invisible, even if no mods request it.
+    # [default: 0]
+    I:invisibleMode=0
+
+    # Fireworks display on new years eve
+    # [default: true]
+    B:newYearsFireworks=true
+
+    # Show durability on item tooltips.
+    # 0 - Off
+    # 1 - Always on
+    # 2 - Only with shift
+    # 3 - Only in debug mode
+    # [range: 0 ~ 3, default: 1]
+    I:showDurabilityTooltips=1
+
+    # Show oredictionary names of every item in its tooltip.
+    # 0 - Off
+    # 1 - Always on
+    # 2 - Only with shift
+    # 3 - Only in debug mode
+    # [range: 0 ~ 3, default: 2]
+    I:showOredictTooltips=2
+
+    # Show item registry names in tooltips.
+    # 0 - Off
+    # 1 - Always on
+    # 2 - Only with shift
+    # 3 - Only in debug mode
+    # [range: 0 ~ 3, default: 3]
+    I:showRegistryNameTooltips=3
+}
+
+
+tweaks {
+    B:bookToPaperRecipe=true
+
+    # Makes boats stack to 16
+    # [default: true]
+    B:changeBoatStackSize=true
+
+    # Makes the bed stepSound wool instead of stone
+    # [default: true]
+    B:fixBedSound=true
+
+    # Allows packed ice to be mined with a pickaxe
+    # [default: true]
+    B:fixPackedIceTool=true
+    B:infinibow=true
+    B:shapelessPaperRecipe=true
+    B:slabToBlockRecipes=true
+}

src/config/enderio/AlloySmelterRecipes_Core.xml

@@ -0,0 +1,408 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify recipes please use 'AlloySmelterRecipes_User.xml'.
+
+  Please refer to the documentation in 'SAGMillRecipes_Core.xml or _User.xml' for details on the format used. Recipes for
+  the alloy smelter have multiple inputs (up to three) and a single output. Multiple output tags can be used as long as
+  they are for the same item. This allows 'chance' outputs, for example, if you wanted to output some 4 bronze ingots
+  with a 50% chance of a fifth, you would use:
+
+  <recipe name="Smelted Bronze" energyCost="750" >
+     <input>
+        <itemStack oreDictionary="ingotCopper" number="1" />
+     </input>
+     <input>
+        <itemStack oreDictionary="ingotTon" number="3" />
+     </input>
+     <output>
+       <itemStack oreDictionary="ingotBronze" number="4" exp="0.5" />
+       <itemStack oreDictionary="ingotBronze" number="1" exp="0.5" chance="0.5" />
+     </output>
+  </recipe>
+
+  The 'exp' value ranges from 0-1. Some examples values from a vanilla furnace are:
+  gold=1
+  iron=0.7
+  food=0.35
+  sand/cobble/wood=0.1
+
+  Recipes can also be added using forge IMC messages. For example, in the init method of a mod:
+
+  String recipe =
+		  "<recipeGroup name=\"cheaty\" >" +
+		    "<recipe name=\"foo\" energyCost=\"2400\" >" +
+			  "<input>" +
+			    "<itemStack modID=\"minecraft\" itemName=\"dirt\" />" +
+			  "</input>" +
+			  "<output>" +
+			    "<itemStack modID=\"minecraft\" itemName=\"diamond\" />" +
+			  "</output>" +
+			"</recipe>" +
+		  "</recipeGroup>";
+		FMLInterModComms.sendMessage("EnderIO", "recipe:alloysmelter", recipe);
+
+ Item Information and data dumps:
+
+  To write all registered items to config/modObjectsRegistery.txt include:
+
+  <dumpRegistry modObjects="true" />
+
+  To write the contents of the ore dictionary to config/oreDictionaryRegistery.txt include:
+
+  <dumpRegistery oreDictionary="true" />
+
+  To show ore dictionary and/or registered names, in the EnderCore config set:
+
+  addRegistryNameTooltip=true
+  addOreDictionaryTooltips=true
+
+-->
+
+<AlloySmelterRecipes>
+
+  <recipeGroup name="EnderIO" > <!-- Required for EnderIO to function correctly. -->
+    <recipe name="Electrical Steel" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="iron_ingot" />
+        <itemStack oreDictionary="dustCoal" />
+        <itemStack oreDictionary="itemSilicon" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="0" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Energetic Alloy" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="redstone" />
+        <itemStack modID="minecraft" itemName="gold_ingot" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="1" exp="0.7" />
+      </output>
+    </recipe>
+    <recipe name="Vibrant Alloy" energyCost="10000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="1" /> <!-- Energetic Alloy -->
+        <itemStack modID="minecraft" itemName="ender_pearl" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="2" exp="1" />
+      </output>
+    </recipe>
+    <recipe name="Redstone Alloy" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="redstone" />
+        <itemStack modID="EnderIO" itemName="itemMaterial" itemMeta="0" /> <!-- Silicon -->
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="3" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Conductive Iron" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="redstone" />
+        <itemStack modID="minecraft" itemName="iron_ingot" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="4" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Pulsating Iron" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="iron_ingot" />
+        <itemStack modID="minecraft" itemName="ender_pearl" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="5" exp="0.7" />
+      </output>
+    </recipe>
+    <recipe name="Dark Steel" energyCost="20000" >
+      <input>
+        <itemStack modID="minecraft" itemName="iron_ingot" />
+        <itemStack oreDictionary="dustCoal" />
+        <itemStack modID="minecraft" itemName="obsidian" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="6" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Soularium" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="soul_sand" />
+        <itemStack modID="minecraft" itemName="gold_ingot" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" exp="0.7" />
+      </output>
+    </recipe>
+    <recipe name="Fused Quartz" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="0" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Fused Glass" energyCost="2500" >
+      <input>
+        <itemStack modID="minecraft" itemName="glass" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="1" exp="0.1" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz" number="4" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz 2" energyCost="5000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="0" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Glass" energyCost="2500" >
+      <input>
+        <itemStack oreDictionary="sand" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="3" exp="0.2" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Glass 2" energyCost="2500" >
+      <input>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="1" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="3" exp="0.2" />
+      </output>
+    </recipe>
+    <recipe name="Fused Quartz from Block" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz_block" number="1" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="0" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz from Block" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz_block" number="1" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz from Block 2" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz_block" number="1" />
+        <itemStack modID="minecraft" itemName="glowstone" number="1" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz from Block 3" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz" number="4" />
+        <itemStack modID="minecraft" itemName="glowstone" number="1" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Enlightened Fused Quartz from Block 4" energyCost="5000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="0" />
+        <itemStack modID="minecraft" itemName="glowstone" number="1" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="2" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Dark Fused Quartz" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz" number="4" />
+        <itemStack oreDictionary="dyeBlack" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="4" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Dark Fused Quartz from Block" energyCost="5000" >
+      <input>
+        <itemStack modID="minecraft" itemName="quartz_block" number="1" />
+        <itemStack oreDictionary="dyeBlack" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="4" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Dark Fused Quartz from Block 2" energyCost="5000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="0" />
+        <itemStack oreDictionary="dyeBlack" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="4" exp="0.5" />
+      </output>
+    </recipe>
+    <recipe name="Dark Fused Glass" energyCost="2500" >
+      <input>
+        <itemStack oreDictionary="sand" />
+        <itemStack oreDictionary="dyeBlack" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="5" exp="0.2" />
+      </output>
+    </recipe>
+    <recipe name="Dark Fused Glass 2" energyCost="2500" >
+      <input>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="1" />
+        <itemStack oreDictionary="dyeBlack" number="4" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockFusedQuartz" itemMeta="5" exp="0.2" />
+      </output>
+    </recipe>
+  </recipeGroup>
+
+  <recipeGroup name="Thermal Expansion" >
+    <recipe name="Electrum Ingot" energyCost="2000" >
+      <input>
+        <itemStack oreDictionary="ingotGold" />
+        <itemStack oreDictionary="ingotSilver" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotElectrum" number="2" exp="0.25" />
+      </output>
+    </recipe>
+    <recipe name="Invar Ingot" energyCost="3000" >
+      <input>
+        <itemStack oreDictionary="ingotNickel" />
+        <itemStack oreDictionary="ingotIron" number="2" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotInvar" number="3" exp="0.25" />
+      </output>
+    </recipe>
+    <recipe name="Hardened Glass" energyCost="4000" >
+      <input>
+        <itemStack oreDictionary="dustObsidian" number="4" />
+        <itemStack oreDictionary="ingotLead" />
+      </input>
+      <output>
+        <itemStack modID="ThermalExpansion" itemName="Glass" number="2" />
+      </output>
+    </recipe>
+    <recipe name="Bronze" energyCost="4000" >
+      <input>
+        <itemStack oreDictionary="ingotCopper" number="3" />
+        <itemStack oreDictionary="ingotTin" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotBronze" number="4" />
+      </output>
+    </recipe>
+    <recipe name="Enderium Base" energyCost="4000" >
+      <input>
+        <itemStack oreDictionary="ingotTin" number="2" />
+        <itemStack oreDictionary="ingotSilver" />
+        <itemStack oreDictionary="ingotPlatinum" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotEnderiumBase" number="4" />
+      </output>
+    </recipe>
+    <recipe name="Enderium" energyCost="50000" >
+      <input>
+        <itemStack oreDictionary="ingotEnderiumBase" number="2" />
+        <itemStack modID="ThermalFoundation" itemName="material" itemMeta="512" />
+        <itemStack modID="minecraft" itemName="ender_pearl" number="2" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotEnderium" number="2" />
+      </output>
+    </recipe>
+    <recipe name="Fluxed Electrum" energyCost="32000" >
+      <input>
+        <itemStack oreDictionary="ingotElectrum" number="2" />
+        <itemStack modID="minecraft" itemName="redstone" number="4" />
+        <itemStack modID="ThermalFoundation" itemName="material" itemMeta="512" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotElectrumFlux" number="2" />
+      </output>
+    </recipe>
+    <recipe name="Signalum" energyCost="32000" >
+      <input>
+        <itemStack oreDictionary="ingotCopper" number="3" />
+        <itemStack oreDictionary="ingotSilver" />
+        <itemStack modID="minecraft" itemName="redstone" number="10" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotSignalum" number="4" />
+      </output>
+    </recipe>
+    <recipe name="Lumium from dust" energyCost="32000" >
+      <input>
+        <itemStack oreDictionary="ingotTin" number="3" />
+        <itemStack oreDictionary="ingotSilver" />
+        <itemStack modID="minecraft" itemName="glowstone_dust" number="4" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotLumium" number="4" />
+      </output>
+    </recipe>
+    <recipe name="Lumium" energyCost="32000" >
+      <input>
+        <itemStack oreDictionary="ingotTin" number="3" />
+        <itemStack oreDictionary="ingotSilver" />
+        <itemStack modID="minecraft" itemName="glowstone" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotLumium" number="4" />
+      </output>
+    </recipe>
+  </recipeGroup>
+
+  <vanillaFurnaceRecipes enabled="true" />
+
+</AlloySmelterRecipes>
+
+<!-- This is an optional Steel Recipe, append one or both of these to a group in the 'AlloySmelterRecipes_User.xml'
+
+    <recipe name="Steel" energyCost="8000" >
+      <input>
+        <itemStack oreDictionary="ingotIron" number="1" />
+        <itemStack oreDictionary="dustCoal" number="2" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotSteel" number="1" />
+      </output>
+    </recipe>
+
+    <recipe name="Steel - Charcoal" energyCost="8000" >
+      <input>
+        <itemStack oreDictionary="ingotIron" number="1" />
+        <itemStack modID="minecraft" itemName="coal" itemMeta="1" number="4" />
+      </input>
+      <output>
+        <itemStack oreDictionary="ingotSteel" number="1" />
+      </output>
+    </recipe>
+
+-->

src/config/enderio/AlloySmelterRecipes_User.xml

@@ -0,0 +1,31 @@
+<!--
+  Custom recipes that will not be over written by Ender IO are added here. Examples of recipes can be found in the
+  AlloySmelterRecipes_Core.xml and general format documentation in the SAGMillRecipes_Core/User.
+
+  As well as adding custom recipes to the operation of the Alloy Smelter, a vanilla furnace recipe can be controlled.
+  It can be disabled completely by simply adding this line:
+
+  <vanillaFurnaceRecipes enabled="false" />
+
+  It is also possible to selectively disable vanilla furnace recipes. The following example disables the smelting of iron
+  ingots, ender pearls, and any form of iron ore registered in the ore dictionary.
+
+  <vanillaFurnaceRecipes>
+
+	<exclude>
+      <itemStack modID="minecraft" itemName="iron_ingot" />
+      <itemStack modID="minecraft" itemName="ender_pearl" />
+      <itemStack oreDictionary="oreIron" />
+    </exclude>
+
+  </vanillaFurnaceRecipes>
+
+  Add this line to disable the creation of TE alloys using the Alloy Smelter.
+
+  <recipeGroup name="Thermal Expansion" enabled="false" />
+
+-->
+
+<AlloySmelterRecipes>
+
+</AlloySmelterRecipes>

src/config/enderio/EnchanterRecipes_Core.xml

@@ -0,0 +1,103 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify recipes please use 'EnchanterRecipes_User.xml'.
+
+ Costs are calculated as follows:
+
+  level = enchantmentItem.stackSize
+  levelCost = Config.enchanterBaseLevelCost;
+  for (int i = 0; i < level; i++) {
+    levelCost += costPerLevel * level;
+  }
+
+-->
+
+<enchaterRecipes>
+
+  <enchantment name="minecraft:protection" >
+    <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="6" number="16" />
+  </enchantment>
+  <enchantment name="minecraft:fire_protection" >
+    <itemStack modID="minecraft" itemName="blaze_powder" number="16" />
+  </enchantment>
+  <enchantment name="minecraft:feather_falling" >
+    <itemStack modID="minecraft" itemName="feather" />
+  </enchantment>
+  <enchantment name="minecraft:blast_protection" >
+    <itemStack modID="minecraft" itemName="gunpowder" number="16" />
+  </enchantment>
+  <enchantment name="minecraft:projectile_protection" >
+    <itemStack modID="minecraft" itemName="arrow" number="16" />
+  </enchantment>
+  <enchantment name="minecraft:respiration"  >
+    <itemStack modID="minecraft" itemName="glass_bottle" />
+  </enchantment>
+  <enchantment name="minecraft:aqua_affinity" >
+    <itemStack modID="minecraft" itemName="waterlily" />
+  </enchantment>
+  <enchantment name="minecraft:depth_strider"  >
+    <itemStack modID="minecraft" itemName="prismarine" itemMeta="0" />
+  </enchantment>
+  <enchantment name="minecraft:frost_walker"  >
+    <itemStack modID="minecraft" itemName="ice" number="16"/>
+  </enchantment>
+  <enchantment name="minecraft:thorns"  >
+    <itemStack modID="minecraft" itemName="double_plant" itemMeta="4" />
+  </enchantment>
+  <enchantment name="minecraft:sharpness" >
+    <itemStack modID="minecraft" itemName="quartz" number="12" />
+  </enchantment>
+  <enchantment name="minecraft:smite" >
+    <itemStack modID="minecraft" itemName="rotten_flesh" number="12" />
+  </enchantment>
+  <enchantment name="minecraft:bane_of_arthropods" >
+    <itemStack modID="minecraft" itemName="spider_eye" number="12" />
+  </enchantment>
+  <enchantment name="minecraft:knockback" >
+    <itemStack modID="minecraft" itemName="piston" />
+  </enchantment>
+  <enchantment name="minecraft:fire_aspect" >
+    <itemStack modID="minecraft" itemName="blaze_rod" number="8" />
+  </enchantment>
+  <enchantment name="minecraft:looting" >
+    <itemStack oreDictionary="itemSkull" />
+  </enchantment>
+  <enchantment name="minecraft:efficiency" >
+    <itemStack modID="minecraft" itemName="redstone" number="12" />
+  </enchantment>
+  <enchantment name="minecraft:silk_touch" >
+    <itemStack modID="minecraft" itemName="slime_ball" />
+  </enchantment>
+  <enchantment name="minecraft:unbreaking" >
+    <itemStack modID="minecraft" itemName="obsidian" />
+  </enchantment>
+  <enchantment name="minecraft:mending">
+    <itemStack modID="EnderIO" itemName="itemXpTransfer"/>
+  </enchantment>
+  <enchantment name="minecraft:fortune" >
+    <itemStack modID="minecraft" itemName="emerald" />
+  </enchantment>
+  <enchantment name="minecraft:power" >
+    <itemStack modID="minecraft" itemName="flint" number="12" />
+  </enchantment>
+  <enchantment name="minecraft:punch" >
+    <itemStack modID="minecraft" itemName="string" />
+  </enchantment>
+  <enchantment name="minecraft:flame" >
+    <itemStack modID="minecraft" itemName="netherrack" />
+  </enchantment>
+  <enchantment name="minecraft:infinity" >
+    <itemStack modID="minecraft" itemName="ender_pearl" />
+  </enchantment>
+  <enchantment name="minecraft:luck_of_the_sea"  >
+    <itemStack modID="minecraft" itemName="dye" itemMeta="4" />
+  </enchantment>
+  <enchantment name="minecraft:lure" >
+    <itemStack modID="minecraft" itemName="fish" />
+  </enchantment>
+  <enchantment name="EnderIO:soulBound" >
+    <itemStack modID="EnderIO" itemName="itemMaterial" itemMeta="8" />
+  </enchantment>
+
+</enchaterRecipes>

src/config/enderio/EnchanterRecipes_User.xml

@@ -0,0 +1,27 @@
+<!-- An example of how to add the enchantments from Thaumcraft.
+
+  <enchantment name="Thaumcraft:potency" costPerLevel="5" >
+    <itemStack modID="Thaumcraft" itemName="ItemShard" itemMeta="1" />
+  </enchantment>
+
+  <enchantment name="Thaumcraft:frugal" costPerLevel="5" >
+    <itemStack modID="Thaumcraft" itemName="ItemShard" itemMeta="4" />
+  </enchantment>
+
+  <enchantment name="Thaumcraft:wandfortune" costPerLevel="5" >
+    <itemStack modID="Thaumcraft" itemName="blockCustomPlant" itemMeta="1" />
+  </enchantment>
+
+  <enchantment name="Thaumcraft:haste" costPerLevel="5" >
+    <itemStack modID="Thaumcraft" itemName="blockMetalDevice" itemMeta="8" />
+  </enchantment>
+
+  <enchantment name="Thaumcraft:repair" costPerLevel="15" >
+    <itemStack modID="Thaumcraft" itemName="BlockJarNodeItem" />
+  </enchantment>
+
+-->
+
+<enchaterRecipes>
+
+</enchaterRecipes>

src/config/enderio/OreDictionaryPreferences_Core.xml

@@ -0,0 +1,105 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify recipes please use 'OreDictionaryPreferences_User.xml'.
+
+  This file contains the preferred outputs from Ender IO machines for items registered in the OreDictionary. Details of
+  itemStack definition can be found in 'SAGMillRecipes_Core.xml'.
+
+ Item Information and data dumps:
+
+  To write all registered items to config/modObjectsRegistery.txt include:
+
+  <dumpRegistry modObjects="true" />
+
+  To write the contents of the ore dictionary to config/oreDictionaryRegistery.txt include:
+
+  <dumpRegistery oreDictionary="true" />
+
+  To show ore dictionary and/or registered names, in the EnderCore config set:
+
+  addRegistryNameTooltip=true
+  addOreDictionaryTooltips=true
+
+-->
+
+<OreDictionaryPreferences>
+
+  <!-- Vanilla -->
+  <preference oreDictionary="sand" >
+    <itemStack modID="minecraft" itemName="sand" itemMeta="0" />
+  </preference>
+
+  <!-- Dusts -->
+  <preference oreDictionary="dustCoal" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="2" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="0" />
+  </preference>
+  <preference oreDictionary="dustCharcoal" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="3" />
+  </preference>
+  <preference oreDictionary="dustObsidian" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="4" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="7" />
+  </preference>
+  <preference oreDictionary="dustIron" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="0" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="1" />
+  </preference>
+  <preference oreDictionary="dustGold" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="1" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="2" />
+  </preference>
+  <preference oreDictionary="dustCopper" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="32" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="3" />
+  </preference>
+  <preference oreDictionary="dustTin" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="33" />
+    <itemStack modID="EnderIO" itemName="itemPowderIngot" itemMeta="4" />
+  </preference>
+  <preference oreDictionary="dustSilver" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="34" />
+  </preference>
+  <preference oreDictionary="dustLead" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="35" />
+  </preference>
+  <preference oreDictionary="dustNickel" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="36" />
+  </preference>
+  <preference oreDictionary="dustSulfur" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="16" />
+  </preference>
+  <preference oreDictionary="dustBronze" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="41" />
+  </preference>
+  <preference oreDictionary="dustNetherQuartz" >
+    <itemStack modID="appliedenergistics2" itemName="item.itemMultiMaterial" itemMeta="3" />
+  </preference>
+  <!-- Ingots -->
+  <preference oreDictionary="ingotCopper" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="64" />
+    <itemStack modID="TConstruct" itemName="materials" itemMeta="9" />
+  </preference>
+  <preference oreDictionary="ingotTin" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="65" />
+    <itemStack modID="TConstruct" itemName="materials" itemMeta="10" />
+  </preference>
+  <preference oreDictionary="ingotSilver" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="66" />
+  </preference>
+  <preference oreDictionary="ingotLead" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="67" />
+  </preference>
+  <preference oreDictionary="ingotBronze" >
+    <itemStack modID="ThermalFoundation" itemName="material" itemMeta="73" />
+    <itemStack modID="TConstruct" itemName="materials" itemMeta="13" />
+  </preference>
+  <preference oreDictionary="ingotAluminum" >
+    <itemStack modID="TConstruct" itemName="materials" itemMeta="11" />
+  </preference>
+  <preference oreDictionary="ingotAluminium" >
+    <itemStack modID="TConstruct" itemName="materials" itemMeta="11" />
+  </preference>
+
+</OreDictionaryPreferences>

src/config/enderio/OreDictionaryPreferences_User.xml

@@ -0,0 +1,7 @@
+<!--
+Entries in this file take precedence over the values in the core file
+-->
+
+<OreDictionaryPreferences>
+
+</OreDictionaryPreferences>

src/config/enderio/PainterPaintSources_Core.xml

@@ -0,0 +1,36 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify sources please use 'PainterPaintSources_User.xml'.
+
+  This file is used to create a white list and black list for items that can be used as paint sources in the painting
+  machine. Each entry in the lists describes an item stack. This stack must be for a block item (i.e. and item that can
+  be placed in the world as a block). If an item is is not in either list then the default checks are used. For details
+  on the format of item stack definitions see SAGMillRecipes_Core.xml.
+
+  The contents of this file will be merged with the contents of 'PainterPaintSources_User.xml'. To remove an entry
+  contained in this file simply include an identical entry in the user file with the added attribute 'remove=true'. For
+  example, to remove Silverwood planks from the whitelist, the user file would contain this:
+
+  <PainterPaintSources>
+    <whitelist>
+      <itemStack modID="Thaumcraft" itemName="blockWoodenDevice" itemMeta="6" remove="true" />
+    </whitelist>
+  </PainterPaintSources>
+
+-->
+
+<PainterPaintSources>
+
+  <whitelist>
+    <!-- Greatwood planks -->
+    <itemStack modID="Thaumcraft" itemName="blockWoodenDevice" itemMeta="6" />
+    <!-- Silverwood planks -->
+    <itemStack modID="Thaumcraft" itemName="blockWoodenDevice" itemMeta="7" />
+  </whitelist>
+
+  <blacklist>
+
+  </blacklist>
+
+</PainterPaintSources>

src/config/enderio/PainterPaintSources_User.xml

@@ -0,0 +1,15 @@
+<!--
+See PainterPaintSources_Core.xml for documentation.
+-->
+
+<PainterPaintSources>
+
+  <whitelist>
+
+  </whitelist>
+
+  <blacklist>
+
+  </blacklist>
+
+</PainterPaintSources>

src/config/enderio/PoweredSpawnerConfig_Core.json

@@ -0,0 +1,50 @@
+{
+
+  // This is the CORE FILE. Do not edit. The RF cost per tick for spawners of each entity type is multiplied by these values
+  "costMultiplier": {
+
+    "Zombie" : "1",
+    "Creeper" : "1.5",
+    "Skeleton" : "2",
+    "Spider" : "1",
+    "CaveSpider" : "1",
+    "Silverfish" : "1",
+    "Witch" : "5",
+    "Slime" : "5",
+    "Enderman" : "10",
+    "SpecialMobs.SpecialEnderman" : "10",
+
+    "LavaSlime" : "2",
+    "PigZombie" : "5",
+    "Ghast" : "10",
+    "Blaze" : "5",
+
+    "SnowMan" : "1",
+    "VillagerGolem" : "10",
+    "Villager" : "1",
+
+    "Wolf" : "1",
+    "Ozelot" : "1",
+    "EntityHorse" : "1",
+    "Bat" : "0.5",
+
+    "Squid" : "0.5",
+    "Chicken" : "0.5",
+    "Sheep" : "0.5",
+    "Cow" : "0.5",
+    "Pig" : "0.5",
+    "MushroomCow" : "1",
+
+    "enderzoo.Enderminy" : "10",
+    "enderzoo.ConcussionCreeper" : "1.5",
+    "enderzoo.enderzoo.FallenKnight" : "1",
+    "enderzoo.WitherWitch" : "3",
+
+    "enderio.witherSkeleton" : "20"
+  },
+
+  "blackList": [
+    "VillagerGolem",
+    "Villager"
+  ]
+}

src/config/enderio/PoweredSpawnerConfig_User.json

@@ -0,0 +1,9 @@
+{
+
+  // New entities are added, one already in _Core will have their values replaced with those in this file
+  "costMultiplier": {
+  }
+
+  // Adding a blackList section will completely replace the one in the core file.
+
+}

src/config/enderio/SAGMillRecipes_User.xml

@@ -0,0 +1,101 @@
+<!--
+  Custom recipes that will not be over written by Ender IO are added here.
+
+  To change an existing recipe, just add the recipe to this file using the same recipe group and recipe name as found in
+  the core file.
+
+  Adding new Recipes:
+  For more details of how to add a new recipe please see the documentation at the top of SAGMillRecipes_Core.xml.
+
+  Adding a new recipe to a new group:
+
+  <recipeGroup name="CrazyPantsGroup" >
+    <recipe name="SolarToGlass" energyCost="120" >
+        <input>
+          <itemStack modID="EnderIO" itemName="enderIO:blockSolarPanel" />
+        </input>
+        <output>
+          <itemStack modID="minecraft" itemName="glass" />
+        </output>
+      </recipe>
+  </recipeGroup>
+
+  Removing Recipes:
+  To disable all recipes within a group, in this example Forestry, include the following in this file:
+
+  <recipeGroup name="Forestry" enabled="false" />
+
+  Disable all recipes in the group 'Vanilla':
+
+  <recipeGroup name="Vanilla" enabled="false" />
+
+  To disable individual recipes, simply provide an invalid recipe for them:
+
+  <recipeGroup name="Applied Energistics" >
+    <recipe name="CertusQuartzOre" />
+  </recipeGroup>
+
+  Disable the glass recipes in the group 'Vanilla':
+
+  <recipeGroup name="Vanilla" >
+    <recipe name="Glass" />
+  </recipeGroup>
+
+  Modifying Recipes:
+  Modify a core recipe definition, in this case, make glass give diamonds:
+
+  <recipeGroup name="Vanilla" >
+    <recipe name="Glass" energyCost="120" >
+        <input>
+          <itemStack modID="minecraft" itemName="glass" />
+        </input>
+        <output>
+          <itemStack modID="minecraft" itemName="diamond" />
+        </output>
+      </recipe>
+  </recipeGroup>
+
+  Add this block to change the default TE obsidian -> dust recipe to the railcraft recipe.
+
+  <recipeGroup name="Thermal Expansion" >
+    <recipe name="Obsidian" energyCost="400" >
+      <input>
+        <itemStack modID="minecraft" itemName="obsidian" />
+      </input>
+      <output>
+        <itemStack modID="Railcraft" itemName="tile.railcraft.cube" itemMeta="4" number="1" />
+        <itemStack oreDictionary="dustObsidian" number="1" chance="0.15" />
+        <itemStack oreDictionary="dustObsidian" number="1" chance="0.025" />
+      </output>
+    </recipe>
+  </recipeGroup>
+
+  Grinding Balls:
+  Adding a new grinding ball:
+
+  <grindingBalls>
+    <grindingBall id="Diamond" grindingMultiplier="1.5" chanceMultiplier="2" powerMultiplier="0.5" durationRF="50000" >
+      <itemStack modID="minecraft" itemName="diamond" />
+    </grindingBall>
+  </grindingBalls>
+
+  Removing an existing grinding ball:
+
+  <grindingBalls>
+    <grindingBall id="Flint" remove="true" />
+  </grindingBalls>
+
+  Modifying the excludes list: (removing glowstone, adding sand)
+
+  <grindingBalls>
+    <excludes>
+      <itemStack modID="minecraft" itemName="glowstone" remove="true" />
+      <itemStack modID="minecraft" itemName="sand" />
+    </excludes>
+  </grindingBalls>
+
+-->
+
+<SAGMillRecipes>
+
+</SAGMillRecipes>

src/config/enderio/SliceAndSpliceRecipes_Core.xml

@@ -0,0 +1,80 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify recipes please use 'SliceAndSpliceRecipes_User.xml'. Recipes
+  are organized into named groups. A group of recipes can be disabled by setting the attribute 'enabled=false'. A
+  recipe group is composed of one or more recipes.
+
+-->
+
+<SliceAndSpliceRecipes>
+
+  <recipeGroup name="EnderIO" >
+    <recipe name="Electrode Skull" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="1" slot="0" />
+        <itemStack modID="minecraft" itemName="skull" itemMeta="2" slot="1" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="1" slot="2" />
+        <itemStack oreDictionary="itemSilicon" slot="3" />
+        <itemStack modID="EnderIO" itemName="itemBasicCapacitor" itemMeta="0" slot="4" />
+        <itemStack oreDictionary="itemSilicon" slot="5" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemFrankenSkull" itemMeta="0" />
+      </output>
+    </recipe>
+    <recipe name="Controller Skull" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="0" />
+        <itemStack modID="minecraft" itemName="skull" itemMeta="2" slot="1" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="2" />
+        <itemStack oreDictionary="itemSilicon" slot="3" />
+        <itemStack modID="minecraft" itemName="redstone" slot="4" />
+        <itemStack oreDictionary="itemSilicon" slot="5" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemFrankenSkull" itemMeta="1" />
+      </output>
+    </recipe>
+    <recipe name="Tormented Enderman Head" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="0" />
+        <itemStack modID="EnderIO" itemName="blockEndermanSkull" itemMeta="0" slot="1" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="2" />
+        <itemStack modID="minecraft" itemName="potion" slot="3" />
+        <itemStack modID="EnderIO" itemName="itemBasicCapacitor" itemMeta="0" slot="4" />
+        <itemStack modID="minecraft" itemName="potion" slot="5" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="blockEndermanSkull" itemMeta="2" />
+      </output>
+    </recipe>
+    <recipe name="Ender Resonator" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="0" />
+        <itemStack modID="EnderIO" itemName="blockEndermanSkull" itemMeta="0" slot="1" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="2" />
+        <itemStack oreDictionary="itemSilicon" slot="3" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="2" slot="4" />
+        <itemStack oreDictionary="itemSilicon" slot="5" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemFrankenSkull" itemMeta="3" />
+      </output>
+    </recipe>
+     <recipe name="Skeletal Contractor" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="0" />
+        <itemStack modID="minecraft" itemName="skull" itemMeta="0" slot="1" />
+        <itemStack modID="EnderIO" itemName="itemAlloy" itemMeta="7" slot="2" />
+        <itemStack modID="minecraft" itemName="rotten_flesh" slot="3" />
+        <itemStack oreDictionary="itemSilicon" slot="4" />        
+        <itemStack modID="minecraft" itemName="rotten_flesh" slot="5" />
+      </input>
+      <output>
+        <itemStack modID="EnderIO" itemName="itemFrankenSkull" itemMeta="5" />
+      </output>
+    </recipe>
+  </recipeGroup>
+
+</SliceAndSpliceRecipes>

src/config/enderio/SliceAndSpliceRecipes_User.xml

@@ -0,0 +1,3 @@
+<SliceAndSpliceRecipes>
+
+</SliceAndSpliceRecipes>

src/config/enderio/VatRecipes_Core.xml

@@ -0,0 +1,153 @@
+<!--
+ IMPORTANT:
+  This is the core recipe file. Modifying this file will have no effect. It will be rewritten by EnderIO and all
+  modifications made to it will be lost. To add or modify recipes please use 'VatRecipes_User.xml'. Recipes
+  are organized into named groups. A group of recipes can be disabled by setting the attribute 'enabled=false'. A
+  recipe group is composed of one or more recipes.
+
+  Vat recipes take two item inputs and one fluid input, and output a fluid.
+  The various values are calulcated like this:
+
+  For:
+  ingredient multiplier (IM) = slot0.multiplier * slot1.multiplier;
+
+  input fluid volume (mb) = IM * 1000
+
+  Produce:
+  output fluid volume (mb) = IM * inputFluid.multiplier * 1000.
+
+  The vat always uses 1 RF per tick, so energy cost also equates to duration.
+
+  Recipes can also be added using forge IMC messages. For example, in the init method of a mod:
+  String recipe =
+         "<recipeGroup name=\"cheaty\" >" +
+           "<recipe name=\"foo\" energyCost=\"2400\" >" +
+             "<input>" +
+              "<itemStack modID=\"minecraft\" itemName=\"dirt\" slot=\"0\" />" +
+              "<fluidStack name=\"water\" multiplier=\"1\" />" +
+             "</input>" +
+             "<output>" +
+               "<fluidStack name=\"lava\" />" +
+             "</output>" +
+            "</recipe>" +
+          "</recipeGroup>";
+  FMLInterModComms.sendMessage("EnderIO", "recipe:vat", recipe);
+
+-->
+
+<VatRecipes>
+
+  <recipeGroup name="EnderIO" > <!-- Required for EnderIO to function correctly. -->
+    <recipe name="Nutrient Distilation" energyCost="10000" allowMissing="true">
+      <input>
+        <itemStack modID="Thaumcraft" itemName="ItemZombieBrain" slot="0" multiplier="2" />
+        <itemStack oreDictionary="itemSkull" slot="0" multiplier="2" />
+        <itemStack modID="minecraft" itemName="rotten_flesh" slot="0" multiplier="1.5" />
+        <itemStack modID="minecraft" itemName="chicken" slot="0" multiplier="0.75" />
+        <itemStack modID="minecraft" itemName="beef" slot="0" multiplier="0.75" />
+        <itemStack modID="minecraft" itemName="porkchop" slot="0" multiplier="0.75" />
+        <itemStack modID="minecraft" itemName="sugar" slot="1" multiplier="1" />
+        <itemStack modID="minecraft" itemName="brown_mushroom" slot="1" multiplier="1.5" />
+        <itemStack modID="minecraft" itemName="red_mushroom" slot="1" multiplier="1.5" />
+        <itemStack modID="minecraft" itemName="nether_wart" slot="1" multiplier="1.5" />
+        <itemStack modID="minecraft" itemName="fermented_spider_eye" slot="1" multiplier="2" />
+        <fluidStack name="water" multiplier="0.25" />
+      </input>
+      <output>
+        <fluidStack name="nutrient_distillation" />
+      </output>
+    </recipe>        
+    <recipe name="EnderDistillation" energyCost="15000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemMaterial" number="1" itemMeta="12" slot="0" multiplier="2"/>
+        <itemStack modID="EnderIO" itemName="itemMaterial" number="1" itemMeta="13" slot="1" multiplier="2"/>
+        <fluidStack name="nutrient_distillation" multiplier="0.25" />
+      </input>
+      <output>
+        <fluidStack name="ender_distillation" />
+      </output>
+    </recipe>         
+    <recipe name="Vapor of Levity" energyCost="20000" >
+      <input>
+        <itemStack modID="EnderIO" itemName="itemMaterial" number="1" itemMeta="12" slot="0" multiplier="1"/>
+        <itemStack modID="EnderIO" itemName="itemMaterial" number="1" itemMeta="16" slot="1" multiplier="1"/>
+        <fluidStack name="ender_distillation" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="vapor_of_levity" />
+      </output>
+    </recipe>           
+    <recipe name="Hootch" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="poisonous_potato" slot="0" multiplier="8" />
+        <itemStack modID="minecraft" itemName="potato" slot="0" multiplier="4" />
+        <itemStack modID="minecraft" itemName="apple" slot="0" multiplier="3.5" />
+        <itemStack modID="minecraft" itemName="wheat" slot="0" multiplier="3" />
+        <itemStack modID="minecraft" itemName="wheat_seeds" slot="0" multiplier="2" />
+        <itemStack modID="minecraft" itemName="sugar" slot="1" multiplier="1" />
+        <fluidStack name="water" multiplier="0.25" />
+      </input>
+      <output>
+        <fluidStack name="hootch" />
+      </output>
+    </recipe>
+    <recipe name="Rocket Fuel" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="gunpowder" slot="0" multiplier="1" />
+        <itemStack modID="minecraft" itemName="redstone" slot="1" multiplier="1" />
+        <fluidStack name="hootch" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="rocket_fuel" />
+      </output>
+    </recipe>
+    <recipe name="Fire Water" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="blaze_powder" slot="0" multiplier="1" />
+        <itemStack modID="minecraft" itemName="redstone" slot="1" multiplier="1" />
+        <fluidStack name="hootch" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="fire_water" />
+      </output>
+    </recipe>
+    <recipe name="Liquid Sunshine" energyCost="10000" >
+      <input>
+        <itemStack modID="minecraft" itemName="glowstone_dust" slot="0" multiplier="0.25" />
+        <itemStack modID="minecraft" itemName="glowstone" slot="0" multiplier="1" />
+        <itemStack modID="minecraft" itemName="double_plant" itemMeta="0" slot="1" multiplier="1" />
+        <fluidStack name="fire_water" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="liquid_sunshine" />
+      </output>
+    </recipe>
+    <recipe name="Cloud Seed" energyCost="10000" allowMissing="true" >
+      <input>
+        <itemStack oreDictionary="dustSalt" slot="0" multiplier="1" />
+        <itemStack oreDictionary="itemClay" slot="0" multiplier="0.5" />
+        <itemStack modID="minecraft" itemName="clay" slot="0" multiplier="2" />
+        <itemStack modID="minecraft" itemName="snowball" slot="1" multiplier="0.1" />
+        <itemStack modID="minecraft" itemName="snow" slot="1" multiplier="0.5" />
+        <itemStack oreDictionary="ice" slot="1" multiplier="0.5" />
+        <itemStack modID="minecraft" itemName="packed_ice" itemMeta="0" slot="1" multiplier="1" />
+        <fluidStack name="water" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="cloud_seed" />
+      </output>
+    </recipe>
+    <recipe name="Concentrated Cloud Seed" energyCost="20000" allowMissing="true" >
+      <input>
+        <itemStack oreDictionary="dustSalt" slot="0" multiplier="1" />
+        <itemStack oreDictionary="itemClay" slot="0" multiplier="0.5" />
+        <itemStack modID="minecraft" itemName="clay" slot="0" multiplier="2" />
+        <fluidStack name="cloud_seed" multiplier="1" />
+      </input>
+      <output>
+        <fluidStack name="cloud_seed_concentrated" />
+      </output>
+    </recipe>
+  </recipeGroup>
+
+</VatRecipes>

src/config/enderio/VatRecipes_User.xml

@@ -0,0 +1,3 @@
+<VatRecipes>
+
+</VatRecipes>

src/config/enderio/recipe_aliases_core.xml

@@ -0,0 +1,114 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+<!-- 
+
+These are the build-in aliases. You cannot change this file, it is a
+reference for you only and will be generated every time the game starts.
+
+To make changes to the aliases, copy the aliases you want to change to
+the matching _user.xml.
+
+Item specifications can reference an alias, an ore dictionary name, a
+block or an item. You can force the type by prefixing the value with
+"oredict:", "block:" or "item:".
+
+More information on the syntax can be found in the recipes.xsd file. An
+XML editor will display that as tooltips when editing this file.
+
+ -->
+
+  <alias name="ZOMBIE_ELECTRODE" item="enderio:itemFrankenSkull:0" />
+  <alias name="ZOMBIE_CONTROLLER" item="enderio:itemFrankenSkull:1" />
+  <alias name="FRANKEN_ZOMBIE" item="enderio:itemFrankenSkull:2" />
+  <alias name="ENDER_RESONATOR" item="enderio:itemFrankenSkull:3" />
+  <alias name="SENTIENT_ENDER" item="enderio:itemFrankenSkull:4" />
+  <alias name="SKELETAL_CONTRACTOR" item="enderio:itemFrankenSkull:5" />
+
+  <alias name="CAPACITOR1" item="enderio:itemBasicCapacitor:0" />
+  <alias name="CAPACITOR2" item="enderio:itemBasicCapacitor:1" />
+  <alias name="CAPACITOR3" item="enderio:itemBasicCapacitor:2" />
+  
+  <alias name="GEAR" item="gearStone" />
+  <alias name="CHASSIS" item="itemMachineChassi" />
+  
+  <alias name="FUSED_QUARTZ" item="oredict:fusedQuartz" />
+  <alias name="FUSED_GLASS" item="oredict:fusedGlass" />
+  <alias name="ENLIGHTED_QUARTZ" item="oredict:enlightenedFusedQuartz" />
+  <alias name="ENLIGHTED_GLASS" item="oredict:enlightenedFusedGlass" />
+  <alias name="DARK_QUARTZ" item="oredict:darkFusedQuartz" />
+  <alias name="DARK_GLASS" item="oredict:darkFusedGlass" />
+
+  <alias name="ELECTRICAL_STEEL" item="ingotElectricalSteel" />
+  <alias name="ENERGETIC_ALLOY" item="ingotEnergeticAlloy" />
+  <alias name="VIBRANT_ALLOY" item="ingotVibrantAlloy" />
+  <alias name="REDSTONE_ALLOY" item="ingotRedstoneAlloy" />
+  <alias name="CONDUCTIVE_IRON" item="ingotConductiveIron" />
+  <alias name="PULSATING_IRON" item="ingotPulsatingIron" />
+  <alias name="DARK_STEEL" item="ingotDarkSteel" />
+  <alias name="SOULARIUM" item="ingotSoularium" />
+
+  <alias name="ELECTRICAL_STEEL_BLOCK" item="blockElectricalSteel" />
+  <alias name="ENERGETIC_ALLOY_BLOCK" item="blockEnergeticAlloy" />
+  <alias name="VIBRANT_ALLOY_BLOCK" item="blockVibrantAlloy" />
+  <alias name="REDSTONE_ALLOY_BLOCK" item="blockRedstoneAlloy" />
+  <alias name="CONDUCTIVE_IRON_BLOCK" item="blockConductiveIron" />
+  <alias name="PULSATING_IRON_BLOCK" item="blockPulsatingIron" />
+  <alias name="DARK_STEEL_BLOCK" item="blockDarkSteel" />
+  <alias name="SOULARIUM_BLOCK" item="blockSoularium" />
+
+  <alias name="SILICON" item="itemSilicon" />
+  <alias name="CONDUIT_BINDER" item="itemConduitBinder" />
+  <alias name="BINDER_COMPOSITE" item="itemBinderComposite" />
+  <alias name="PULSATING_IRON_NUGGET" item="itemPulsatingIronNugget" />
+  <alias name="VIBRANT_NUGGET" item="itemVibrantNugget" />
+  <alias name="PULSATING_CRYSTAL" item="itemPulsatingCrystal" />
+  <alias name="VIBRANT_CRYSTAL" item="itemVibrantCrystal" />
+  <alias name="DARK_GRINDING_BALL" item="itemDarkGrindingBall" />
+  <alias name="ENDER_CRYSTAL" item="itemEnderCrystal" />
+  <alias name="ATTRACTOR_CRYSTAL" item="itemAttractorCrystal" />
+  <alias name="WEATHER_CRYSTAL" item="itemWeatherCrystal" />
+  <alias name="NUTRITIOUS_STICK" item="itemNutritiousStick" />
+  <alias name="CHASSIPARTS" item="itemChassiParts" />
+
+  <alias name="CAP_BANK_1" item="enderio:blockCapBank:1" />
+  <alias name="CAP_BANK_2" item="enderio:blockCapBank:2" />
+  <alias name="CAP_BANK_3" item="enderio:blockCapBank:3" />
+
+  <alias name="SOLAR_1" item="enderio:blockSolarPanel:0" />
+  <alias name="SOLAR_2" item="enderio:blockSolarPanel:1" />
+  <alias name="SOLAR_3" item="enderio:blockSolarPanel:2" />
+
+  <alias name="CONDUIT_PROBE" item="enderio:itemConduitProbe:0" />
+
+  <alias name="HEAD_ENDERMAN" item="enderio:blockEndermanSkull:0" />
+  <alias name="HEAD_SKELETON" item="minecraft:skull:0" />
+  <alias name="HEAD_CREEPER" item="minecraft:skull:2" />
+  <alias name="HEAD_ZOMBIE" item="minecraft:skull:4" />
+
+  <alias name="HEAD_ENDERMAN_TORMENTED" item="enderio:blockEndermanSkull:2" />
+
+  <alias name="LIGHT_ELECTRIC" item="enderio:blockElectricLight:0" />
+  <alias name="LIGHT_ELECTRIC_INV" item="enderio:blockElectricLight:1" />
+  <alias name="LIGHT_BASIC" item="enderio:blockElectricLight:2" />
+  <alias name="LIGHT_BASIC_INV" item="enderio:blockElectricLight:3" />
+  <alias name="LIGHT_WIRELESS" item="enderio:blockElectricLight:4" />
+  <alias name="LIGHT_WIRELESS_INV" item="enderio:blockElectricLight:5" />
+
+  <alias name="PPP_WOOD" item="enderio:blockPaintedPressurePlate:0" />
+  <alias name="PPP_STONE" item="enderio:blockPaintedPressurePlate:2" />
+  <alias name="PPP_IRON" item="enderio:blockPaintedPressurePlate:4" />
+  <alias name="PPP_GOLD" item="enderio:blockPaintedPressurePlate:6" />
+  <alias name="PPP_DARK_STEEL" item="enderio:blockPaintedPressurePlate:8" />
+  <alias name="PPP_SOULARIUM" item="enderio:blockPaintedPressurePlate:10" />
+  <alias name="PPP_TUNED" item="enderio:blockPaintedPressurePlate:12" />
+
+  <alias name="PPP_WOOD_SILENT" item="enderio:blockPaintedPressurePlate:1" />
+  <alias name="PPP_STONE_SILENT" item="enderio:blockPaintedPressurePlate:3" />
+  <alias name="PPP_IRON_SILENT" item="enderio:blockPaintedPressurePlate:5" />
+  <alias name="PPP_GOLD_SILENT" item="enderio:blockPaintedPressurePlate:7" />
+  <alias name="PPP_DARK_STEEL_SILENT" item="enderio:blockPaintedPressurePlate:9" />
+  <alias name="PPP_SOULARIUM_SILENT" item="enderio:blockPaintedPressurePlate:11" />
+  <alias name="PPP_TUNED_SILENT" item="enderio:blockPaintedPressurePlate:13" />
+
+</enderio:recipes>

src/config/enderio/recipe_aliases_user.xml

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+</enderio:recipes>

src/config/enderio/recipe_items_core.xml

@@ -0,0 +1,824 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+<!-- 
+
+These are the build-in recipes. You cannot change this file, it is a
+reference for you only and will be generated every time the game starts.
+
+To make changes to the recipes, copy the recipes you want to change to
+the matching _user.xml. To disabled a recipe, add an attribute "disabled"
+and set it to true, e.g.: <recipe name="Gear" disabled="true" />
+
+Item specifications can reference an alias, an ore dictionary name, a
+block or an item. You can force the type by prefixing the value with
+"oredict:", "block:" or "item:". Recipes that have items that cannot be
+found in-game are either skipped or an error, depending on their "required"
+attribute.
+
+More information on the syntax can be found in the recipes.xsd file. An
+XML editor will display that as tooltips when editing this file.
+
+ -->
+
+  <recipe name="Frank'N'Zombie" required="true">
+    <config section="Recipe Settings" name="addPeacefulRecipes" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotGold" /><item name="gemDiamond" /><item name="ingotGold" />
+        <item name="gemDiamond" /><item name="ZOMBIE_CONTROLLER" /><item name="gemDiamond" />
+        <item name="ingotGold" /><item name="gemDiamond" /><item name="ingotGold" />
+      </grid>
+      <output name="FRANKEN_ZOMBIE" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Sentient Ender" required="true">
+    <config section="Recipe Settings" name="addPeacefulRecipes" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item name="gemDiamond" /><item name="gemDiamond" /><item name="gemDiamond" />
+        <item name="gemDiamond" /><item name="ENDER_RESONATOR" /><item name="gemDiamond" />
+        <item name="ingotGold" /><item name="blockGold" /><item name="ingotGold" />
+      </grid>
+      <output name="SENTIENT_ENDER" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Probe" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="enderio:itemPowerConduit:0" /><item name="ELECTRICAL_STEEL" />
+        <item name="oredict:paneGlass" /><item name="item:minecraft:comparator" /><item name="oredict:paneGlass" />
+        <item name="SILICON" /><item name="enderio:itemRedstoneConduit:0" /><item name="SILICON" />
+      </grid>
+      <output name="CONDUIT_PROBE" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Awareness Upgrade" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CONDUIT_BINDER" /><item name="SILICON" /><item name="CONDUIT_BINDER" />
+        <item name="SILICON" /><item name="pearlEnderEye" /><item name="SILICON" />
+        <item name="CONDUIT_BINDER" /><item name="ELECTRICAL_STEEL" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemFunctionUpgrade:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Staff Of Travelling" required="true">
+    <config section="Staff Settings" name="travelStaffEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item /><item /><item name="ENDER_CRYSTAL" />
+        <item /><item name="DARK_STEEL" /><item />
+        <item name="DARK_STEEL" /><item /><item />
+      </grid>
+      <output name="enderio:itemTravelStaff" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="Rod of Return" required="true">
+    <config section="Rod of Return Settings" name="rodOfReturnEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="PULSATING_CRYSTAL"/><item name="ENDER_CRYSTAL" />
+        <item /><item name="ELECTRICAL_STEEL" /><item name="PULSATING_CRYSTAL"/>
+        <item name="ELECTRICAL_STEEL" /><item /><item />
+      </grid>
+      <output name="enderio:itemRodOfReturn" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Coordinate Selector (endercore)" required="true">
+    <config section="Item Enabling" name="travelAnchorEnabled" value="true" />
+    <config section="Staff Settings" name="travelStaffEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="enderpearl" /><item name="ELECTRICAL_STEEL" />
+        <item /><item name="minecraft:compass" /><item name="ELECTRICAL_STEEL" />
+        <item /><item  /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:itemCoordSelector" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Coordinate Selector (Forge)" required="true">
+    <config section="Item Enabling" name="travelAnchorEnabled" value="true" />
+    <config section="Staff Settings" name="travelStaffEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="enderpearl" /><item name="ELECTRICAL_STEEL" />
+        <item /><item name="minecraft:compass" /><item name="ELECTRICAL_STEEL" />
+        <item /><item /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:itemCoordSelector" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Yeta Wrench" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="" /><item name="ELECTRICAL_STEEL" />
+        <item /><item name="GEAR" /><item />
+        <item /><item name="ELECTRICAL_STEEL" /><item />
+      </grid>
+      <output name="enderio:itemYetaWrench" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Electromagnet" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CONDUCTIVE_IRON" /><item name="VIBRANT_CRYSTAL" /><item name="CONDUCTIVE_IRON" />
+        <item name="CONDUCTIVE_IRON" /><item /><item name="CONDUCTIVE_IRON" />
+        <item name="ELECTRICAL_STEEL" /><item /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:itemMagnet" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Helmet" required="true">
+    <crafting>
+      <grid size="3x2">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:darkSteel_helmet" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Chestplate" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:darkSteel_chestplate" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Leggings" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:darkSteel_leggings" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Boots" required="true">
+    <crafting>
+      <grid size="3x2">
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:darkSteel_boots" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Glider Wing" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item /><item name="DARK_STEEL" />
+        <item /><item name="DARK_STEEL" /><item name="itemLeather" />
+        <item name="DARK_STEEL" /><item name="itemLeather" /><item name="itemLeather" />
+      </grid>
+      <output name="enderio:itemGliderWing:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Gilder Wings" required="true">
+    <crafting>
+      <grid size="3x2">
+        <item /><item name="DARK_STEEL" /><item />
+        <item name="enderio:itemGliderWing:0" /><item name="DARK_STEEL" /><item name="enderio:itemGliderWing:0" />
+      </grid>
+      <output name="enderio:itemGliderWing:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Shears" required="true">
+    <crafting>
+      <grid size="2x2">
+        <item /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item />
+      </grid>
+      <output name="enderio:darkSteel_shears" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Soul Vial" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="SOULARIUM" /><item />
+        <item name="FUSED_QUARTZ" /><item /><item name="FUSED_QUARTZ" />
+        <item /><item name="FUSED_QUARTZ" /><item />
+      </grid>
+      <output name="enderio:itemSoulVessel" />
+    </crafting>
+  </recipe>
+
+  <recipe name="XP Rod" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item /><item name="SOULARIUM" />
+        <item /><item name="ENERGETIC_ALLOY" /><item />
+        <item name="SOULARIUM" /><item /><item />
+      </grid>
+      <output name="enderio:itemXpTransfer" />
+    </crafting>
+  </recipe>
+
+  <recipe name="The Ender" required="true">
+    <crafting>
+      <grid size="1x3">
+        <item name="DARK_STEEL" />
+        <item name="DARK_STEEL" />
+        <item name="stickWood" />
+      </grid>
+      <output name="enderio:darkSteel_sword" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Pickaxe" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item /><item name="stickWood" /><item />
+        <item /><item name="stickWood" /><item />
+      </grid>
+      <output name="enderio:darkSteel_pickaxe" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="Dark Axe" required="true">
+    <crafting>
+      <grid size="2x3">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item name="stickWood" />
+        <item /><item name="stickWood" />
+      </grid>
+      <output name="enderio:darkSteel_axe" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="Dark Bow" required="true">
+    <config name="darkSteelBowEnabled" section="Item Enabling" value="true"/>
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="NUTRITIOUS_STICK" /><item name="string"/>
+        <item name="SKELETAL_CONTRACTOR"/><item/><item name="string"/>
+        <item /><item name="NUTRITIOUS_STICK"/><item name="string"/>
+      </grid>
+      <output name="enderio:darkSteelBow" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="Conduit Facade" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="CONDUIT_BINDER" /><item /><item name="CONDUIT_BINDER" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:blockConduitFacade:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Facade, hardened" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="dustObsidian" /><item />
+        <item name="dustObsidian" /><item name="enderio:blockConduitFacade:0" /><item name="dustObsidian" />
+        <item /><item name="dustObsidian" /><item />
+      </grid>
+      <output name="enderio:blockConduitFacade:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Facade, transparent" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="CONDUIT_BINDER" /><item name="FUSED_GLASS" /><item name="CONDUIT_BINDER" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:blockConduitFacade:2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Facade, transparent, upgrade" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockConduitFacade:0"/><item name="FUSED_GLASS" />
+      </shapeless>
+      <output name="enderio:blockConduitFacade:2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Facade, transparent, hardened" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="dustObsidian" /><item />
+        <item name="dustObsidian" /><item name="enderio:blockConduitFacade:2" /><item name="dustObsidian" />
+        <item /><item name="dustObsidian" /><item />
+      </grid>
+      <output name="enderio:blockConduitFacade:3" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Facade, transparent, hardened, upgrade" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockConduitFacade:1"/><item name="FUSED_GLASS" />
+      </shapeless>
+      <output name="enderio:blockConduitFacade:3" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Liquid, Basic" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="FUSED_GLASS" /><item name="FUSED_GLASS" /><item name="FUSED_GLASS" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemLiquidConduit:0" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:0" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:0" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Liquid, Advanced" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemLiquidConduit:1" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:1" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:1" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Liquid, Advanced (upgrade)" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="FUSED_QUARTZ" /><item name="enderio:itemLiquidConduit:0" /><item name="FUSED_QUARTZ" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemLiquidConduit:1" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:1" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:1" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Liquid, Ender" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="VIBRANT_ALLOY" /><item name="FUSED_QUARTZ" /><item name="VIBRANT_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemLiquidConduit:2" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:2" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:2" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Liquid, Ender (upgrade)" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="VIBRANT_ALLOY" /><item name="enderio:itemLiquidConduit:1" /><item name="VIBRANT_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemLiquidConduit:2" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:2" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemLiquidConduit:2" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Endergy, Tier 1" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="CONDUCTIVE_IRON" /><item name="CONDUCTIVE_IRON" /><item name="CONDUCTIVE_IRON" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemPowerConduit:0" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemPowerConduit:0" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemPowerConduit:0" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Endergy, Tier 2" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="ENERGETIC_ALLOY" /><item name="ENERGETIC_ALLOY" /><item name="ENERGETIC_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemPowerConduit:1" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemPowerConduit:1" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemPowerConduit:1" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Endergy, Tier 2 (upgrade)" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="ENERGETIC_ALLOY" /><item name="enderio:itemPowerConduit:0" /><item name="ENERGETIC_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemPowerConduit:1" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemPowerConduit:1" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemPowerConduit:1" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Endergy, Tier 3" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="VIBRANT_ALLOY" /><item name="VIBRANT_ALLOY" /><item name="VIBRANT_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemPowerConduit:2" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemPowerConduit:2" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemPowerConduit:2" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Endergy, Tier 3 (upgrade)" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="VIBRANT_ALLOY" /><item name="enderio:itemPowerConduit:1" /><item name="VIBRANT_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemPowerConduit:2" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemPowerConduit:2" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemPowerConduit:2" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Redstone, Insulated" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="REDSTONE_ALLOY" /><item name="REDSTONE_ALLOY" /><item name="REDSTONE_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemRedstoneConduit:0" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemRedstoneConduit:0" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemRedstoneConduit:0" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <alias name="GAS_CONDUIT" item="minecraft:stone:0">
+    <!-- prevent log messages from the output tags using this -->
+    <dependency item="enderio:itemGasConduit:0" reverse="true"/>
+  </alias>
+
+  <recipe name="Conduit, Gas" required="true">
+    <config name="gasConduitEnabled" section="Item Enabling" value="true"/>
+    <dependency item="enderio:itemGasConduit:0" />
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="ELECTRICAL_STEEL" /><item name="FUSED_QUARTZ" /><item name="ELECTRICAL_STEEL" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="GAS_CONDUIT" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="GAS_CONDUIT" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="GAS_CONDUIT" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <alias name="OC_CONDUIT" item="enderio:itemOCConduit:0">
+    <dependency item="enderio:itemOCConduit:0" reverse="false"/>
+  </alias>
+  <alias name="OC_CONDUIT" item="minecraft:stone:0">
+    <!-- prevent log messages from the output tags using this -->
+    <dependency item="enderio:itemOCConduit:0" reverse="true"/>
+  </alias>
+
+  <recipe name="Conduit, Computer" required="true">
+    <config name="enableOCConduits" section="Item Enabling" value="true"/>
+    <dependency item="enderio:itemOCConduit:0" />
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="REDSTONE_ALLOY" /><item name="ingotIron" /><item name="REDSTONE_ALLOY" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="OC_CONDUIT" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="OC_CONDUIT" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="OC_CONDUIT" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <alias name="ME_CONDUIT" item="minecraft:stone:0">
+    <!-- prevent log messages from the output tags using this -->
+    <dependency item="enderio:itemMEConduit:0" reverse="true"/>
+  </alias>
+
+  <recipe name="Conduit, ME" required="true">
+    <config name="enableMEConduits" section="Item Enabling" value="true"/>
+    <dependency item="enderio:itemMEConduit:0" />
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="crystalFluix" /><item name="AEApi.instance().parts().partQuartzFiber.stack(1).copy() ???" /><item name="crystalFluix" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="ME_CONDUIT" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="ME_CONDUIT" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="ME_CONDUIT" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, ME (pure)" required="true">
+    <config name="enableMEConduits" section="Item Enabling" value="true"/>
+    <dependency item="enderio:itemMEConduit:0" />
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="crystalPureFluix" /><item name="AEApi.instance().parts().partQuartzFiber.stack(1).copy() ???" /><item name="crystalPureFluix" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="ME_CONDUIT" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="ME_CONDUIT" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="ME_CONDUIT" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <alias name="ME_CONDUIT_DENSE" item="minecraft:stone:0">
+    <!-- prevent log messages from the output tags using this -->
+    <dependency item="enderio:itemMEConduit:1" reverse="true"/>
+  </alias>
+
+  <recipe name="Conduit, ME, dense" required="true">
+    <config name="enableMEConduits" section="Item Enabling" value="true"/>
+    <dependency item="enderio:itemMEConduit:1" />
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="ME_CONDUIT" /><item name="CONDUIT_BINDER" />
+        <item name="ME_CONDUIT" /><item name="CONDUIT_BINDER" /><item name="ME_CONDUIT" />
+        <item name="CONDUIT_BINDER" /><item name="ME_CONDUIT" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="ME_CONDUIT_DENSE" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="ME_CONDUIT_DENSE" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="ME_CONDUIT_DENSE" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit, Item" required="true">
+    <crafting>
+      <grid>
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+        <item name="PULSATING_IRON_NUGGET" /><item name="PULSATING_IRON_NUGGET" /><item name="PULSATING_IRON_NUGGET" />
+        <item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" /><item name="CONDUIT_BINDER" />
+      </grid>
+      <output name="enderio:itemItemConduit:0" amount="12">
+        <level maxlevel="1"/>
+      </output>
+      <output name="enderio:itemItemConduit:0" amount="8">
+        <level minlevel="2" maxlevel="2"/>
+      </output>
+      <output name="enderio:itemItemConduit:0" amount="2">
+        <level minlevel="3"/>
+      </output>
+    </crafting>
+  </recipe>
+
+  <recipe name="Filter, Basic" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="oredict:paper" /><item />
+        <item name="oredict:paper" /><item name="blockHopper" /><item name="oredict:paper" />
+        <item /><item name="oredict:paper" /><item/>
+      </grid>
+      <output name="enderio:itemBasicFilterUpgrade:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Filter, Advanced" required="true">
+    <crafting>
+      <grid>
+        <item name="dustRedstone" /><item name="oredict:paper" /><item name="dustRedstone" />
+        <item name="oredict:paper" /><item name="ZOMBIE_CONTROLLER" /><item name="oredict:paper" />
+        <item name="dustRedstone" /><item name="oredict:paper" /><item name="dustRedstone" />
+      </grid>
+      <output name="enderio:itemBasicFilterUpgrade:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Filter, Mod" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="oredict:paper" /><item />
+        <item name="oredict:paper" /><item name="enderio:itemYetaWrench" /><item name="oredict:paper" />
+        <item /><item name="oredict:paper" /><item/>
+      </grid>
+      <output name="enderio:itemModItemFilter:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Filter, Existing" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="dustRedstone" /><item />
+        <item name="dustRedstone" /><item name="enderio:itemBasicFilterUpgrade:1" /><item name="dustRedstone" />
+        <item /><item name="minecraft:comparator" /><item/>
+      </grid>
+      <output name="enderio:itemExistingItemFilter:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Filter, Power" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="oredict:paper" /><item />
+        <item name="oredict:paper" /><item name="CONDUIT_PROBE" /><item name="oredict:paper" />
+        <item /><item name="oredict:paper" /><item/>
+      </grid>
+      <output name="enderio:itemPowerItemFilter:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Upgrade, Speed" required="true">
+    <crafting>
+      <grid>
+        <item name="ingotIron" /><item name="ingotIron" /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="minecraft:piston" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="minecraft:redstone_torch" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:itemExtractSpeedUpgrade:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Upgrade, Slowness" required="true">
+    <crafting>
+      <grid>
+        <item name="ingotIron" /><item name="ingotIron" /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="slimeball" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="stickWood" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:itemExtractSpeedUpgrade:1" />
+    </crafting>
+  </recipe>
+
+
+  <recipe name="Inventory Panel Remote" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item/><item/><item name="minecraft:heavy_weighted_pressure_plate" />
+        <item name="minecraft:heavy_weighted_pressure_plate" /><item name="enderio:blockInventoryPanel" /><item name="minecraft:heavy_weighted_pressure_plate" />
+        <item name="minecraft:heavy_weighted_pressure_plate" /><item name="enderio:blockTravelAnchor" /><item name="minecraft:heavy_weighted_pressure_plate" />
+      </grid>
+      <output name="enderio:itemRemoteInvAccess:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Inventory Panel Remote, variant" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item/><item/><item name="PPP_IRON" />
+        <item name="PPP_IRON" /><item name="enderio:blockInventoryPanel" /><item name="PPP_IRON" />
+        <item name="PPP_IRON" /><item name="enderio:blockTravelAnchor" /><item name="PPP_IRON" />
+      </grid>
+      <output name="enderio:itemRemoteInvAccess:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Advanced Inventory Panel Remote" required="true">
+    <config section="Item Enabling" name="transceiverEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item/><item/><item name="PPP_DARK_STEEL" />
+        <item name="PPP_DARK_STEEL" /><item name="enderio:itemRemoteInvAccess:0" /><item name="PPP_DARK_STEEL" />
+        <item name="PPP_DARK_STEEL" /><item name="enderio:itemTravelStaff" /><item name="PPP_DARK_STEEL" />
+      </grid>
+      <output name="enderio:itemRemoteInvAccess:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Ender Inventory Panel Remote" required="true">
+    <config section="Item Enabling" name="transceiverEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item/><item/><item name="PPP_SOULARIUM" />
+        <item name="PPP_SOULARIUM" /><item name="enderio:itemRemoteInvAccess:1" /><item name="PPP_SOULARIUM" />
+        <item name="PPP_SOULARIUM" /><item name="enderio:blockTransceiver" /><item name="PPP_SOULARIUM" />
+      </grid>
+      <output name="enderio:itemRemoteInvAccess:2" />
+    </crafting>
+  </recipe>
+
+</enderio:recipes>

src/config/enderio/recipe_items_user.xml

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+</enderio:recipes>

src/config/enderio/recipe_machines_core.xml

@@ -0,0 +1,839 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+<!-- 
+
+These are the build-in recipes. You cannot change this file, it is a
+reference for you only and will be generated every time the game starts.
+
+To make changes to the recipes, copy the recipes you want to change to
+the matching _user.xml. To disabled a recipe, add an attribute "disabled"
+and set it to true, e.g.: <recipe name="Gear" disabled="true" />
+
+Item specifications can reference an alias, an ore dictionary name, a
+block or an item. You can force the type by prefixing the value with
+"oredict:", "block:" or "item:". Recipes that have items that cannot be
+found in-game are either skipped or an error, depending on their "required"
+attribute.
+
+More information on the syntax can be found in the recipes.xsd file. An
+XML editor will display that as tooltips when editing this file.
+
+ -->
+
+  <recipe name="Stirling Generator" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="minecraft:stonebrick:0" /><item name="minecraft:stonebrick:0" /><item name="minecraft:stonebrick:0" />
+        <item name="minecraft:stonebrick:0" /><item name="minecraft:furnace" /><item name="minecraft:stonebrick:0" />
+        <item name="GEAR" /><item name="minecraft:piston" /><item name="GEAR" />
+      </grid>
+      <output name="enderio:blockStirlingGenerator" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Combustion Generator" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" />
+        <item name="EnderIO:blockTank:0" /><item name="CHASSIS" /><item name="EnderIO:blockTank:0" />
+        <item name="GEAR" /><item name="minecraft:piston" /><item name="GEAR" />
+      </grid>
+      <output name="enderio:blockCombustionGenerator" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Zombie Generator" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" />
+        <item name="FUSED_QUARTZ" /><item name="ZOMBIE_ELECTRODE" /><item name="FUSED_QUARTZ" />
+        <item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" />
+      </grid>
+      <output name="enderio:blockZombieGenerator" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Killer Joe" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item name="FUSED_QUARTZ" /><item name="FRANKEN_ZOMBIE" /><item name="FUSED_QUARTZ" />
+        <item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" />
+      </grid>
+      <output name="enderio:blockKillerJoe" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Wireless Charger" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="ENDER_RESONATOR" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR3" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockWirelessCharger" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Crafter" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="workbench" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="CHASSIS" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="ZOMBIE_CONTROLLER" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockCrafter" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Powered Spawner" required="true">
+    <crafting>
+      <level maxlevel="2" />
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="itemSkull" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="VIBRANT_CRYSTAL" /><item name="ZOMBIE_CONTROLLER" /><item name="VIBRANT_CRYSTAL" />
+      </grid>
+      <output name="enderio:blockPoweredSpawner" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="itemSkull" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="VIBRANT_CRYSTAL" /><item name="FRANKEN_ZOMBIE" /><item name="VIBRANT_CRYSTAL" />
+      </grid>
+      <output name="enderio:blockPoweredSpawner" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Reservoir" required="true">
+    <config section="Item Enabling" name="reservoirEnabled" value="true" />
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="blockGlass" /><item name="FUSED_QUARTZ" /><item name="blockGlass" />
+        <item name="blockGlass" /><item name="item:minecraft:cauldron" /><item name="blockGlass" />
+        <item name="blockGlass" /><item name="FUSED_QUARTZ" /><item name="blockGlass" />
+      </grid>
+      <output name="enderio:blockReservoir" amount="2" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="blockGlassHardened" /><item name="FUSED_QUARTZ" /><item name="blockGlassHardened" />
+        <item name="blockGlassHardened" /><item name="item:minecraft:cauldron" /><item name="blockGlassHardened" />
+        <item name="blockGlassHardened" /><item name="FUSED_QUARTZ" /><item name="blockGlassHardened" />
+      </grid>
+      <output name="enderio:blockReservoir" amount="2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Tank" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="barsIron" /><item name="ingotIron" />
+        <item name="barsIron" /><item name="blockGlass" /><item name="barsIron" />
+        <item name="ingotIron" /><item name="barsIron" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockTank:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Tank 2" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item name="enderio:blockDarkIronBars" /><item name="DARK_STEEL" />
+        <item name="enderio:blockDarkIronBars" /><item name="blockGlassHardened" /><item name="enderio:blockDarkIronBars" />
+        <item name="DARK_STEEL" /><item name="enderio:blockDarkIronBars" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:blockTank:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="SAG Mill" required="true">
+    <crafting>
+      <level maxlevel="2" />
+      <grid size="3x3">
+        <item name="itemFlint" /><item name="itemFlint" /><item name="itemFlint" />
+        <item name="ingotIron" /><item name="CHASSIS" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="minecraft:piston" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockSagMill" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="oredict:obsidian" /><item name="oredict:obsidian" /><item name="oredict:obsidian" />
+        <item name="itemFlint" /><item name="CHASSIS" /><item name="itemFlint" />
+        <item name="minecraft:piston" /><item name="ingotIron" /><item name="minecraft:piston" />
+      </grid>
+      <output name="enderio:blockSagMill" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Alloy Smelter" required="true">
+    <crafting>
+      <level maxlevel="2" />
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="minecraft:furnace" /><item name="ingotIron" />
+        <item name="minecraft:furnace" /><item name="CHASSIS" /><item name="minecraft:furnace" />
+        <item name="ingotIron" /><item name="item:minecraft:cauldron" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockAlloySmelter" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="blockIron" /><item name="minecraft:furnace" /><item name="blockIron" />
+        <item name="minecraft:furnace" /><item name="CHASSIS" /><item name="minecraft:furnace" />
+        <item name="blockIron" /><item name="item:minecraft:cauldron" /><item name="blockIron" />
+      </grid>
+      <output name="enderio:blockAlloySmelter" />
+    </crafting>
+  </recipe>
+
+  <recipe name="The Vat" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="item:minecraft:cauldron" /><item name="ELECTRICAL_STEEL" />
+        <item name="enderio:blockTank:0" /><item name="CHASSIS" /><item name="enderio:blockTank:0" />
+        <item name="ELECTRICAL_STEEL" /><item name="minecraft:furnace" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockVat" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Capacitor Bank, simple" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="CAPACITOR1" /><item name="ingotIron" />
+        <item name="CAPACITOR1" /><item name="blockRedstone" /><item name="CAPACITOR1" />
+        <item name="ingotIron" /><item name="CAPACITOR1" /><item name="ingotIron" />
+      </grid>
+      <output name="CAP_BANK_1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Capacitor Bank, activated" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR2" /><item name="ELECTRICAL_STEEL" />
+        <item name="CAPACITOR2" /><item name="blockRedstone" /><item name="CAPACITOR2" />
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR2" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="CAP_BANK_2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Capacitor Bank, vibrant" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR3" /><item name="ELECTRICAL_STEEL" />
+        <item name="CAPACITOR3" /><item name="VIBRANT_CRYSTAL" /><item name="CAPACITOR3" />
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR3" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="CAP_BANK_3" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painter" required="true">
+    <crafting>
+      <level maxlevel="2" />
+      <grid size="3x3">
+        <item name="gemQuartz" /><item name="gemDiamond" /><item name="gemQuartz" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockPainter" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="gemQuartz" /><item name="gemQuartz" /><item name="gemQuartz" />
+        <item name="ELECTRICAL_STEEL" /><item name="blockDiamond" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockPainter" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Farming Station" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="minecraft:diamond_hoe" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="PULSATING_CRYSTAL" /><item name="ZOMBIE_CONTROLLER" /><item name="PULSATING_CRYSTAL" />
+      </grid>
+      <output name="enderio:blockFarmStation" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Transceiver" required="true">
+    <config section="Item Enabling" name="transceiverEnabled" value="true" />
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="oredict:obsidian" /><item name="pearlEnderEye" /><item name="oredict:obsidian" />
+        <item name="ENERGETIC_ALLOY" /><item name="gemDiamond" /><item name="ENERGETIC_ALLOY" />
+        <item name="oredict:obsidian" /><item name="CAPACITOR3" /><item name="oredict:obsidian" />
+      </grid>
+      <output name="enderio:blockTransceiver" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="ENDER_RESONATOR" /><item name="ELECTRICAL_STEEL" />
+        <item name="FUSED_QUARTZ" /><item name="ENDER_CRYSTAL" /><item name="FUSED_QUARTZ" />
+        <item name="ELECTRICAL_STEEL" /><item name="CAPACITOR3" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockTransceiver" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Solar Panel 1" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="ENERGETIC_ALLOY" /><item name="blockGlassHardened" /><item name="ENERGETIC_ALLOY" />
+        <item name="SILICON" /><item name="blockGlassHardened" /><item name="SILICON" />
+        <item name="ELECTRICAL_STEEL" /><item name="minecraft:daylight_detector" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="SOLAR_1" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="ENERGETIC_ALLOY" /><item name="blockGlassHardened" /><item name="ENERGETIC_ALLOY" />
+        <item name="VIBRANT_ALLOY" /><item name="blockGlassHardened" /><item name="VIBRANT_ALLOY" />
+        <item name="CAPACITOR1" /><item name="minecraft:daylight_detector" /><item name="CAPACITOR1" />
+      </grid>
+      <output name="SOLAR_1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Solar Panel 2" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="VIBRANT_ALLOY" /><item name="ENLIGHTED_QUARTZ" /><item name="VIBRANT_ALLOY" />
+        <item name="VIBRANT_CRYSTAL" /><item name="ENLIGHTED_QUARTZ" /><item name="VIBRANT_CRYSTAL" />
+        <item name="PULSATING_IRON" /><item name="minecraft:daylight_detector" /><item name="PULSATING_IRON" />
+      </grid>
+      <output name="SOLAR_2" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="PULSATING_IRON" /><item name="ENLIGHTED_QUARTZ" /><item name="PULSATING_IRON" />
+        <item name="VIBRANT_ALLOY" /><item name="ENLIGHTED_QUARTZ" /><item name="VIBRANT_ALLOY" />
+        <item name="CAPACITOR2" /><item name="minecraft:daylight_detector" /><item name="CAPACITOR2" />
+      </grid>
+      <output name="SOLAR_2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Solar Panel 3" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="DARK_QUARTZ" /><item name="DARK_QUARTZ" /><item name="DARK_QUARTZ" />
+        <item name="SOULARIUM" /><item name="DARK_QUARTZ" /><item name="SOULARIUM" />
+        <item name="SOLAR_2" /><item name="SOLAR_2" /><item name="SOLAR_2" />
+      </grid>
+      <output name="SOLAR_3" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="SOULARIUM" /><item name="DARK_QUARTZ" /><item name="SOULARIUM" />
+        <item name="CAPACITOR3" /><item name="ENDER_CRYSTAL" /><item name="CAPACITOR3" />
+        <item name="SOLAR_2" /><item name="SOLAR_2" /><item name="SOLAR_2" />
+      </grid>
+      <output name="SOLAR_3" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Energy Monitor" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="CONDUIT_PROBE" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="ELECTRICAL_STEEL" /><item name="enderio:itemPowerConduit:0" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockPowerMonitor" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Energy Monitor 2" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="minecraft:wool:15" /><item name="minecraft:wool:15" /><item name="minecraft:wool:15" />
+        <item name="minecraft:wool:15" /><item name="enderio:blockPowerMonitor" /><item name="minecraft:wool:15" />
+        <item name="dyeRed" /><item name="dyeYellow" /><item name="dyeGreen" />
+      </grid>
+      <output name="enderio:blockPowerMonitorv2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Enchanter" required="true">
+    <crafting>
+      <level maxlevel="2" />
+      <grid size="3x3">
+        <item name="gemDiamond" /><item name="minecraft:book" /><item name="gemDiamond" />
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" /><item name="DARK_STEEL" />
+        <item /><item name="DARK_STEEL" /><item />
+      </grid>
+      <output name="enderio:blockEnchanter" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="blockDiamond" /><item name="minecraft:bookshelf" /><item name="blockDiamond" />
+        <item name="blockDarkSteel" /><item name="blockDarkSteel" /><item name="blockDarkSteel" />
+        <item name="" /><item name="DARK_STEEL" /><item name="" />
+      </grid>
+      <output name="enderio:blockEnchanter" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Vacuum Chest" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="ingotIron" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="chestWood" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="PULSATING_CRYSTAL" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockVacuumChest" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Soul Binder" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="SOULARIUM" /><item name="PULSATING_CRYSTAL" /><item name="SOULARIUM" />
+        <item name="HEAD_ZOMBIE" /><item name="CHASSIS" /><item name="HEAD_CREEPER" />
+        <item name="SOULARIUM" /><item name="HEAD_SKELETON" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockSoulBinder" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="SOULARIUM" /><item name="HEAD_ENDERMAN" /><item name="SOULARIUM" />
+        <item name="HEAD_ZOMBIE" /><item name="CHASSIS" /><item name="HEAD_CREEPER" />
+        <item name="SOULARIUM" /><item name="HEAD_SKELETON" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockSoulBinder" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Attractor Obelisk" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="ATTRACTOR_CRYSTAL" /><item />
+        <item name="ENERGETIC_ALLOY" /><item name="SOULARIUM" /><item name="ENERGETIC_ALLOY" />
+        <item name="SOULARIUM" /><item name="CHASSIS" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockAttractor" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Aversion Obelisk" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="HEAD_ENDERMAN_TORMENTED" /><item />
+        <item name="ENERGETIC_ALLOY" /><item name="SOULARIUM" /><item name="ENERGETIC_ALLOY" />
+        <item name="SOULARIUM" /><item name="CHASSIS" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockSpawnGuard" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Relocator Obelisk" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="1x2">
+        <item name="blockPrismarine" />
+        <item name="enderio:blockSpawnGuard" />
+      </grid>
+      <output name="enderio:blockSpawnRelocator" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item /><item name="blockPrismarine" /><item />
+        <item name="blockPrismarine" /><item name="enderio:blockSpawnGuard" /><item name="blockPrismarine" />
+        <item /><item name="blockPrismarine" /><item />
+      </grid>
+      <output name="enderio:blockSpawnRelocator" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Experience Obelisk" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="enderio:itemXpTransfer" /><item />
+        <item /><item name="SOULARIUM" /><item />
+        <item name="SOULARIUM" /><item name="CHASSIS" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockExperienceObelisk" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Weather Obelisk" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="WEATHER_CRYSTAL" /><item />
+        <item name="ENERGETIC_ALLOY" /><item name="SOULARIUM" /><item name="ENERGETIC_ALLOY" />
+        <item name="SOULARIUM" /><item name="CAP_BANK_1" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockWeatherObelisk" />
+    </crafting>
+  </recipe>
+
+  <recipe name="RF Gauge" required="true">
+    <crafting>
+      <level maxlevel="0" />
+      <grid size="3x3">
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="enderio:itemConduitProbe:0" /><item name="ingotIron" />
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockGauge" amount="2" />
+    </crafting>
+    <crafting>
+      <level minlevel="1" maxlevel="1" />
+      <grid size="3x3">
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="enderio:itemConduitProbe:0" /><item name="ingotIron" />
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockGauge" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" maxlevel="2" />
+      <grid size="3x3">
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="enderio:itemConduitProbe:0" /><item name="ELECTRICAL_STEEL" />
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockGauge" />
+    </crafting>
+    <crafting>
+      <level minlevel="3" />
+      <grid size="3x3">
+        <item name="ingotIron" /><item /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="enderio:itemConduitProbe:0" /><item name="ELECTRICAL_STEEL" />
+        <item name="ingotIron" /><item name="CHASSIS" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockGauge" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, basic" required="true">
+    <crafting>
+      <grid size="3x2">
+        <item name="blockGlass" /><item name="blockGlass" /><item name="blockGlass" />
+        <item name="ingotIron" /><item name="oredict:glowstone" /><item name="ingotIron" />
+      </grid>
+      <output name="LIGHT_BASIC" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, basic (un-invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_BASIC_INV" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_BASIC" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, basic, inverted (invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_BASIC" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_BASIC_INV" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, electric" required="true">
+    <crafting>
+      <level maxlevel="1" />
+      <grid size="3x3">
+        <item name="blockGlass" /><item name="blockGlass" /><item name="blockGlass" />
+        <item name="SILICON" /><item name="dustGlowstone" /><item name="SILICON" />
+        <item name="SILICON" /><item name="CAPACITOR1" /><item name="SILICON" />
+      </grid>
+      <output name="LIGHT_ELECTRIC" />
+    </crafting>
+    <crafting>
+      <level minlevel="2" />
+      <grid size="3x3">
+        <item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" /><item name="FUSED_QUARTZ" />
+        <item name="SILICON" /><item name="dustGlowstone" /><item name="SILICON" />
+        <item name="SILICON" /><item name="CAPACITOR1" /><item name="SILICON" />
+      </grid>
+      <output name="LIGHT_ELECTRIC" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, electric (un-invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_ELECTRIC_INV" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_ELECTRIC" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, electric inverted (invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_ELECTRIC" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_ELECTRIC_INV" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, wireless (upgrade)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_ELECTRIC" />
+        <item name="ENDER_RESONATOR" />
+      </shapeless>
+      <output name="LIGHT_WIRELESS" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, wireless (un-invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_WIRELESS_INV" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_WIRELESS" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, wireless, inverted (upgrade)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_ELECTRIC_INV" />
+        <item name="ENDER_RESONATOR" />
+      </shapeless>
+      <output name="LIGHT_WIRELESS_INV" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Light, wireless, inverted (invert)" required="true">
+    <crafting>
+      <shapeless>
+        <item name="LIGHT_WIRELESS" />
+        <item name="minecraft:redstone_torch" />
+      </shapeless>
+      <output name="LIGHT_WIRELESS_INV" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Slice'N'Splice" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="SOULARIUM" /><item name="itemSkull" /><item name="SOULARIUM" />
+        <item name="minecraft:iron_axe" /><item name="CHASSIS" /><item name="minecraft:shears" />
+        <item name="SOULARIUM" /><item name="SOULARIUM" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockSliceAndSplice" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Slice'N'Splice, mirrored" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="SOULARIUM" /><item name="itemSkull" /><item name="SOULARIUM" />
+        <item name="minecraft:shears" /><item name="CHASSIS" /><item name="minecraft:iron_axe" />
+        <item name="SOULARIUM" /><item name="SOULARIUM" /><item name="SOULARIUM" />
+      </grid>
+      <output name="enderio:blockSliceAndSplice" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Item Buffer" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="ELECTRICAL_STEEL" /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="chestWood" /><item name="ELECTRICAL_STEEL" />
+        <item name="ingotIron" /><item name="ELECTRICAL_STEEL" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockBuffer:0" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Power Buffer" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="ELECTRICAL_STEEL" /><item name="ingotIron" />
+        <item name="ELECTRICAL_STEEL" /><item name="CHASSIS" /><item name="ELECTRICAL_STEEL" />
+        <item name="ingotIron" /><item name="ELECTRICAL_STEEL" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockBuffer:1" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Omni Buffer" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockBuffer:0" />
+        <item name="enderio:blockBuffer:1" />
+      </shapeless>
+      <output name="enderio:blockBuffer:2" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Inventory Panel" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="DARK_STEEL" /><item name="enderio:itemFunctionUpgrade:0" /><item name="DARK_STEEL" />
+        <item name="PULSATING_CRYSTAL" /><item name="SENTIENT_ENDER" /><item name="PULSATING_CRYSTAL" />
+        <item name="DARK_STEEL" /><item name="enderio:blockTank:0" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:blockInventoryPanel" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="Inventory Panel Sensor" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="enderio:itemFunctionUpgrade:0" /><item name="ELECTRICAL_STEEL" />
+        <item name="REDSTONE_ALLOY" /><item name="CHASSIS" /><item name="REDSTONE_ALLOY" />
+        <item name="ELECTRICAL_STEEL" /><item name="item:minecraft:comparator"/><item name="ELECTRICAL_STEEL" />               
+      </grid>
+      <output name="enderio:blockInventoryPanelSensor" />
+    </crafting>
+  </recipe>
+
+<!-- Disabled until we fix the block
+  <recipe name="Ender IO" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ELECTRICAL_STEEL" /><item name="FUSED_QUARTZ" /><item name="ELECTRICAL_STEEL" />
+        <item name="FUSED_QUARTZ" /><item name="pearlEnderEye" /><item name="FUSED_QUARTZ" />
+        <item name="ELECTRICAL_STEEL" /><item name="FUSED_QUARTZ" /><item name="ELECTRICAL_STEEL" />
+      </grid>
+      <output name="enderio:blockEnderIo" />
+    </crafting>
+  </recipe>
+-->
+
+  <recipe name="Travel Anchor" required="true">
+    <config section="Item Enabling" name="travelAnchorEnabled" value="true" />
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="CONDUIT_BINDER" /><item name="ingotIron" />
+        <item name="CONDUIT_BINDER" /><item name="PULSATING_CRYSTAL" /><item name="CONDUIT_BINDER" />
+        <item name="ingotIron" /><item name="CONDUIT_BINDER" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockTravelAnchor" />
+    </crafting>
+  </recipe>
+
+  <recipe name="TelePad" required="true" disabled="false">    
+    <crafting>    
+      <grid size="3x3">
+        <item name="FUSED_QUARTZ" /><item name="ENDER_CRYSTAL" /><item name="FUSED_QUARTZ" />
+        <item name="DARK_STEEL" /><item name="enderio:blockTravelAnchor" /><item name="DARK_STEEL" />
+        <item name="DARK_STEEL" /><item name="CAPACITOR3" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:blockTelePad" />
+    </crafting>
+  </recipe>
+  
+  <recipe name="DialingDevice" required="true" disabled="false">    
+    <crafting>    
+      <grid size="3x3">
+        <item/>                  <item name="ELECTRICAL_STEEL" /><item/>
+        <item/>                  <item name="ENDER_RESONATOR" /><item/>
+        <item name="DARK_STEEL" /><item name="CAPACITOR3" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="enderio:blockDialingDevice" />
+    </crafting>
+  </recipe>  
+
+  <recipe name="Painted Pressure Plate, Dark Steel" required="true">
+    <crafting>
+      <grid size="2x1">
+        <item name="DARK_STEEL" /><item name="DARK_STEEL" />
+      </grid>
+      <output name="PPP_DARK_STEEL" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painted Pressure Plate, Soularium" required="true">
+    <crafting>
+      <grid size="2x1">
+        <item name="SOULARIUM" /><item name="SOULARIUM" />
+      </grid>
+      <output name="PPP_SOULARIUM" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painted Pressure Plate, Wood, Silent" required="true">
+    <crafting>
+      <grid size="1x2">
+        <item name="minecraft:wooden_pressure_plate" />
+        <item name="minecraft:wool" />
+      </grid>
+      <output name="PPP_WOOD_SILENT" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painted Pressure Plate, Stone, Silent" required="true">
+    <crafting>
+      <grid size="1x2">
+        <item name="minecraft:stone_pressure_plate" />
+        <item name="minecraft:wool" />
+      </grid>
+      <output name="PPP_STONE_SILENT" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painted Pressure Plate, Iron Silent" required="true">
+    <crafting>
+      <grid size="1x2">
+        <item name="minecraft:heavy_weighted_pressure_plate" />
+        <item name="minecraft:wool" />
+      </grid>
+      <output name="PPP_IRON_SILENT" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Painted Pressure Plate, Gold Silent" required="true">
+    <crafting>
+      <grid size="1x2">
+        <item name="minecraft:light_weighted_pressure_plate" />
+        <item name="minecraft:wool" />
+      </grid>
+      <output name="PPP_GOLD_SILENT" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Exit Rail" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron" /><item name="minecraft:piston" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="minecraft:stone_pressure_plate" /><item name="ingotIron" />
+        <item name="ingotIron" /><item name="dustRedstone" /><item name="ingotIron" />
+      </grid>
+      <output name="enderio:blockExitRail" amount="6" />
+    </crafting>
+  </recipe>
+
+</enderio:recipes>

src/config/enderio/recipe_machines_user.xml

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+</enderio:recipes>

src/config/enderio/recipe_materials_core.xml

@@ -0,0 +1,883 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+<!-- 
+
+These are the build-in recipes. You cannot change this file, it is a
+reference for you only and will be generated every time the game starts.
+
+To make changes to the recipes, copy the recipes you want to change to
+the matching _user.xml. To disabled a recipe, add an attribute "disabled"
+and set it to true, e.g.: <recipe name="Gear" disabled="true" />
+
+Item specifications can reference an alias, an ore dictionary name, a
+block or an item. You can force the type by prefixing the value with
+"oredict:", "block:" or "item:". Recipes that have items that cannot be
+found in-game are either skipped or an error, depending on their "required"
+attribute.
+
+More information on the syntax can be found in the recipes.xsd file. An
+XML editor will display that as tooltips when editing this file.
+
+ -->
+
+  <recipe name="Compatibility: Glass 2 Glass" required="false">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockFusedQuartz:1"/>
+      </shapeless>
+      <output name="minecraft:glass"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Compatibility: End Crystal" required="false">
+    <crafting>
+      <grid>
+        <item name="blockGlassColorless"/><item name="blockGlassColorless"/><item name="blockGlassColorless"/>
+        <item name="blockGlassColorless"/><item name="pearlEnderEye"/><item name="blockGlassColorless"/>
+        <item name="blockGlassColorless"/><item name="itemGhastTear"/><item name="blockGlassColorless"/>
+      </grid>
+      <output name="minecraft:end_crystal"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Compatibility: Beacon" required="false">
+    <crafting>
+      <grid>
+        <item name="blockGlassColorless"/><item name="blockGlassColorless"/><item name="blockGlassColorless"/>
+        <item name="blockGlassColorless"/><item name="netherStar"/><item name="blockGlassColorless"/>
+        <item name="oredict:obsidian"/><item name="oredict:obsidian"/><item name="oredict:obsidian"/>
+      </grid>
+      <output name="minecraft:beacon"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Compatibility: Bottle" required="false">
+    <crafting>
+      <grid size="3x2">
+        <item name="blockGlassColorless"/><item /><item name="blockGlassColorless"/>
+        <item /><item name="blockGlassColorless"/><item />
+      </grid>
+      <output name="minecraft:glass_bottle" amount="3"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Compatibility: Glass Pane" required="false">
+    <crafting>
+      <grid size="3x2">
+        <item name="blockGlassColorless"/><item name="blockGlassColorless"/><item name="blockGlassColorless"/>
+        <item name="blockGlassColorless"/><item name="blockGlassColorless"/><item name="blockGlassColorless"/>
+      </grid>
+      <output name="minecraft:glass_pane" amount="16"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Compatibility: Daylight Sensor" required="false">
+    <crafting>
+      <grid>
+        <item name="blockGlassColorless"/><item name="blockGlassColorless"/><item name="blockGlassColorless"/>
+        <item name="gemQuartz"/><item name="gemQuartz"/><item name="gemQuartz"/>
+        <item name="slabWood"/><item name="slabWood"/><item name="slabWood"/>
+      </grid>
+      <output name="minecraft:daylight_detector"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Binder Composite" required="true">
+    <crafting>
+      <level maxlevel="0"/>
+      <grid size="3x3">
+        <item name="oredict:gravel" /><item name="oredict:gravel" /><item name="oredict:gravel" />
+        <item name="oredict:sand" /><item name="oredict:itemClay" /><item name="oredict:sand" />
+        <item name="oredict:gravel" /><item name="oredict:gravel" /><item name="oredict:gravel" />
+      </grid>
+      <output name="BINDER_COMPOSITE" amount="16" />
+    </crafting>
+    <crafting>
+      <level minlevel="1" maxlevel="2"/>
+      <grid size="3x3">
+        <item name="oredict:gravel" /><item name="oredict:itemClay" /><item name="oredict:gravel" />
+        <item name="oredict:sand" /><item name="oredict:gravel" /><item name="oredict:sand" />
+        <item name="oredict:gravel" /><item name="oredict:itemClay" /><item name="oredict:gravel" />
+      </grid>
+      <output name="BINDER_COMPOSITE" amount="8" />
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid size="3x3">
+        <item name="oredict:gravel" /><item name="minecraft:clay" /><item name="oredict:gravel" />
+        <item name="oredict:sand" /><item name="oredict:gravel" /><item name="oredict:sand" />
+        <item name="oredict:gravel" /><item name="minecraft:clay" /><item name="oredict:gravel" />
+      </grid>
+      <output name="BINDER_COMPOSITE" amount="4" />
+    </crafting>
+  </recipe>
+
+  <recipe name="Conduit Binder" required="true">
+    <smelting exp="0">
+      <input name="BINDER_COMPOSITE"/>
+      <output name="CONDUIT_BINDER" amount="4">
+        <level maxlevel="1"/>
+      </output>
+      <output name="CONDUIT_BINDER" amount="2">
+        <level minlevel="2"/>
+      </output>
+    </smelting>
+  </recipe>
+
+  <recipe name="Pulsating Iron, Nuggets" required="true">
+    <crafting>
+      <shapeless>
+        <item name="PULSATING_IRON"/>
+      </shapeless>
+      <output name="PULSATING_IRON_NUGGET" amount="9"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Pulsating Iron, De-Nuggeting" required="true">
+    <crafting>
+      <shapeless>
+        <item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/>
+        <item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/>
+        <item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/>
+      </shapeless>
+      <output name="PULSATING_IRON"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Vibrant Alloy, Nuggets" required="true">
+    <crafting>
+      <shapeless>
+        <item name="VIBRANT_ALLOY"/>
+      </shapeless>
+      <output name="VIBRANT_NUGGET" amount="9"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Vibrant Alloy, De-Nuggeting" required="true">
+    <crafting>
+      <shapeless>
+        <item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/>
+        <item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/>
+        <item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/>
+      </shapeless>
+      <output name="VIBRANT_ALLOY"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Pulsating Crystal" required="true">
+    <crafting>
+      <grid>
+        <item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/>
+        <item name="PULSATING_IRON_NUGGET"/><item name="gemDiamond"/><item name="PULSATING_IRON_NUGGET"/>
+        <item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/><item name="PULSATING_IRON_NUGGET"/>
+      </grid>
+      <output name="PULSATING_CRYSTAL"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Vibrant Crystal" required="true">
+    <crafting>
+      <grid>
+        <item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/>
+        <item name="VIBRANT_NUGGET"/><item name="gemEmerald"/><item name="VIBRANT_NUGGET"/>
+        <item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/><item name="VIBRANT_NUGGET"/>
+      </grid>
+      <output name="VIBRANT_CRYSTAL"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Grinding Ball" required="true">
+    <crafting>
+      <level maxlevel="1"/>
+      <grid size="2x2">
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+      </grid>
+      <output name="DARK_GRINDING_BALL" amount="5"/>
+    </crafting>
+    <crafting>
+      <level minlevel="2" maxlevel="2"/>
+      <grid>
+        <item/><item name="DARK_STEEL"/><item/>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+        <item/><item name="DARK_STEEL"/><item/>
+      </grid>
+      <output name="DARK_GRINDING_BALL" amount="5"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+        <item name="DARK_STEEL"/><item/><item name="DARK_STEEL"/>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+      </grid>
+      <output name="DARK_GRINDING_BALL" amount="5"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Iron Dust, Smelting" required="true">
+    <smelting>
+      <input name="enderio:itemPowderIngot:1"/>
+      <output name="minecraft:iron_ingot"/>
+    </smelting>
+  </recipe>
+
+  <recipe name="Gold Dust, Smelting" required="true">
+    <smelting>
+      <input name="enderio:itemPowderIngot:2"/>
+      <output name="minecraft:gold_ingot"/>
+    </smelting>
+  </recipe>
+
+  <recipe name="Ender Pearl Nuggets" required="true">
+    <crafting>
+      <shapeless>
+        <item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/>
+        <item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/>
+        <item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/><item name="nuggetEnderpearl"/>
+      </shapeless>
+      <output name="oredict:enderpearl"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Iron Bars" required="true">
+    <crafting>
+      <grid size="3x2">
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+      </grid>
+      <output name="enderio:blockDarkIronBars" amount="16"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Chassis" required="true">
+    <crafting>      
+      <grid>
+        <item name="barsIron"/><item name="ingotIron"/><item name="barsIron"/>
+        <item name="ingotIron"/><item name="CAPACITOR1"/><item name="ingotIron"/>
+        <item name="barsIron"/><item name="ingotIron"/><item name="barsIron"/>
+      </grid>
+      <output name="CHASSIS"/>
+    </crafting>    
+  </recipe>
+
+  <recipe name="Gear" required="true">
+    <crafting>
+      <level maxlevel="2"/>
+      <grid>
+        <item name="stickWood"/><item name="oredict:cobblestone"/><item name="stickWood"/>
+        <item name="oredict:cobblestone"/><item /><item name="oredict:cobblestone"/>
+        <item name="stickWood"/><item name="oredict:cobblestone"/><item name="stickWood"/>
+      </grid>
+      <output name="GEAR"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item name="stickWood"/><item name="oredict:cobblestone"/><item name="stickWood"/>
+        <item name="oredict:cobblestone"/><item name="ingotIron"/><item name="oredict:cobblestone"/>
+        <item name="stickWood"/><item name="oredict:cobblestone"/><item name="stickWood"/>
+      </grid>
+      <output name="GEAR"/>
+    </crafting>
+  </recipe>
+
+  <alias name="CAPACITOR_METAL" item="ingotCopper">
+    <dependency item="ingotCopper" reverse="false"/>
+  </alias>
+  <alias name="CAPACITOR_METAL" item="nuggetGold">
+    <dependency item="ingotCopper" reverse="true"/>
+  </alias>
+
+  <recipe name="Capacitor 1" required="true">
+    <crafting>
+      <level maxlevel="1"/>
+      <grid>
+        <item /><item name="dustRedstone"/><item name="nuggetGold"/>
+        <item name="dustRedstone"/><item name="ingotIron"/><item name="dustRedstone"/>
+        <item name="nuggetGold"/><item name="dustRedstone"/><item />
+      </grid>
+      <output name="CAPACITOR1"/>
+    </crafting>
+    <crafting>
+      <level minlevel="2" maxlevel="2"/>
+      <grid>
+        <item /><item name="dustRedstone"/><item name="nuggetGold"/>
+        <item name="dustRedstone"/><item name="CAPACITOR_METAL"/><item name="dustRedstone"/>
+        <item name="nuggetGold"/><item name="dustRedstone"/><item />
+      </grid>
+      <output name="CAPACITOR1"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item /><item name="dustRedstone"/><item name="ingotGold"/>
+        <item name="dustRedstone"/><item name="CAPACITOR_METAL"/><item name="dustRedstone"/>
+        <item name="ingotGold"/><item name="dustRedstone"/><item />
+      </grid>
+      <output name="CAPACITOR1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Capacitor 2" required="true">
+    <crafting>
+      <level maxlevel="2"/>
+      <grid>
+        <item /><item name="ENERGETIC_ALLOY"/><item />
+        <item name="CAPACITOR1"/><item name="dustCoal"/><item name="CAPACITOR1"/>
+        <item /><item name="ENERGETIC_ALLOY"/><item />
+      </grid>
+      <output name="CAPACITOR2"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item name="ENERGETIC_ALLOY"/><item name="ENERGETIC_ALLOY"/><item name="ENERGETIC_ALLOY"/>
+        <item name="CAPACITOR1"/><item name="dustCoal"/><item name="CAPACITOR1"/>
+        <item name="ENERGETIC_ALLOY"/><item name="ENERGETIC_ALLOY"/><item name="ENERGETIC_ALLOY"/>
+      </grid>
+      <output name="CAPACITOR2"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Capacitor 3" required="true">
+    <crafting>
+      <level maxlevel="1"/>
+      <grid>
+        <item /><item name="VIBRANT_ALLOY"/><item />
+        <item name="CAPACITOR2"/><item name="oredict:dustGlowstone"/><item name="CAPACITOR2"/>
+        <item /><item name="VIBRANT_ALLOY"/><item />
+      </grid>
+      <output name="CAPACITOR3"/>
+    </crafting>
+    <crafting>
+      <level minlevel="2" maxlevel="2"/>
+      <grid>
+        <item /><item name="VIBRANT_ALLOY"/><item />
+        <item name="CAPACITOR2"/><item name="oredict:glowstone"/><item name="CAPACITOR2"/>
+        <item /><item name="VIBRANT_ALLOY"/><item />
+      </grid>
+      <output name="CAPACITOR3"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item name="VIBRANT_ALLOY"/><item name="VIBRANT_ALLOY"/><item name="VIBRANT_ALLOY"/>
+        <item name="CAPACITOR2"/><item name="oredict:glowstone"/><item name="CAPACITOR2"/>
+        <item name="VIBRANT_ALLOY"/><item name="VIBRANT_ALLOY"/><item name="VIBRANT_ALLOY"/>
+      </grid>
+      <output name="CAPACITOR3"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Weather Crystal" required="true">
+    <crafting>
+      <grid>
+        <item /><item name="PULSATING_CRYSTAL"/><item />
+        <item name="VIBRANT_CRYSTAL"/><item name="ENDER_CRYSTAL"/><item name="VIBRANT_CRYSTAL"/>
+        <item /><item name="PULSATING_CRYSTAL"/><item />
+      </grid>
+      <output name="WEATHER_CRYSTAL"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Reinforced Obsidian" required="true">
+    <config name="reinforcedObsidianEnabled" section="Item Enabling" value="true"/>
+    <crafting>
+      <level maxlevel="2"/>
+      <grid>
+        <item name="DARK_STEEL"/><item name="enderio:blockDarkIronBars"/><item name="DARK_STEEL"/>
+        <item name="enderio:blockDarkIronBars"/><item name="oredict:obsidian"/><item name="enderio:blockDarkIronBars"/>
+        <item name="DARK_STEEL"/><item name="enderio:blockDarkIronBars"/><item name="DARK_STEEL"/>
+      </grid>
+      <output name="enderio:blockReinforcedObsidian"/>
+    </crafting>
+    <crafting>
+      <level minlevel="3"/>
+      <grid>
+        <item name="DARK_STEEL_BLOCK"/><item name="enderio:blockDarkIronBars"/><item name="DARK_STEEL_BLOCK"/>
+        <item name="enderio:blockDarkIronBars"/><item name="oredict:obsidian"/><item name="enderio:blockDarkIronBars"/>
+        <item name="DARK_STEEL_BLOCK"/><item name="enderio:blockDarkIronBars"/><item name="DARK_STEEL_BLOCK"/>
+      </grid>
+      <output name="enderio:blockReinforcedObsidian"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Anvil" required="true">
+    <crafting>
+      <grid>
+        <item name="DARK_STEEL_BLOCK"/><item name="DARK_STEEL_BLOCK"/><item name="DARK_STEEL_BLOCK"/>
+        <item/><item name="DARK_STEEL"/><item/>
+        <item name="DARK_STEEL"/><item name="DARK_STEEL"/><item name="DARK_STEEL"/>
+      </grid>
+      <output name="enderio:blockDarkSteelAnvil"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Dark Steel Ladder" required="true">
+    <crafting>
+      <grid size="1x3">
+        <item name="enderio:blockDarkIronBars"/>
+        <item name="enderio:blockDarkIronBars"/>
+        <item name="enderio:blockDarkIronBars"/>
+      </grid>
+      <output name="enderio:blockDarkSteelLadder" amount="12"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Bread" required="true">
+    <smelting exp="0.35">
+      <input name="dustWheat"/>
+      <output name="minecraft:bread"/>
+    </smelting>
+  </recipe>
+
+  <recipe name="Enderios" required="true">
+    <crafting>
+      <shapeless>
+        <item name="minecraft:bowl"/><item name="minecraft:milk_bucket"/><item name="cropWheat"/><item name="nuggetEnderpearl"/>
+      </shapeless>
+      <output name="enderio:itemEnderFood:0"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Copper" required="false">
+    <smelting>
+      <input name="enderio:itemPowderIngot:3"/>
+      <output name="ingotCopper"/>
+    </smelting>
+  </recipe>
+
+  <recipe name="Tin" required="false">
+    <smelting>
+      <input name="enderio:itemPowderIngot:4"/>
+      <output name="ingotTin"/>
+    </smelting>
+  </recipe>
+
+  <recipe name="Chassis Parts" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron"/><item name="ingotIron"/><item name="ingotIron"/>
+        <item name="ingotIron"/><item name="CHASSIS"/><item name="ingotIron"/>
+        <item name="ingotIron"/><item name="ingotIron"/><item name="ingotIron"/>
+      </grid>
+      <output name="CHASSIPARTS" amount="16"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/0" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="CHASSIPARTS"/><item />
+        <item name="CHASSIPARTS"/><item /><item name="CHASSIPARTS"/>
+        <item /><item name="CHASSIPARTS"/><item />
+      </grid>
+      <output name="enderio:blockDecoration1:0" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/1 a" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="ingotIron"/><item />
+        <item name="ingotIron"/><item name="enderio:blockDecoration1:0"/><item name="ingotIron"/>
+        <item /><item name="ingotIron"/><item />
+      </grid>
+      <output name="enderio:blockDecoration1:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/1 b" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CHASSIPARTS"/><item name="ingotIron"/><item name="CHASSIPARTS"/>
+        <item name="ingotIron"/><item /><item name="ingotIron"/>
+        <item name="CHASSIPARTS"/><item name="ingotIron"/><item name="CHASSIPARTS"/>
+      </grid>
+      <output name="enderio:blockDecoration1:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/1 c" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="ingotIron"/><item name="CHASSIPARTS"/><item name="ingotIron"/>
+        <item name="CHASSIPARTS"/><item /><item name="CHASSIPARTS"/>
+        <item name="ingotIron"/><item name="CHASSIPARTS"/><item name="ingotIron"/>
+      </grid>
+      <output name="enderio:blockDecoration1:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/1 d" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:6"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/2" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:2" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/3" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:2"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:3" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/4" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:3"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:4" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/5" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:4"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:5" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/6" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:5"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:6" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/7 a" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="SOULARIUM"/><item />
+        <item name="SOULARIUM"/><item name="enderio:blockDecoration1:0"/><item name="SOULARIUM"/>
+        <item /><item name="SOULARIUM"/><item />
+      </grid>
+      <output name="enderio:blockDecoration1:7" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/7 b" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CHASSIPARTS"/><item name="SOULARIUM"/><item name="CHASSIPARTS"/>
+        <item name="SOULARIUM"/><item /><item name="SOULARIUM"/>
+        <item name="CHASSIPARTS"/><item name="SOULARIUM"/><item name="CHASSIPARTS"/>
+      </grid>
+      <output name="enderio:blockDecoration1:7" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/7 c" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="SOULARIUM"/><item name="CHASSIPARTS"/><item name="SOULARIUM"/>
+        <item name="CHASSIPARTS"/><item /><item name="CHASSIPARTS"/>
+        <item name="SOULARIUM"/><item name="CHASSIPARTS"/><item name="SOULARIUM"/>
+      </grid>
+      <output name="enderio:blockDecoration1:7" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/7 d" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:12"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:7" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/8" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:7"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:8" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/9" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:8"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:9" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/10" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:9"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:10" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/11" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:10"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:11" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/12" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:11"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:12" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/13" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="oredict:dyeRed"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:13" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/1 f" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:13"/><item name="minecraft:water_bucket"/>
+      </shapeless>
+      <output name="enderio:blockDecoration1:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/14 a" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="barsIron"/><item />
+        <item name="barsIron"/><item name="enderio:blockDecoration1:0"/><item name="barsIron"/>
+        <item /><item name="barsIron"/><item />
+      </grid>
+      <output name="enderio:blockDecoration1:14" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/14 b" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CHASSIPARTS"/><item name="barsIron"/><item name="CHASSIPARTS"/>
+        <item name="barsIron"/><item /><item name="barsIron"/>
+        <item name="CHASSIPARTS"/><item name="barsIron"/><item name="CHASSIPARTS"/>
+      </grid>
+      <output name="enderio:blockDecoration1:14" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/14 c" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="barsIron"/><item name="CHASSIPARTS"/><item name="barsIron"/>
+        <item name="CHASSIPARTS"/><item /><item name="CHASSIPARTS"/>
+        <item name="barsIron"/><item name="CHASSIPARTS"/><item name="barsIron"/>
+      </grid>
+      <output name="enderio:blockDecoration1:14" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/15 a" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item /><item name="FUSED_GLASS"/><item />
+        <item name="FUSED_GLASS"/><item name="enderio:blockDecoration1:0"/><item name="FUSED_GLASS"/>
+        <item /><item name="FUSED_GLASS"/><item />
+      </grid>
+      <output name="enderio:blockDecoration1:15" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/15 b" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="CHASSIPARTS"/><item name="FUSED_GLASS"/><item name="CHASSIPARTS"/>
+        <item name="FUSED_GLASS"/><item /><item name="FUSED_GLASS"/>
+        <item name="CHASSIPARTS"/><item name="FUSED_GLASS"/><item name="CHASSIPARTS"/>
+      </grid>
+      <output name="enderio:blockDecoration1:15" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 1/15 c" required="true">
+    <crafting>
+      <grid size="3x3">
+        <item name="FUSED_GLASS"/><item name="CHASSIPARTS"/><item name="FUSED_GLASS"/>
+        <item name="CHASSIPARTS"/><item /><item name="CHASSIPARTS"/>
+        <item name="FUSED_GLASS"/><item name="CHASSIPARTS"/><item name="FUSED_GLASS"/>
+      </grid>
+      <output name="enderio:blockDecoration1:15" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/0" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="minecraft:furnace"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:0" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/1" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="chestWood"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:1" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/2" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="CHASSIS"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:2" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/3" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration2:1"/><item name="enderio:blockDecoration2:2"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:3" amount="2"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/4" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration2:3"/><item name="netherStar"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:4" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/5" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="workbench"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:5" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/6" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="gemDiamond"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:6" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/7" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="enderio:itemPowerConduit:0"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:7" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/8" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="itemFlint"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:8" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/9" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:7"/><item name="minecraft:iron_axe"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:9" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/10" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="GEAR"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:10" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/11" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:15"/><item name="barsIron"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:11" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/12" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:15"/><item name="enderio:blockDarkIronBars"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:12" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/13" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="CONDUIT_BINDER"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:13" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/14" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="ingotIron"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:14" amount="1"/>
+    </crafting>
+  </recipe>
+
+  <recipe name="Deco Block 2/15" required="true">
+    <crafting>
+      <shapeless>
+        <item name="enderio:blockDecoration1:1"/><item name="CAPACITOR1"/>
+      </shapeless>
+      <output name="enderio:blockDecoration2:15" amount="1"/>
+    </crafting>
+  </recipe>
+
+</enderio:recipes>

src/config/enderio/recipe_materials_user.xml

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<enderio:recipes xmlns:enderio="http://enderio.com/recipes" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://enderio.com/recipes recipes.xsd ">
+
+</enderio:recipes>

src/config/enderio/recipes.xsd

@@ -0,0 +1,378 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<schema targetNamespace="http://enderio.com/recipes" elementFormDefault="unqualified" attributeFormDefault="unqualified"
+  xmlns="http://www.w3.org/2001/XMLSchema" xmlns:enderio="http://enderio.com/recipes">
+
+  <element name="recipes">
+    <complexType>
+      <sequence maxOccurs="unbounded" minOccurs="0">
+        <choice maxOccurs="1" minOccurs="1">
+          <element name="alias">
+                        <annotation>
+                          <documentation>Adds an alias into the system. The alias can be used in following elements just like the value itself. Aliases can be replaced.</documentation>
+                        </annotation>
+                        <complexType>
+              <sequence>
+                <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                    <annotation>
+                                      <documentation>Restricts this alias to only be used if thegiven config value has the given value.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="required" name="section" type="string"></attribute>
+                    <attribute use="required" name="name" type="string"></attribute>
+                    <attribute use="optional" name="value" type="boolean"></attribute>
+                  </complexType>
+                </element>
+                <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                    <annotation>
+                                      <documentation>Restricts this alias to only be used if the given elements descriptor can (not) be found in the game. Use this to prevent replacing good aliases with bad ones.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="required" name="item" type="string"></attribute>
+                    <attribute use="optional" name="reverse" type="boolean"></attribute>
+                  </complexType>
+                </element>
+                <element minOccurs="0" maxOccurs="1" name="level">
+                                    <annotation>
+                                      <documentation>Restricts this alias to only be used if the recipe level is in the given range.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="optional" name="minlevel" type="int"></attribute>
+                    <attribute use="optional" name="maxlevel" type="int"></attribute>
+                  </complexType>
+                </element>
+              </sequence>
+              <attribute name="name" type="string" use="required">
+                <annotation>
+                  <documentation>The name of the alias. You can use anything here, but be aware that you share the namespace with all other game elements.</documentation>
+                </annotation></attribute>
+              <attribute name="item" type="string" use="required">
+                <annotation>
+                  <documentation>A descriptor naming an item, block, ordict or another alias.</documentation>
+                </annotation></attribute>
+            </complexType>
+          </element>
+          <element name="recipe">
+                        <annotation>
+                          <documentation>A single recipe. It can have any number of crafting or any number of smelting variants (no mixing), but at any time only one of them may be active.</documentation>
+                        </annotation>
+                        <complexType>
+              <sequence>
+                <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                    <annotation>
+                                      <documentation>Restricts this recipe to only be used if the given config value has the given value.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="required" name="section" type="string">
+                    </attribute>
+                    <attribute use="required" name="name" type="string">
+                    </attribute>
+                    <attribute use="optional" name="value" type="boolean">
+                    </attribute>
+                  </complexType>
+                </element>
+                <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                    <annotation>
+                                      <documentation>Restricts this recipe to only be used if the given game element can (not) be found in the game.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="required" name="item" type="string">
+                    </attribute>
+                    <attribute use="optional" name="reverse" type="boolean">
+                    </attribute>
+                  </complexType>
+                </element>
+                <element minOccurs="0" maxOccurs="1" name="level">
+                                    <annotation>
+                                      <documentation>Restricts this recipe to only be used if the recipe level is within the given bounds.</documentation>
+                                    </annotation>
+                                    <complexType>
+                    <attribute use="optional" name="minlevel" type="int">
+                    </attribute>
+                    <attribute use="optional" name="maxlevel" type="int">
+                    </attribute>
+                  </complexType>
+                </element>
+                <choice minOccurs="1" maxOccurs="1">
+                  <element minOccurs="1" maxOccurs="unbounded" name="crafting">
+                                        <annotation>
+                                          <documentation>Crafting variants are crafted in a crafting table.</documentation>
+                                        </annotation>
+                                        <complexType>
+                      <sequence>
+                        <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the given config value has the given value.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="section" type="string">
+                            </attribute>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                            <attribute use="optional" name="value" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the given game element can (not) be found in the game.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="item" type="string">
+                            </attribute>
+                            <attribute use="optional" name="reverse" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="level">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the recipe level is within the given bounds.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="optional" name="minlevel" type="int">
+                            </attribute>
+                            <attribute use="optional" name="maxlevel" type="int">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <choice minOccurs="1" maxOccurs="1">
+                          <element minOccurs="1" maxOccurs="1" name="grid">
+                                                        <annotation>
+                                                          <documentation>A grid represents a shaped recipe. All items must be in the exact position they are given here. If the recipe is smaller than 3x3, it may be moved in the grid.</documentation>
+                                                        </annotation>
+                                                        <complexType>
+                              <sequence>
+                                <element minOccurs="1" maxOccurs="9" name="item">
+                                                                    <annotation>
+                                                                      <documentation>An item to be used for crafting.</documentation>
+                                                                    </annotation>
+                                                                    <complexType>
+                                    <attribute use="optional" name="name" type="string">
+                                    </attribute>
+                                  </complexType>
+                                </element>
+                              </sequence>
+                              <attribute use="optional" name="size">
+                                                                <annotation>
+                                                                  <documentation>The size of the grid in the form "width 'x' height". Default is "3x3".</documentation>
+                                                                </annotation>
+                                                                <simpleType>
+                                  <restriction base="string">
+                                    <length value="3"></length>
+                                  </restriction>
+                                </simpleType>
+                              </attribute>
+                            </complexType>
+                          </element>
+                          <element minOccurs="1" maxOccurs="1" name="shapeless">
+                                                        <annotation>
+                                                          <documentation>A shapeless recipe only required the given items to be in the grid, regardless of their position.</documentation>
+                                                        </annotation>
+                                                        <complexType>
+                              <sequence>
+                                <element minOccurs="1" maxOccurs="9" name="item">
+                                                                    <annotation>
+                                                                      <documentation>An item to be used for crafting.</documentation></annotation>
+                                                                    <complexType>
+                                    <attribute use="optional" name="name" type="string">
+                                    </attribute>
+                                  </complexType>
+                                </element>
+                              </sequence>
+                            </complexType>
+                          </element>
+                        </choice>
+                        <element minOccurs="1" maxOccurs="unbounded" name="output">
+                                                    <annotation>
+                                                      <documentation>The result of the crafting.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                                                      <sequence>
+                                                        <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the given config value has the given value.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="section" type="string">
+                            </attribute>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                            <attribute use="optional" name="value" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the given game element can (not) be found in the game.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="item" type="string">
+                            </attribute>
+                            <attribute use="optional" name="reverse" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="level">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the recipe level is within the given bounds.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="optional" name="minlevel" type="int">
+                            </attribute>
+                            <attribute use="optional" name="maxlevel" type="int">
+                            </attribute>
+                          </complexType>
+                        </element>
+                                                      </sequence>
+                                                      <attribute use="required" name="name" type="string"></attribute>
+                                                      <attribute use="optional" name="amount">
+                                                        <simpleType>
+                                                          <restriction base="int">
+                                                            <minInclusive value="1"></minInclusive>
+                                                            <maxInclusive value="64"></maxInclusive>
+                                                          </restriction>
+                                                        </simpleType>
+                                                      </attribute>
+                                                    </complexType>
+                        </element>
+                      </sequence>
+                    </complexType>
+                  </element>
+                  <element minOccurs="1" maxOccurs="unbounded" name="smelting">
+                                        <annotation>
+                                          <documentation>Smelting variants are crafted in a furnace (or alloy smelter in furnace mode).</documentation>
+                                        </annotation>
+                                        <complexType>
+                      <sequence>
+                        <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the given config value has the given value.</documentation></annotation>
+                                                    <complexType>
+                            <attribute use="required" name="section" type="string">
+                            </attribute>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                            <attribute use="optional" name="value" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the given game element can (not) be found in the game.</documentation></annotation>
+                                                    <complexType>
+                            <attribute use="required" name="item" type="string">
+                            </attribute>
+                            <attribute use="optional" name="reverse" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="level">
+                                                    <annotation>
+                                                      <documentation>Restricts this variant to only be used if the recipe level is within the given bounds.</documentation></annotation>
+                                                    <complexType>
+                            <attribute use="optional" name="minlevel" type="int">
+                            </attribute>
+                            <attribute use="optional" name="maxlevel" type="int">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="1" maxOccurs="1" name="input">
+                          <complexType>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="1" maxOccurs="unbounded" name="output">
+                                                    <annotation>
+                                                      <documentation>The result of the smelting.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                                                    <sequence>
+                                                        <element minOccurs="0" maxOccurs="unbounded" name="config">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the given config value has the given value.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="section" type="string">
+                            </attribute>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                            <attribute use="optional" name="value" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="dependency">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the given game element can (not) be found in the game.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="required" name="item" type="string">
+                            </attribute>
+                            <attribute use="optional" name="reverse" type="boolean">
+                            </attribute>
+                          </complexType>
+                        </element>
+                        <element minOccurs="0" maxOccurs="unbounded" name="level">
+                                                    <annotation>
+                                                      <documentation>Restricts this output to only be used if the recipe level is within the given bounds.</documentation>
+                                                    </annotation>
+                                                    <complexType>
+                            <attribute use="optional" name="minlevel" type="int">
+                            </attribute>
+                            <attribute use="optional" name="maxlevel" type="int">
+                            </attribute>
+                          </complexType>
+                        </element>
+                                                      </sequence>
+                            <attribute use="required" name="name" type="string">
+                            </attribute>
+                            <attribute use="optional" name="amount">
+                              <simpleType>
+                                <restriction base="int">
+                                  <minInclusive value="1"></minInclusive>
+                                  <maxInclusive value="64"></maxInclusive>
+                                </restriction>
+                              </simpleType>
+                            </attribute>
+                          </complexType>
+                        </element>
+                      </sequence>
+                      <attribute use="optional" name="exp">
+                                                <annotation>
+                                                  <documentation>The chance to get 1 EXP from the smelting one output item. Note that this is always for one item, regardless of the recipe size. The number must be between 0.0 (for no EXP) and 1.0 for a 100% chance.
+
+If this attribute is missing it's value will be taken from already existing smelting recipes that produce this item (really recommended for stuff that already has vanilla smelting recipes). If there's no existing smelting, it will be 0.
+
+Please note that items have the possibility to override this value.</documentation>
+                                                </annotation>
+                                                <simpleType>
+                          <restriction base="float">
+                            <minInclusive value="0"></minInclusive>
+                            <maxInclusive value="1"></maxInclusive>
+                          </restriction>
+                        </simpleType>
+                      </attribute>
+                    </complexType>
+                  </element>
+                </choice>
+              </sequence>
+              <attribute use="optional" name="required" type="boolean">
+                                <annotation>
+                                  <documentation>If a recipe is required, it is an error if none of its variants is valid.</documentation>
+                                </annotation>
+              </attribute>
+              <attribute use="required" name="name" type="string">
+                <annotation>
+                  <documentation>A display name. Used for error messages only.</documentation>
+                </annotation></attribute>
+              <attribute name="disabled" type="boolean" use="optional">
+                <annotation>
+                  <documentation>If a recipe is disabled it will not be registered and it will not check the validity of its content. Use this in the user file to disable core recipes.</documentation>
+                </annotation></attribute>
+            </complexType>
+          </element>
+        </choice>
+      </sequence>
+    </complexType>
+  </element>
+
+</schema>

src/config/endertanks.cfg

@@ -0,0 +1,128 @@
+# Configuration file
+
+##########################################################################################################
+# color-values
+#--------------------------------------------------------------------------------------------------------#
+# Color Values for Bands,
+# Format: Decimal Values (0 to 16,777,215)
+# You can use this website to get the decimal value of any color:
+# http://www.colorhexa.com
+# Or by using the Color Mixer from this website:
+# http://www.mathsisfun.com/hexadecimal-decimal-colors.html
+# 
+##########################################################################################################
+
+color-values {
+    #  [range: 0 ~ 16777215, default: 2500134]
+    I:Black=2500134
+
+    #  [range: 0 ~ 16777215, default: 3292826]
+    I:Blue=3292826
+
+    #  [range: 0 ~ 16777215, default: 5650466]
+    I:Brown=5650466
+
+    #  [range: 0 ~ 16777215, default: 3373205]
+    I:Cyan=3373205
+
+    #  [range: 0 ~ 16777215, default: 4605510]
+    I:Gray=4605510
+
+    #  [range: 0 ~ 16777215, default: 3821086]
+    I:Green=3821086
+
+    #  [range: 0 ~ 16777215, default: 8296912]
+    I:LightBlue=8296912
+
+    #  [range: 0 ~ 16777215, default: 11120559]
+    I:LightGray=11120559
+
+    #  [range: 0 ~ 16777215, default: 4832573]
+    I:Lime=4832573
+
+    #  [range: 0 ~ 16777215, default: 12411333]
+    I:Magenta=12411333
+
+    #  [range: 0 ~ 16777215, default: 14517579]
+    I:Orange=14517579
+
+    #  [range: 0 ~ 16777215, default: 14195370]
+    I:Pink=14195370
+
+    #  [range: 0 ~ 16777215, default: 8996546]
+    I:Purple=8996546
+
+    #  [range: 0 ~ 16777215, default: 10828341]
+    I:Red=10828341
+
+    #  [range: 0 ~ 16777215, default: 16777215]
+    I:White=16777215
+
+    #  [range: 0 ~ 16777215, default: 12892206]
+    I:Yellow=12892206
+}
+
+
+##########################################################################################################
+# upgrade-items
+#--------------------------------------------------------------------------------------------------------#
+# Items used to upgrade the EnderTanks
+##########################################################################################################
+
+upgrade-items {
+    # Items Listed upgrade storage capacity by 'LargeCapacityUpgrade'
+    #  [default: [minecraft:ender_eye]]
+    S:LargeCapacity <
+        minecraft:ender_eye
+     >
+
+    # Items Listed are used to make the tanks personal
+    #  [default: [ore:gemDiamond]]
+    S:Personal <
+        ore:gemDiamond
+     >
+
+    # Items Listed are used to increase the tanks internal pump
+    #  [default: [minecraft:piston]]
+    S:Pump <
+        minecraft:piston
+     >
+
+    # Items Listed upgrade storage capacity by 'SmallCapacityUpgrade'
+    #  [default: [ore:enderpearl]]
+    S:SmallCapacity <
+        ore:enderpearl
+     >
+}
+
+
+##########################################################################################################
+# upgrade-settings
+#--------------------------------------------------------------------------------------------------------#
+# NOTE: Capacity numbers are in buckets
+##########################################################################################################
+
+upgrade-settings {
+    # Maximum capacity an EnderTank holds.
+    #  [range: 16 ~ 512, default: 256]
+    I:CapacityMax=256
+
+    # Minimum capacity an EnderTank holds.
+    #  [range: 4 ~ 64, default: 32]
+    I:CapacityMin=32
+
+    # Capacity increased by 'LargeCapacity' Items.
+    #  [range: 4 ~ 32, default: 16]
+    I:LargeCapacityUpgrade=16
+
+    # How many internal pump upgrades can a tank have?
+    #  default internal pump is only 1/4 bucket, upgrades make it a bucket per upgrade.
+    #  [range: 0 ~ 8, default: 4]
+    I:PumpUpgrades=4
+
+    # Capacity increased by 'SmallCapacity' Items.
+    #  [range: 2 ~ 16, default: 8]
+    I:SmallCapacityUpgrade=8
+}
+
+

src/config/enderthing.cfg

@@ -0,0 +1,7 @@
+# Configuration file
+
+compatibility {
+    B:ImportCapabilityPrivateData=false
+}
+
+

src/config/environmentaltech/client.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+void_miners {
+    # This will cause the beam to only render when machine is mining. Can flicker fast when machine has speed modifiers. By default it renders when the machine is constructed correctly [default: false]
+    B:PulsatingBeam=false
+}
+
+

src/config/environmentaltech/worldgen.cfg

@@ -0,0 +1,50 @@
+# Configuration file
+
+worldgen {
+    # Max height of Alabaster [range: 0 ~ 255, default: 200]
+    I:alabasterMaxHeight=200
+
+    # Min height of Alabaster [range: 0 ~ 64, default: 40]
+    I:alabasterMinHeight=40
+
+    # Size of each spawn of Alabaster [range: 0 ~ 64, default: 30]
+    I:alabasterNodeSize=30
+
+    # Total spawns of Alabaster in each chunk [range: 0 ~ 32, default: 22]
+    I:alabasterTotalNodes=22
+
+    # Max height of Basalt [range: 0 ~ 255, default: 32]
+    I:basaltMaxHeight=32
+
+    # Min height of Basalt [range: 0 ~ 64, default: 8]
+    I:basaltMinHeight=8
+
+    # Size of each spawn of Basalt [range: 0 ~ 64, default: 28]
+    I:basaltNodeSize=28
+
+    # Total spawns of Basalt in each chunk [range: 0 ~ 32, default: 14]
+    I:basaltTotalNodes=14
+
+    # Enables Generation of Alabaster between world heighs of: 44 and 200 [default: true]
+    B:genAlabaster=true
+
+    # Enables Generation of Basalt between world heighs of: 8 and 32 [default: true]
+    B:genBasalt=true
+
+    # Enables Generation of Hardened Stone between world heighs of: 0 and 12 [default: true]
+    B:genHardenedStone=true
+
+    # Max height of Hardened Stone [range: 0 ~ 255, default: 12]
+    I:hardenedStoneMaxHeight=12
+
+    # Min height of Hardened Stone [range: 0 ~ 64, default: 0]
+    I:hardenedStoneMinHeight=0
+
+    # Size of each spawn of Hardened Stone [range: 0 ~ 128, default: 30]
+    I:hardenedStoneNodeSize=30
+
+    # Total spawns of Hardened Stone in each chunk [range: 0 ~ 32, default: 12]
+    I:hardenedStoneTotalNodes=12
+}
+
+